From 113e3a1ce8e5068be50945ae40da5b4fc1b76578 Mon Sep 17 00:00:00 2001 From: Oveis Sheibani Date: Thu, 26 Mar 2026 22:20:16 -0500 Subject: [PATCH] PWGCF: Add Lambda-Cascade correlation task --- .../Tasks/CMakeLists.txt | 9 +- .../Tasks/Lambdacascadecorrelation.cxx | 3704 +++++++++++++++++ 2 files changed, 3712 insertions(+), 1 deletion(-) create mode 100644 PWGCF/TwoParticleCorrelations/Tasks/Lambdacascadecorrelation.cxx diff --git a/PWGCF/TwoParticleCorrelations/Tasks/CMakeLists.txt b/PWGCF/TwoParticleCorrelations/Tasks/CMakeLists.txt index 7584e824e6a..49b1a9573a4 100644 --- a/PWGCF/TwoParticleCorrelations/Tasks/CMakeLists.txt +++ b/PWGCF/TwoParticleCorrelations/Tasks/CMakeLists.txt @@ -96,4 +96,11 @@ o2physics_add_dpl_workflow(eta-dihadron o2physics_add_dpl_workflow(nuclei-balance SOURCES nucleibalance.cxx PUBLIC_LINK_LIBRARIES O2::Framework O2Physics::AnalysisCore O2Physics::PWGCFCore - COMPONENT_NAME Analysis) \ No newline at end of file + COMPONENT_NAME Analysis) + +o2physics_add_dpl_workflow(lambdacascadecorrelation + SOURCES Lambdacascadecorrelation.cxx + PUBLIC_LINK_LIBRARIES O2::Framework O2Physics::AnalysisCore O2Physics::AnalysisCCDB + COMPONENT_NAME Analysis) + + diff --git a/PWGCF/TwoParticleCorrelations/Tasks/Lambdacascadecorrelation.cxx b/PWGCF/TwoParticleCorrelations/Tasks/Lambdacascadecorrelation.cxx new file mode 100644 index 00000000000..dfcb3182d43 --- /dev/null +++ b/PWGCF/TwoParticleCorrelations/Tasks/Lambdacascadecorrelation.cxx @@ -0,0 +1,3704 @@ +// Copyright 2019-2020 CERN and copyright holders of ALICE O2. +// See https://alice-o2.web.cern.ch/copyright for details of the copyright holders. +// All rights not expressly granted are reserved. +// +// This software is distributed under the terms of the GNU General Public +// License v3 (GPL Version 3), copied verbatim in the file "COPYING". +// +// In applying this license CERN does not waive the privileges and immunities +// granted to it by virtue of its status as an Intergovernmental Organization +// or submit itself to any jurisdiction. + +/// \file Lambdacascadecorrelation.cxx +/// \brief Correlation-balance functions of multistrange baryons +/// \author Oveis Sheibani + +#include "PWGLF/DataModel/LFStrangenessTables.h" +#include "PWGLF/Utils/inelGt.h" + +#include "Common/Core/RecoDecay.h" +#include "Common/Core/TrackSelection.h" +#include "Common/Core/trackUtilities.h" +#include "Common/DataModel/Centrality.h" +#include "Common/DataModel/CollisionAssociationTables.h" +#include "Common/DataModel/EventSelection.h" +#include "Common/DataModel/Multiplicity.h" +#include "Common/DataModel/PIDResponseTPC.h" +#include "Common/DataModel/TrackSelectionTables.h" + +#include "CCDB/BasicCCDBManager.h" +#include "CommonConstants/PhysicsConstants.h" +#include "Framework/ASoAHelpers.h" +#include "Framework/AnalysisDataModel.h" +#include "Framework/AnalysisTask.h" +#include "Framework/O2DatabasePDGPlugin.h" +#include "Framework/runDataProcessing.h" +#include "ReconstructionDataFormats/Track.h" + +#include "TDatabasePDG.h" +#include "TPDGCode.h" +#include +#include +#include +#include +#include +#include +#include +#include + +#include +#include +#include +#include +#include +#include +#include + +using namespace o2; +using namespace o2::framework; +using namespace o2::framework::expressions; +using namespace o2::constants::physics; +using namespace o2::constants::math; +using namespace o2::soa; + +// use parameters + cov mat non-propagated, aux info + (extension propagated) +using FullTracksExt = soa::Join; +using FullTracksExtIU = soa::Join; +using FullTracksExtWithPID = soa::Join; +using FullTracksExtIUWithPID = soa::Join; + +namespace o2::aod +{ +namespace cascadeflags +{ +DECLARE_SOA_COLUMN(IsSelected, isSelected, int); //~! +} // namespace cascadeflags +DECLARE_SOA_TABLE(CascadeFlags, "AOD", "CASCADEFLAGS", //! + cascadeflags::IsSelected); +using CascDataExtSelected = soa::Join; +} // namespace o2::aod + +using MyCollisions = soa::Join; +using MyCollisionsMult = soa::Join; +using MyCascades = soa::Filtered; +using LabeledCascades = soa::Join; + +namespace o2::aod +{ +namespace lambdacollision +{ +DECLARE_SOA_COLUMN(Cent, cent, float); +DECLARE_SOA_COLUMN(Mult, mult, float); +DECLARE_SOA_COLUMN(RefCollId, refCollId, int64_t); // <--- 1. Add this line +} // namespace lambdacollision +DECLARE_SOA_TABLE(LambdaCollisions, "AOD", "LAMBDACOLS", o2::soa::Index<>, + lambdacollision::Cent, + lambdacollision::Mult, + lambdacollision::RefCollId, // <--- 2. Add this line + aod::collision::PosX, + aod::collision::PosY, + aod::collision::PosZ); +using LambdaCollision = LambdaCollisions::iterator; + +namespace lambdamcgencollision +{ +DECLARE_SOA_COLUMN(RefMcCollId, refMcCollId, int64_t); // original McCollision global index +} +DECLARE_SOA_TABLE(LambdaMcGenCollisions, "AOD", "LMCGENCOLS", o2::soa::Index<>, + lambdacollision::Cent, + lambdacollision::Mult, + lambdamcgencollision::RefMcCollId, + o2::aod::mccollision::PosX, + o2::aod::mccollision::PosY, + o2::aod::mccollision::PosZ); +using LambdaMcGenCollision = LambdaMcGenCollisions::iterator; + +namespace lambdatrack +{ +DECLARE_SOA_INDEX_COLUMN(LambdaCollision, lambdaCollision); +DECLARE_SOA_COLUMN(Px, px, float); +DECLARE_SOA_COLUMN(Py, py, float); +DECLARE_SOA_COLUMN(Pz, pz, float); +DECLARE_SOA_COLUMN(Pt, pt, float); +DECLARE_SOA_COLUMN(Eta, eta, float); +DECLARE_SOA_COLUMN(Phi, phi, float); +DECLARE_SOA_COLUMN(Rap, rap, float); +DECLARE_SOA_COLUMN(Mass, mass, float); +DECLARE_SOA_COLUMN(PosTrackId, posTrackId, int64_t); +DECLARE_SOA_COLUMN(NegTrackId, negTrackId, int64_t); +DECLARE_SOA_COLUMN(CosPA, cosPA, float); +DECLARE_SOA_COLUMN(DcaDau, dcaDau, float); +DECLARE_SOA_COLUMN(V0Type, v0Type, int8_t); +DECLARE_SOA_COLUMN(V0PrmScd, v0PrmScd, int8_t); +DECLARE_SOA_COLUMN(CorrFact, corrFact, float); +} // namespace lambdatrack +DECLARE_SOA_TABLE(LambdaTracks, "AOD", "LAMBDATRACKS", o2::soa::Index<>, + lambdatrack::LambdaCollisionId, + lambdatrack::Px, + lambdatrack::Py, + lambdatrack::Pz, + lambdatrack::Pt, + lambdatrack::Eta, + lambdatrack::Phi, + lambdatrack::Rap, + lambdatrack::Mass, + lambdatrack::PosTrackId, + lambdatrack::NegTrackId, + lambdatrack::CosPA, + lambdatrack::DcaDau, + lambdatrack::V0Type, + lambdatrack::V0PrmScd, + lambdatrack::CorrFact); +using LambdaTrack = LambdaTracks::iterator; + +namespace lambdatrackext +{ +DECLARE_SOA_COLUMN(LambdaSharingDaughter, lambdaSharingDaughter, bool); +DECLARE_SOA_COLUMN(LambdaSharingDauIds, lambdaSharingDauIds, std::vector); +DECLARE_SOA_COLUMN(TrueLambdaFlag, trueLambdaFlag, bool); +} // namespace lambdatrackext +DECLARE_SOA_TABLE(LambdaTracksExt, "AOD", "LAMBDATRACKSEXT", + lambdatrackext::LambdaSharingDaughter, + lambdatrackext::LambdaSharingDauIds, + lambdatrackext::TrueLambdaFlag); + +using LambdaTrackExt = LambdaTracksExt::iterator; + +namespace lambdamcgentrack +{ +DECLARE_SOA_INDEX_COLUMN(LambdaMcGenCollision, lambdaMcGenCollision); +} +DECLARE_SOA_TABLE(LambdaMcGenTracks, "AOD", "LMCGENTRACKS", o2::soa::Index<>, + lambdamcgentrack::LambdaMcGenCollisionId, + o2::aod::mcparticle::Px, + o2::aod::mcparticle::Py, + o2::aod::mcparticle::Pz, + lambdatrack::Pt, + lambdatrack::Eta, + lambdatrack::Phi, + lambdatrack::Rap, + lambdatrack::Mass, + lambdatrack::PosTrackId, + lambdatrack::NegTrackId, + lambdatrack::V0Type, + lambdatrack::CosPA, + lambdatrack::DcaDau, + lambdatrack::V0PrmScd, + lambdatrack::CorrFact); +using LambdaMcGenTrack = LambdaMcGenTracks::iterator; + +} // namespace o2::aod + +enum CollisionLabels { + kTotColBeforeHasMcCollision = 1, + kTotCol, + kPassSelCol +}; + +enum TrackLabels { + kTracksBeforeHasMcParticle = 1, + kAllV0Tracks, + kV0KShortMassRej, + kNotLambdaNotAntiLambda, + kV0IsBothLambdaAntiLambda, + kNotLambdaAfterSel, + kV0IsLambdaOrAntiLambda, + kPassV0DauTrackSel, + kPassV0KinCuts, + kPassV0TopoSel, + kAllSelPassed, + kPrimaryLambda, + kSecondaryLambda, + kLambdaDauNotMcParticle, + kLambdaNotPrPiMinus, + kAntiLambdaNotAntiPrPiPlus, + kPassTrueLambdaSel, + kEffCorrPtCent, + kEffCorrPtRapCent, + kNoEffCorr, + kPFCorrPtCent, + kPFCorrPtRapCent, + kNoPFCorr, + kGenTotAccLambda, + kGenLambdaNoDau, + kGenLambdaToPrPi +}; + +enum CentEstType { + kCentFT0M = 0, + kCentFV0A +}; + +enum RunType { + kRun3 = 0, + kRun2 +}; + +enum ParticleType { + kLambda = 0, + kAntiLambda +}; + +enum ParticlePairType { + kLambdaAntiLambda = 0, + kLambdaLambda, + kAntiLambdaAntiLambda +}; + +enum ShareDauLambda { + kUniqueLambda = 0, + kLambdaShareDau +}; + +enum RecGenType { + kRec = 0, + kGen +}; + +enum DMCType { + kData = 0, + kMC +}; + +enum CorrHistDim { + OneDimCorr = 1, + TwoDimCorr, + ThreeDimCorr +}; + +enum PrmScdType { + kPrimary = 0, + kSecondary +}; + +enum PrmScdPairType { + kPP = 0, + kPS, + kSP, + kSS +}; + +struct LambdaTableProducer { + + Produces lambdaCollisionTable; + Produces lambdaTrackTable; + Produces lambdaMCGenCollisionTable; + Produces lambdaMCGenTrackTable; + + // Collisions + Configurable cCentEstimator{"cCentEstimator", 0, "Centrality Estimator : 0-FT0M, 1-FV0A"}; + Configurable cMinZVtx{"cMinZVtx", -10.0, "Min VtxZ cut"}; + Configurable cMaxZVtx{"cMaxZVtx", 10.0, "Max VtxZ cut"}; + Configurable cMinMult{"cMinMult", 0., "Minumum Multiplicity"}; + Configurable cMaxMult{"cMaxMult", 100.0, "Maximum Multiplicity"}; + Configurable cSel8Trig{"cSel8Trig", true, "Sel8 (T0A + T0C) Selection Run3"}; + Configurable cInt7Trig{"cInt7Trig", false, "kINT7 MB Trigger"}; + Configurable cSel7Trig{"cSel7Trig", false, "Sel7 (V0A + V0C) Selection Run2"}; + Configurable cTriggerTvxSel{"cTriggerTvxSel", false, "Trigger Time and Vertex Selection"}; + Configurable cTFBorder{"cTFBorder", false, "Timeframe Border Selection"}; + Configurable cNoItsROBorder{"cNoItsROBorder", false, "No ITSRO Border Cut"}; + Configurable cItsTpcVtx{"cItsTpcVtx", false, "ITS+TPC Vertex Selection"}; + Configurable cPileupReject{"cPileupReject", false, "Pileup rejection"}; + Configurable cZVtxTimeDiff{"cZVtxTimeDiff", false, "z-vtx time diff selection"}; + Configurable cIsGoodITSLayers{"cIsGoodITSLayers", false, "Good ITS Layers All"}; + + // Tracks + Configurable cTrackMinPt{"cTrackMinPt", 0.15, "p_{T} minimum"}; + Configurable cTrackMaxPt{"cTrackMaxPt", 999.0, "p_{T} maximum"}; + Configurable cTrackEtaCut{"cTrackEtaCut", 0.8, "Pseudorapidity cut"}; + Configurable cMinTpcCrossedRows{"cMinTpcCrossedRows", 70, "TPC Min Crossed Rows"}; + Configurable cMinTpcCROverCls{"cMinTpcCROverCls", 0.8, "Tpc Min Crossed Rows Over Findable Clusters"}; + Configurable cMaxTpcSharedClusters{"cMaxTpcSharedClusters", 0.4, "Tpc Max Shared Clusters"}; + Configurable cMaxChi2Tpc{"cMaxChi2Tpc", 4, "Max Chi2 Tpc"}; + Configurable cTpcNsigmaCut{"cTpcNsigmaCut", 3.0, "TPC NSigma Selection Cut"}; + Configurable cRemoveAmbiguousTracks{"cRemoveAmbiguousTracks", false, "Remove Ambiguous Tracks"}; + + // V0s + Configurable cMinDcaProtonToPV{"cMinDcaProtonToPV", 0.02, "Minimum Proton DCAr to PV"}; + Configurable cMinDcaPionToPV{"cMinDcaPionToPV", 0.06, "Minimum Pion DCAr to PV"}; + Configurable cMinV0DcaDaughters{"cMinV0DcaDaughters", 0., "Minimum DCA between V0 daughters"}; + Configurable cMaxV0DcaDaughters{"cMaxV0DcaDaughters", 1., "Maximum DCA between V0 daughters"}; + Configurable cMinDcaV0ToPV{"cMinDcaV0ToPV", 0.0, "Minimum DCA V0 to PV"}; + Configurable cMaxDcaV0ToPV{"cMaxDcaV0ToPV", 999.0, "Maximum DCA V0 to PV"}; + Configurable cMinV0TransRadius{"cMinV0TransRadius", 0.5, "Minimum V0 radius from PV"}; + Configurable cMaxV0TransRadius{"cMaxV0TransRadius", 999.0, "Maximum V0 radius from PV"}; + Configurable cMinV0CTau{"cMinV0CTau", 0.0, "Minimum ctau"}; + Configurable cMaxV0CTau{"cMaxV0CTau", 30.0, "Maximum ctau"}; + Configurable cMinV0CosPA{"cMinV0CosPA", 0.995, "Minimum V0 CosPA to PV"}; + Configurable cKshortRejMassWindow{"cKshortRejMassWindow", 0.01, "Reject K0Short Candidates"}; + Configurable cKshortRejFlag{"cKshortRejFlag", true, "K0short Mass Rej Flag"}; + + // V0s kinmatic acceptance + Configurable cMinV0Mass{"cMinV0Mass", 1.10, "V0 Mass Min"}; + Configurable cMaxV0Mass{"cMaxV0Mass", 1.12, "V0 Mass Min"}; + Configurable cMinV0Pt{"cMinV0Pt", 0.8, "Minimum V0 pT"}; + Configurable cMaxV0Pt{"cMaxV0Pt", 4.2, "Minimum V0 pT"}; + Configurable cMaxV0Rap{"cMaxV0Rap", 0.5, "|rap| cut"}; + Configurable cDoEtaAnalysis{"cDoEtaAnalysis", false, "Do Eta Analysis"}; + Configurable cV0TypeSelFlag{"cV0TypeSelFlag", false, "V0 Type Selection Flag"}; + Configurable cV0TypeSelection{"cV0TypeSelection", 1, "V0 Type Selection"}; + + // V0s MC + Configurable cHasMcFlag{"cHasMcFlag", true, "Has Mc Tag"}; + Configurable cSelectTrueLambda{"cSelectTrueLambda", true, "Select True Lambda"}; + Configurable cSelMCPSV0{"cSelMCPSV0", true, "Select Primary/Secondary V0"}; + Configurable cCheckRecoDauFlag{"cCheckRecoDauFlag", true, "Check for reco daughter PID"}; + Configurable cGenPrimaryLambda{"cGenPrimaryLambda", true, "Primary Generated Lambda"}; + Configurable cGenSecondaryLambda{"cGenSecondaryLambda", false, "Secondary Generated Lambda"}; + Configurable cGenDecayChannel{"cGenDecayChannel", true, "Gen Level Decay Channel Flag"}; + Configurable cRecoMomResoFlag{"cRecoMomResoFlag", false, "Check effect of momentum space smearing on balance function"}; + + // Efficiency Correction + Configurable cCorrectionFlag{"cCorrectionFlag", false, "Correction Flag"}; + Configurable cGetEffFact{"cGetEffFact", false, "Get Efficiency Factor Flag"}; + Configurable cGetPrimFrac{"cGetPrimFrac", false, "Get Primary Fraction Flag"}; + Configurable cCorrFactHist{"cCorrFactHist", 0, "Efficiency Factor Histogram"}; + Configurable cPrimFracHist{"cPrimFracHist", 0, "Primary Fraction Histogram"}; + + // CCDB + Configurable cUrlCCDB{"cUrlCCDB", "http://ccdb-test.cern.ch:8080", "url of ccdb"}; + Configurable cPathCCDB{"cPathCCDB", "Users/y/ypatley/lambda_corr_fact", "Path for ccdb-object"}; + + // Initialize CCDB Service + Service ccdb; + + // Histogram Registry. + HistogramRegistry histos{"histos", {}, OutputObjHandlingPolicy::AnalysisObject}; + + // initialize corr_factor objects + std::vector> vCorrFactStrings = {{"hEffVsPtCentLambda", "hEffVsPtCentAntiLambda"}, + {"hEffVsPtYCentLambda", "hEffVsPtYCentAntiLambda"}, + {"hEffVsPtEtaCentLambda", "hEffVsPtEtaCentAntiLambda"}}; + + // initialize corr_factor objects + std::vector> vPrimFracStrings = {{"hPrimFracVsPtCentLambda", "hPrimFracVsPtCentAntiLambda"}, + {"hPrimFracVsPtYCentLambda", "hPrimFracVsPtYCentAntiLambda"}, + {"hPrimFracVsPtEtaCentLambda", "hPrimFracVsPtEtaCentAntiLambda"}}; + + // Initialize Global Variables + float cent = 0., mult = 0.; + float pt = 0., eta = 0., rap = 0., phi = 0.; + + void init(InitContext const&) + { + // Set CCDB url + ccdb->setURL(cUrlCCDB.value); + ccdb->setCaching(true); + + // initialize axis specifications + const AxisSpec axisCols(5, 0.5, 5.5, ""); + const AxisSpec axisTrks(30, 0.5, 30.5, ""); + const AxisSpec axisCent(100, 0, 100, "FT0M (%)"); + const AxisSpec axisMult(10, 0, 10, "N_{#Lambda}"); + const AxisSpec axisVz(220, -11, 11, "V_{z} (cm)"); + const AxisSpec axisPID(8000, -4000, 4000, "PdgCode"); + + const AxisSpec axisV0Mass(140, 1.08, 1.15, "M_{p#pi} (GeV/#it{c}^{2})"); + const AxisSpec axisV0Pt(100., 0., 10., "p_{T} (GeV/#it{c})"); + const AxisSpec axisV0Rap(48, -1.2, 1.2, "y"); + const AxisSpec axisV0Eta(48, -1.2, 1.2, "#eta"); + const AxisSpec axisV0Phi(36, 0., TwoPI, "#phi (rad)"); + + const AxisSpec axisRadius(2000, 0, 200, "r(cm)"); + const AxisSpec axisCosPA(300, 0.97, 1.0, "cos(#theta_{PA})"); + const AxisSpec axisDcaV0PV(1000, 0., 10., "dca (cm)"); + const AxisSpec axisDcaProngPV(5000, -50., 50., "dca (cm)"); + const AxisSpec axisDcaDau(75, 0., 1.5, "Daug DCA (#sigma)"); + const AxisSpec axisCTau(2000, 0, 200, "c#tau (cm)"); + const AxisSpec axisGCTau(2000, 0, 200, "#gammac#tau (cm)"); + const AxisSpec axisAlpha(40, -1, 1, "#alpha"); + const AxisSpec axisQtarm(40, 0, 0.4, "q_{T}"); + + const AxisSpec axisTrackPt(40, 0, 4, "p_{T} (GeV/#it{c})"); + const AxisSpec axisTrackDCA(200, -1, 1, "dca_{XY} (cm)"); + const AxisSpec axisMomPID(80, 0, 4, "p (GeV/#it{c})"); + const AxisSpec axisNsigma(401, -10.025, 10.025, {"n#sigma"}); + const AxisSpec axisdEdx(360, 20, 200, "#frac{dE}{dx}"); + + // Create Histograms. + // Event histograms + histos.add("Events/h1f_collisions_info", "# of Collisions", kTH1F, {axisCols}); + histos.add("Events/h1f_collision_posZ", "V_{z}-distribution", kTH1F, {axisVz}); + + // QA + histos.add("Tracks/h1f_tracks_info", "# of tracks", kTH1F, {axisTrks}); + histos.add("Tracks/h2f_armpod_before_sel", "Armentros-Podolanski Plot", kTH2F, {axisAlpha, axisQtarm}); + histos.add("Tracks/h2f_armpod_after_sel", "Armentros-Podolanski Plot", kTH2F, {axisAlpha, axisQtarm}); + histos.add("Tracks/h1f_lambda_pt_vs_invm", "p_{T} vs M_{#Lambda}", kTH2F, {axisV0Mass, axisV0Pt}); + histos.add("Tracks/h1f_antilambda_pt_vs_invm", "p_{T} vs M_{#bar{#Lambda}}", kTH2F, {axisV0Mass, axisV0Pt}); + + // QA Lambda + histos.add("QA/Lambda/h2f_qt_vs_alpha", "Armentros-Podolanski Plot", kTH2F, {axisAlpha, axisQtarm}); + histos.add("QA/Lambda/h1f_dca_V0_daughters", "DCA between V0 daughters", kTH1F, {axisDcaDau}); + histos.add("QA/Lambda/h1f_dca_pos_to_PV", "DCA positive prong to PV", kTH1F, {axisDcaProngPV}); + histos.add("QA/Lambda/h1f_dca_neg_to_PV", "DCA negative prong to PV", kTH1F, {axisDcaProngPV}); + histos.add("QA/Lambda/h1f_dca_V0_to_PV", "DCA V0 to PV", kTH1F, {axisDcaV0PV}); + histos.add("QA/Lambda/h1f_V0_cospa", "cos(#theta_{PA})", kTH1F, {axisCosPA}); + histos.add("QA/Lambda/h1f_V0_radius", "V_{0} Decay Radius in XY plane", kTH1F, {axisRadius}); + histos.add("QA/Lambda/h1f_V0_ctau", "V_{0} c#tau", kTH1F, {axisCTau}); + histos.add("QA/Lambda/h1f_V0_gctau", "V_{0} #gammac#tau", kTH1F, {axisGCTau}); + + histos.add("QA/Lambda/h1f_pos_prong_pt", "Pos-Prong p_{T}", kTH1F, {axisTrackPt}); + histos.add("QA/Lambda/h1f_neg_prong_pt", "Neg-Prong p_{T}", kTH1F, {axisTrackPt}); + histos.add("QA/Lambda/h1f_pos_prong_eta", "Pos-Prong #eta-distribution", kTH1F, {axisV0Eta}); + histos.add("QA/Lambda/h1f_neg_prong_eta", "Neg-Prong #eta-distribution", kTH1F, {axisV0Eta}); + histos.add("QA/Lambda/h1f_pos_prong_phi", "Pos-Prong #phi-distribution", kTH1F, {axisV0Phi}); + histos.add("QA/Lambda/h1f_neg_prong_phi", "Neg-Prong #phi-distribution", kTH1F, {axisV0Phi}); + + histos.add("QA/Lambda/h2f_pos_prong_dcaXY_vs_pt", "DCA vs p_{T}", kTH2F, {axisTrackPt, axisTrackDCA}); + histos.add("QA/Lambda/h2f_neg_prong_dcaXY_vs_pt", "DCA vs p_{T}", kTH2F, {axisTrackPt, axisTrackDCA}); + histos.add("QA/Lambda/h2f_pos_prong_dEdx_vs_p", "TPC Signal Pos-Prong", kTH2F, {axisMomPID, axisdEdx}); + histos.add("QA/Lambda/h2f_neg_prong_dEdx_vs_p", "TPC Signal Neg-Prong", kTH2F, {axisMomPID, axisdEdx}); + histos.add("QA/Lambda/h2f_pos_prong_tpc_nsigma_pr_vs_p", "TPC n#sigma Pos Prong", kTH2F, {axisMomPID, axisNsigma}); + histos.add("QA/Lambda/h2f_neg_prong_tpc_nsigma_pr_vs_p", "TPC n#sigma Neg Prong", kTH2F, {axisMomPID, axisNsigma}); + histos.add("QA/Lambda/h2f_pos_prong_tpc_nsigma_pi_vs_p", "TPC n#sigma Pos Prong", kTH2F, {axisMomPID, axisNsigma}); + histos.add("QA/Lambda/h2f_neg_prong_tpc_nsigma_pi_vs_p", "TPC n#sigma Neg Prong", kTH2F, {axisMomPID, axisNsigma}); + + // Kinematic Histograms + histos.add("McRec/Lambda/hPt", "Transverse Momentum", kTH1F, {axisV0Pt}); + histos.add("McRec/Lambda/hEta", "Pseudorapidity", kTH1F, {axisV0Eta}); + histos.add("McRec/Lambda/hRap", "Rapidity", kTH1F, {axisV0Rap}); + histos.add("McRec/Lambda/hPhi", "Azimuthal Angle", kTH1F, {axisV0Phi}); + + // QA Anti-Lambda + histos.addClone("QA/Lambda/", "QA/AntiLambda/"); + histos.addClone("McRec/Lambda/", "McRec/AntiLambda/"); + + // MC Generated Histograms + if (doprocessMCRun3 || doprocessMCRun2 || doprocessMCRecoRun3 || doprocessMCRecoRun2) { + // McReco Histos + histos.add("Tracks/h2f_tracks_pid_before_sel", "PIDs", kTH2F, {axisPID, axisV0Pt}); + histos.add("Tracks/h2f_tracks_pid_after_sel", "PIDs", kTH2F, {axisPID, axisV0Pt}); + histos.add("Tracks/h2f_lambda_mothers_pdg", "PIDs", kTH2F, {axisPID, axisV0Pt}); + + // McGen Histos + histos.add("McGen/h1f_collision_recgen", "# of Reco Collision Associated to One Mc Generator Collision", kTH1F, {axisMult}); + histos.add("McGen/h1f_collisions_info", "# of collisions", kTH1F, {axisCols}); + histos.add("McGen/h2f_collision_posZ", "V_{z}-distribution", kTH2F, {axisVz, axisVz}); + histos.add("McGen/h2f_collision_cent", "FT0M Centrality", kTH2F, {axisCent, axisCent}); + histos.add("McGen/h1f_lambda_daughter_PDG", "PDG Daughters", kTH1F, {axisPID}); + histos.add("McGen/h1f_antilambda_daughter_PDG", "PDG Daughters", kTH1F, {axisPID}); + + histos.addClone("McRec/", "McGen/"); + + histos.add("McGen/Lambda/Proton/hPt", "Proton p_{T}", kTH1F, {axisTrackPt}); + histos.add("McGen/Lambda/Proton/hEta", "Proton #eta", kTH1F, {axisV0Eta}); + histos.add("McGen/Lambda/Proton/hRap", "Proton y", kTH1F, {axisV0Rap}); + histos.add("McGen/Lambda/Proton/hPhi", "Proton #phi", kTH1F, {axisV0Phi}); + + histos.addClone("McGen/Lambda/Proton/", "McGen/Lambda/Pion/"); + histos.addClone("McGen/Lambda/Proton/", "McGen/AntiLambda/Proton/"); + histos.addClone("McGen/Lambda/Pion/", "McGen/AntiLambda/Pion/"); + + // set bin lables specific to MC + histos.get(HIST("Events/h1f_collisions_info"))->GetXaxis()->SetBinLabel(CollisionLabels::kTotColBeforeHasMcCollision, "kTotColBeforeHasMcCollision"); + histos.get(HIST("McGen/h1f_collisions_info"))->GetXaxis()->SetBinLabel(CollisionLabels::kTotCol, "kTotCol"); + histos.get(HIST("McGen/h1f_collisions_info"))->GetXaxis()->SetBinLabel(CollisionLabels::kPassSelCol, "kPassSelCol"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kTracksBeforeHasMcParticle, "kTracksBeforeHasMcParticle"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kPrimaryLambda, "kPrimaryLambda"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kSecondaryLambda, "kSecondaryLambda"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kLambdaDauNotMcParticle, "kLambdaDauNotMcParticle"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kLambdaNotPrPiMinus, "kLambdaNotPrPiMinus"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kAntiLambdaNotAntiPrPiPlus, "kAntiLambdaNotAntiPrPiPlus"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kPassTrueLambdaSel, "kPassTrueLambdaSel"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kGenTotAccLambda, "kGenTotAccLambda"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kGenLambdaNoDau, "kGenLambdaNoDau"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kGenLambdaToPrPi, "kGenLambdaToPrPi"); + } + + // set bin labels + histos.get(HIST("Events/h1f_collisions_info"))->GetXaxis()->SetBinLabel(CollisionLabels::kTotCol, "kTotCol"); + histos.get(HIST("Events/h1f_collisions_info"))->GetXaxis()->SetBinLabel(CollisionLabels::kPassSelCol, "kPassSelCol"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kAllV0Tracks, "kAllV0Tracks"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kV0KShortMassRej, "kV0KShortMassRej"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kNotLambdaNotAntiLambda, "kNotLambdaNotAntiLambda"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kV0IsBothLambdaAntiLambda, "kV0IsBothLambdaAntiLambda"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kNotLambdaAfterSel, "kNotLambdaAfterSel"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kV0IsLambdaOrAntiLambda, "kV0IsLambdaOrAntiLambda"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kPassV0DauTrackSel, "kPassV0DauTrackSel"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kPassV0KinCuts, "kPassV0KinCuts"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kPassV0TopoSel, "kPassV0TopoSel"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kAllSelPassed, "kAllSelPassed"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kEffCorrPtCent, "kEffCorrPtCent"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kEffCorrPtRapCent, "kEffCorrPtRapCent"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kNoEffCorr, "kNoEffCorr"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kPFCorrPtCent, "kPFCorrPtCent"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kPFCorrPtRapCent, "kPFCorrPtRapCent"); + histos.get(HIST("Tracks/h1f_tracks_info"))->GetXaxis()->SetBinLabel(TrackLabels::kNoPFCorr, "kNoPFCorr"); + } + + template + bool selCollision(C const& col) + { + // VtxZ Selection + if (col.posZ() <= cMinZVtx || col.posZ() >= cMaxZVtx) { + return false; + } + + if constexpr (run == kRun3) { // Run3 Min-Bias Trigger + // select centrality estimator + if (cCentEstimator == kCentFT0M) { + cent = col.centFT0M(); + } else if (cCentEstimator == kCentFV0A) { + cent = col.centFV0A(); + } + if (cSel8Trig && !col.sel8()) { + return false; + } + } else { // Run2 Min-Bias Trigger + cent = col.centRun2V0M(); + if (cInt7Trig && !col.alias_bit(kINT7)) { + return false; + } + if (cSel7Trig && !col.sel7()) { + return false; + } + } + + if (cent <= cMinMult || cent >= cMaxMult) { // select centrality percentile class + return false; + } + + if (cTriggerTvxSel && !col.selection_bit(aod::evsel::kIsTriggerTVX)) { + return false; + } + + if (cTFBorder && !col.selection_bit(aod::evsel::kNoTimeFrameBorder)) { + return false; + } + + if (cNoItsROBorder && !col.selection_bit(aod::evsel::kNoITSROFrameBorder)) { + return false; + } + + if (cItsTpcVtx && !col.selection_bit(aod::evsel::kIsVertexITSTPC)) { + return false; + } + + if (cPileupReject && !col.selection_bit(aod::evsel::kNoSameBunchPileup)) { + return false; + } + + if (cZVtxTimeDiff && !col.selection_bit(aod::evsel::kIsGoodZvtxFT0vsPV)) { + return false; + } + + if (cIsGoodITSLayers && !col.selection_bit(aod::evsel::kIsGoodITSLayersAll)) { + return false; + } + + // Set Multiplicity + mult = col.multNTracksPV(); + + return true; + } + + // Kinematic Selection + bool kinCutSelection(float const& pt, float const& rap, float const& ptMin, float const& ptMax, float const& rapMax) + { + if (pt <= ptMin || pt >= ptMax || rap >= rapMax) { + return false; + } + + return true; + } + + // Track Selection + template + bool selTrack(T const& track) + { + if (!kinCutSelection(track.pt(), std::abs(track.eta()), cTrackMinPt, cTrackMaxPt, cTrackEtaCut)) { + return false; + } + + if (track.tpcNClsCrossedRows() <= cMinTpcCrossedRows) { + return false; + } + + if (track.tpcCrossedRowsOverFindableCls() < cMinTpcCROverCls) { + return false; + } + + if (track.tpcNClsShared() > cMaxTpcSharedClusters) { + return false; + } + + if (track.tpcChi2NCl() > cMaxChi2Tpc) { + return false; + } + + return true; + } + + // Daughter Track Selection + template + bool selDaughterTracks(V const& v0, T const&, ParticleType const& v0Type) + { + auto posTrack = v0.template posTrack_as(); + auto negTrack = v0.template negTrack_as(); + + if (!selTrack(posTrack) || !selTrack(negTrack)) { + return false; + } + + // Apply DCA Selection on Daughter Tracks Based on Lambda/AntiLambda daughters + float dcaProton = 0., dcaPion = 0.; + if (v0Type == kLambda) { + dcaProton = std::abs(v0.dcapostopv()); + dcaPion = std::abs(v0.dcanegtopv()); + } else if (v0Type == kAntiLambda) { + dcaPion = std::abs(v0.dcapostopv()); + dcaProton = std::abs(v0.dcanegtopv()); + } + + if (dcaProton < cMinDcaProtonToPV || dcaPion < cMinDcaPionToPV) { + return false; + } + + return true; + } + + template + bool topoCutSelection(C const& col, V const& v0, T const&) + { + // DCA + if (v0.dcaV0daughters() <= cMinV0DcaDaughters || v0.dcaV0daughters() >= cMaxV0DcaDaughters) { + return false; + } + + if (v0.dcav0topv() <= cMinDcaV0ToPV || v0.dcav0topv() >= cMaxDcaV0ToPV) { + return false; + } + + if (v0.v0radius() <= cMinV0TransRadius || v0.v0radius() >= cMaxV0TransRadius) { + return false; + } + + // ctau + float ctau = v0.distovertotmom(col.posX(), col.posY(), col.posZ()) * MassLambda0; + if (ctau <= cMinV0CTau || ctau >= cMaxV0CTau) { + return false; + } + + // cosine of pointing angle + if (v0.v0cosPA() <= cMinV0CosPA) { + return false; + } + + // all selection criterion passed (Return True) + return true; + } + + template + bool selLambdaDauWithTpcPid(T const& postrack, T const& negtrack) + { + bool returnFlag = false; + float tpcNSigmaPr = 0., tpcNSigmaPi = 0.; + + switch (part) { + // postrack = Proton, negtrack = Pion + case kLambda: + tpcNSigmaPr = postrack.tpcNSigmaPr(); + tpcNSigmaPi = negtrack.tpcNSigmaPi(); + break; + + // negtrack = Proton, postrack = Pion + case kAntiLambda: + tpcNSigmaPr = negtrack.tpcNSigmaPr(); + tpcNSigmaPi = postrack.tpcNSigmaPi(); + break; + } + + if (std::abs(tpcNSigmaPr) < cTpcNsigmaCut && std::abs(tpcNSigmaPi) < cTpcNsigmaCut) { + returnFlag = true; + } + + return returnFlag; + } + + template + bool selLambdaMassWindow(V const& v0, T const&, ParticleType& v0type) + { + // Kshort mass rejection hypothesis + if (cKshortRejFlag && (std::abs(v0.mK0Short() - MassK0Short) <= cKshortRejMassWindow)) { + histos.fill(HIST("Tracks/h1f_tracks_info"), kV0KShortMassRej); + return false; + } + + // initialize daughter tracks + auto postrack = v0.template posTrack_as(); + auto negtrack = v0.template negTrack_as(); + + // initialize selection flags + bool lambdaFlag = false, antiLambdaFlag = false; + + // get v0 track as lambda + if ((v0.mLambda() > cMinV0Mass && v0.mLambda() < cMaxV0Mass) && (selLambdaDauWithTpcPid(postrack, negtrack))) { + lambdaFlag = true; + v0type = kLambda; + } + + // get v0 track as anti-lambda + if ((v0.mAntiLambda() > cMinV0Mass && v0.mAntiLambda() < cMaxV0Mass) && (selLambdaDauWithTpcPid(postrack, negtrack))) { + antiLambdaFlag = true; + v0type = kAntiLambda; + } + + if (!lambdaFlag && !antiLambdaFlag) { // neither Lambda nor Anti-Lambda + histos.fill(HIST("Tracks/h1f_tracks_info"), kNotLambdaNotAntiLambda); + return false; + } else if (lambdaFlag && antiLambdaFlag) { // check if the track is identified as lambda and anti-lambda both (DISCARD THIS TRACK) + histos.fill(HIST("Tracks/h1f_tracks_info"), kV0IsBothLambdaAntiLambda); + return false; + } + + if (lambdaFlag || antiLambdaFlag) { + return true; + } + + histos.fill(HIST("Tracks/h1f_tracks_info"), kNotLambdaAfterSel); + + return false; + } + + template + bool selV0Particle(C const& col, V const& v0, T const& tracks, ParticleType& v0Type) + { + // Apply Lambda Mass Hypothesis + if (!selLambdaMassWindow(v0, tracks, v0Type)) { + return false; + } + + histos.fill(HIST("Tracks/h1f_tracks_info"), kV0IsLambdaOrAntiLambda); + + // Apply Daughter Track Selection + if (!selDaughterTracks(v0, tracks, v0Type)) { + return false; + } + + histos.fill(HIST("Tracks/h1f_tracks_info"), kPassV0DauTrackSel); + + // Apply Kinematic Selection + float rap = 0.; + if (!cDoEtaAnalysis) { + rap = std::abs(v0.yLambda()); + } else { + rap = std::abs(v0.eta()); + } + + if (!kinCutSelection(v0.pt(), rap, cMinV0Pt, cMaxV0Pt, cMaxV0Rap)) { + return false; + } + + histos.fill(HIST("Tracks/h1f_tracks_info"), kPassV0KinCuts); + + // Apply Topological Selection + if (!topoCutSelection(col, v0, tracks)) { + return false; + } + + histos.fill(HIST("Tracks/h1f_tracks_info"), kPassV0TopoSel); + + // All Selection Criterion Passed + return true; + } + + template + bool hasAmbiguousDaughters(V const& v0, T const&) + { + auto posTrack = v0.template posTrack_as(); + auto negTrack = v0.template negTrack_as(); + + auto posTrackCompCols = posTrack.compatibleCollIds(); + auto negTrackCompCols = negTrack.compatibleCollIds(); + + // Check if daughter tracks belongs to more than one collision (Ambiguous Tracks) + if (posTrackCompCols.size() > 1 || negTrackCompCols.size() > 1) { + return true; + } + + // Check if compatible collision index matches the track collision index + if (((posTrackCompCols.size() != 0) && (posTrackCompCols[0] != posTrack.collisionId())) || + ((negTrackCompCols.size() != 0) && (negTrackCompCols[0] != negTrack.collisionId()))) { + return true; + } + + // Pass as not ambiguous + return false; + } + + template + PrmScdType isPrimaryV0(V const& v0) + { + auto mcpart = v0.template mcParticle_as(); + + // check for secondary lambda + if (!mcpart.isPhysicalPrimary()) { + histos.fill(HIST("Tracks/h1f_tracks_info"), kSecondaryLambda); + return kSecondary; + } + + histos.fill(HIST("Tracks/h1f_tracks_info"), kPrimaryLambda); + return kPrimary; + } + + template + bool selTrueMcRecLambda(V const& v0, T const&) + { + auto mcpart = v0.template mcParticle_as(); + + // check if Lambda/AntiLambda + if (std::abs(mcpart.pdgCode()) != kLambda0) { + return false; + } + + // Check for daughters + if (cCheckRecoDauFlag) { + auto postrack = v0.template posTrack_as(); + auto negtrack = v0.template negTrack_as(); + + // check if the daughters have corresponding mcparticle + if (!postrack.has_mcParticle() || !negtrack.has_mcParticle()) { + histos.fill(HIST("Tracks/h1f_tracks_info"), kLambdaDauNotMcParticle); + return false; + } + + auto mcpostrack = postrack.template mcParticle_as(); + auto mcnegtrack = negtrack.template mcParticle_as(); + + if (mcpart.pdgCode() == kLambda0) { + if (mcpostrack.pdgCode() != kProton || mcnegtrack.pdgCode() != kPiMinus) { + histos.fill(HIST("Tracks/h1f_tracks_info"), kLambdaNotPrPiMinus); + return false; + } + } else if (mcpart.pdgCode() == kLambda0Bar) { + if (mcpostrack.pdgCode() != kPiPlus || mcnegtrack.pdgCode() != kProtonBar) { + histos.fill(HIST("Tracks/h1f_tracks_info"), kAntiLambdaNotAntiPrPiPlus); + return false; + } + } + } + + return true; + } + + template + float getCorrectionFactors(V const& v0) + { + // Check for efficiency correction flag + if (!cCorrectionFlag) { + return 1.; + } + + // Get from CCDB + auto ccdbObj = ccdb->getForTimeStamp(cPathCCDB.value, -1); + + // Check CCDB Object + if (!ccdbObj) { + LOGF(warning, "CCDB OBJECT NOT FOUND"); + return 1.; + } + + // initialize efficiency factor and primary fraction values + float effCorrFact = 1., primFrac = 1.; + float rap = (cDoEtaAnalysis) ? v0.eta() : v0.yLambda(); + + // Get Efficiency Factor + if (cGetEffFact) { + TObject* objEff = reinterpret_cast(ccdbObj->FindObject(Form("%s", vCorrFactStrings[cCorrFactHist][part].c_str()))); + TH1F* histEff = reinterpret_cast(objEff->Clone()); + if (histEff->GetDimension() == TwoDimCorr) { + histos.fill(HIST("Tracks/h1f_tracks_info"), kEffCorrPtCent); + effCorrFact = histEff->GetBinContent(histEff->FindBin(cent, v0.pt())); + } else if (histEff->GetDimension() == ThreeDimCorr) { + histos.fill(HIST("Tracks/h1f_tracks_info"), kEffCorrPtRapCent); + effCorrFact = histEff->GetBinContent(histEff->FindBin(cent, v0.pt(), rap)); + } else { + histos.fill(HIST("Tracks/h1f_tracks_info"), kNoEffCorr); + LOGF(warning, "CCDB OBJECT IS NOT A HISTOGRAM !!!"); + effCorrFact = 1.; + } + delete histEff; + } + + // Get Primary Fraction + // (The dimension of this could be different than efficiency because of large errors !!!) + if (cGetPrimFrac) { + TObject* objPrm = reinterpret_cast(ccdbObj->FindObject(Form("%s", vPrimFracStrings[cPrimFracHist][part].c_str()))); + TH1F* histPrm = reinterpret_cast(objPrm->Clone()); + if (histPrm->GetDimension() == TwoDimCorr) { + histos.fill(HIST("Tracks/h1f_tracks_info"), kPFCorrPtCent); + primFrac = histPrm->GetBinContent(histPrm->FindBin(cent, v0.pt())); + } else if (histPrm->GetDimension() == ThreeDimCorr) { + histos.fill(HIST("Tracks/h1f_tracks_info"), kPFCorrPtRapCent); + primFrac = histPrm->GetBinContent(histPrm->FindBin(cent, v0.pt(), rap)); + } else { + histos.fill(HIST("Tracks/h1f_tracks_info"), kNoPFCorr); + LOGF(warning, "CCDB OBJECT IS NOT A HISTOGRAM !!!"); + primFrac = 1.; + } + delete histPrm; + } + + return primFrac * effCorrFact; + } + + template + void fillLambdaMothers(V const& v0, T const&) + { + auto mcpart = v0.template mcParticle_as(); + auto lambdaMothers = mcpart.template mothers_as(); + histos.fill(HIST("Tracks/h2f_lambda_mothers_pdg"), lambdaMothers[0].pdgCode(), v0.pt()); + } + + template + void fillLambdaQAHistos(C const& col, V const& v0, T const&) + { + static constexpr std::string_view SubDir[] = {"QA/Lambda/", "QA/AntiLambda/"}; + + // daugthers + auto postrack = v0.template posTrack_as(); + auto negtrack = v0.template negTrack_as(); + float mass = 0.; + + if constexpr (part == kLambda) { + mass = v0.mLambda(); + } else { + mass = v0.mAntiLambda(); + } + + // ctau + float e = RecoDecay::e(v0.px(), v0.py(), v0.pz(), mass); + float gamma = e / mass; + float ctau = v0.distovertotmom(col.posX(), col.posY(), col.posZ()) * MassLambda0; + float gctau = ctau * gamma; + + histos.fill(HIST(SubDir[part]) + HIST("h2f_qt_vs_alpha"), v0.alpha(), v0.qtarm()); + histos.fill(HIST(SubDir[part]) + HIST("h1f_dca_V0_daughters"), v0.dcaV0daughters()); + histos.fill(HIST(SubDir[part]) + HIST("h1f_dca_pos_to_PV"), v0.dcapostopv()); + histos.fill(HIST(SubDir[part]) + HIST("h1f_dca_neg_to_PV"), v0.dcanegtopv()); + histos.fill(HIST(SubDir[part]) + HIST("h1f_dca_V0_to_PV"), v0.dcav0topv()); + histos.fill(HIST(SubDir[part]) + HIST("h1f_V0_cospa"), v0.v0cosPA()); + histos.fill(HIST(SubDir[part]) + HIST("h1f_V0_radius"), v0.v0radius()); + histos.fill(HIST(SubDir[part]) + HIST("h1f_V0_ctau"), ctau); + histos.fill(HIST(SubDir[part]) + HIST("h1f_V0_gctau"), gctau); + + histos.fill(HIST(SubDir[part]) + HIST("h1f_pos_prong_pt"), postrack.pt()); + histos.fill(HIST(SubDir[part]) + HIST("h1f_pos_prong_eta"), postrack.eta()); + histos.fill(HIST(SubDir[part]) + HIST("h1f_pos_prong_phi"), postrack.phi()); + histos.fill(HIST(SubDir[part]) + HIST("h1f_neg_prong_pt"), negtrack.pt()); + histos.fill(HIST(SubDir[part]) + HIST("h1f_neg_prong_eta"), negtrack.eta()); + histos.fill(HIST(SubDir[part]) + HIST("h1f_neg_prong_phi"), negtrack.phi()); + + histos.fill(HIST(SubDir[part]) + HIST("h2f_pos_prong_dcaXY_vs_pt"), postrack.pt(), postrack.dcaXY()); + histos.fill(HIST(SubDir[part]) + HIST("h2f_neg_prong_dcaXY_vs_pt"), negtrack.pt(), negtrack.dcaXY()); + histos.fill(HIST(SubDir[part]) + HIST("h2f_pos_prong_dEdx_vs_p"), postrack.tpcInnerParam(), postrack.tpcSignal()); + histos.fill(HIST(SubDir[part]) + HIST("h2f_neg_prong_dEdx_vs_p"), negtrack.tpcInnerParam(), negtrack.tpcSignal()); + histos.fill(HIST(SubDir[part]) + HIST("h2f_pos_prong_tpc_nsigma_pr_vs_p"), postrack.tpcInnerParam(), postrack.tpcNSigmaPr()); + histos.fill(HIST(SubDir[part]) + HIST("h2f_neg_prong_tpc_nsigma_pr_vs_p"), negtrack.tpcInnerParam(), negtrack.tpcNSigmaPr()); + histos.fill(HIST(SubDir[part]) + HIST("h2f_pos_prong_tpc_nsigma_pi_vs_p"), postrack.tpcInnerParam(), postrack.tpcNSigmaPi()); + histos.fill(HIST(SubDir[part]) + HIST("h2f_neg_prong_tpc_nsigma_pi_vs_p"), negtrack.tpcInnerParam(), negtrack.tpcNSigmaPi()); + } + + // Fill Lambda Kinematic Histograms + template + void fillKinematicHists(float const& pt, float const& eta, float const& y, float const& phi) + { + static constexpr std::string_view SubDirRG[] = {"McRec/", "McGen/"}; + static constexpr std::string_view SubDirPart[] = {"Lambda/", "AntiLambda/"}; + + histos.fill(HIST(SubDirRG[rg]) + HIST(SubDirPart[part]) + HIST("hPt"), pt); + histos.fill(HIST(SubDirRG[rg]) + HIST(SubDirPart[part]) + HIST("hEta"), eta); + histos.fill(HIST(SubDirRG[rg]) + HIST(SubDirPart[part]) + HIST("hRap"), y); + histos.fill(HIST(SubDirRG[rg]) + HIST(SubDirPart[part]) + HIST("hPhi"), phi); + } + + // Reconstructed Level Tables + template + void fillLambdaRecoTables(C const& collision, V const& v0tracks, T const& tracks) + { + // Total Collisions + histos.fill(HIST("Events/h1f_collisions_info"), kTotCol); + + // Select Collision (Only for Data... McRec has been selected already !!!) + if constexpr (dmc == kData) { + if (!selCollision(collision)) { + return; + } + } + + histos.fill(HIST("Events/h1f_collisions_info"), kPassSelCol); + histos.fill(HIST("Events/h1f_collision_posZ"), collision.posZ()); + + // Fill Collision Table + // lambdaCollisionTable(cent, mult, collision.posX(), collision.posY(), collision.posZ()); + lambdaCollisionTable(cent, mult, collision.globalIndex(), collision.posX(), collision.posY(), collision.posZ()); + + // initialize v0track objects + ParticleType v0Type = kLambda; + PrmScdType v0PrmScdType = kPrimary; + float mass = 0., corr_fact = 1.; + + for (auto const& v0 : v0tracks) { + // check for corresponding MCGen Particle + if constexpr (dmc == kMC) { + histos.fill(HIST("Tracks/h1f_tracks_info"), kTracksBeforeHasMcParticle); + if (!v0.has_mcParticle()) { + continue; + } + } + + histos.fill(HIST("Tracks/h1f_tracks_info"), kAllV0Tracks); + histos.fill(HIST("Tracks/h2f_armpod_before_sel"), v0.alpha(), v0.qtarm()); + + // Select V0 Particle as Lambda/AntiLambda + if (!selV0Particle(collision, v0, tracks, v0Type)) { + continue; + } + + // Select V0 Type Selection + if (cV0TypeSelFlag && v0.v0Type() != cV0TypeSelection) { + continue; + } + + // we have v0 as lambda + histos.fill(HIST("Tracks/h1f_tracks_info"), kAllSelPassed); + + // Remove lambda with ambiguous daughters (Only for run3) + if constexpr (run == kRun3) { + if (cRemoveAmbiguousTracks && hasAmbiguousDaughters(v0, tracks)) { + continue; + } + } + + // Get Lambda mass and kinematic variables + mass = (v0Type == kLambda) ? v0.mLambda() : v0.mAntiLambda(); + pt = v0.pt(); + eta = v0.eta(); + rap = v0.yLambda(); + phi = v0.phi(); + + // do MC analysis + if constexpr (dmc == kMC) { + histos.fill(HIST("Tracks/h2f_tracks_pid_before_sel"), v0.mcParticle().pdgCode(), v0.pt()); + + // Get Primary/Secondary Lambda + if (cSelMCPSV0) { + v0PrmScdType = isPrimaryV0(v0); + } + + // check for true Lambda/Anti-Lambda + if (cSelectTrueLambda && !selTrueMcRecLambda(v0, tracks)) { + continue; + } + + // get mothers information + if (v0PrmScdType == kSecondary) { + fillLambdaMothers(v0, tracks); + } + + histos.fill(HIST("Tracks/h1f_tracks_info"), kPassTrueLambdaSel); + histos.fill(HIST("Tracks/h2f_tracks_pid_after_sel"), v0.mcParticle().pdgCode(), v0.pt()); + + if (cRecoMomResoFlag) { + auto mc = v0.template mcParticle_as(); + pt = mc.pt(); + eta = mc.eta(); + rap = mc.y(); + phi = mc.phi(); + float y = (cDoEtaAnalysis) ? eta : rap; + // apply kinematic selection (On Truth) + if (!kinCutSelection(pt, std::abs(y), cMinV0Pt, cMaxV0Pt, cMaxV0Rap)) { + continue; + } + } + } + + histos.fill(HIST("Tracks/h2f_armpod_after_sel"), v0.alpha(), v0.qtarm()); + + // get correction factors + corr_fact = (v0Type == kLambda) ? getCorrectionFactors(v0) : getCorrectionFactors(v0); + + // fill lambda qa + if (v0Type == kLambda) { + histos.fill(HIST("Tracks/h1f_lambda_pt_vs_invm"), mass, v0.pt()); + fillLambdaQAHistos(collision, v0, tracks); + fillKinematicHists(v0.pt(), v0.eta(), v0.yLambda(), v0.phi()); + } else { + histos.fill(HIST("Tracks/h1f_antilambda_pt_vs_invm"), mass, v0.pt()); + fillLambdaQAHistos(collision, v0, tracks); + fillKinematicHists(v0.pt(), v0.eta(), v0.yLambda(), v0.phi()); + } + + // Fill Lambda/AntiLambda Table + lambdaTrackTable(lambdaCollisionTable.lastIndex(), v0.px(), v0.py(), v0.pz(), + pt, eta, phi, rap, mass, v0.template posTrack_as().index(), v0.template negTrack_as().index(), + v0.v0cosPA(), v0.dcaV0daughters(), (int8_t)v0Type, v0PrmScdType, corr_fact); + } + } + + // MC Generater Level Tables + template + void fillLambdaMcGenTables(C const& mcCollision, M const& mcParticles) + { + // Fill McGen Collision Table + lambdaMCGenCollisionTable(cent, mult, mcCollision.globalIndex(), mcCollision.posX(), mcCollision.posY(), mcCollision.posZ()); + + // initialize track objects + ParticleType v0Type = kLambda; + PrmScdType v0PrmScdType = kPrimary; + float rap = 0.; + + for (auto const& mcpart : mcParticles) { + // check for Lambda first + if (mcpart.pdgCode() == kLambda0) { + v0Type = kLambda; + } else if (mcpart.pdgCode() == kLambda0Bar) { + v0Type = kAntiLambda; + } else { + continue; + } + + // check for Primary Lambda/AntiLambda + if (mcpart.isPhysicalPrimary()) { + v0PrmScdType = kPrimary; + } else { + v0PrmScdType = kSecondary; + } + + // Decide Eta/Rap + if (!cDoEtaAnalysis) { + rap = mcpart.y(); + } else { + rap = mcpart.eta(); + } + + // Apply Kinematic Acceptance + if (!kinCutSelection(mcpart.pt(), std::abs(rap), cMinV0Pt, cMaxV0Pt, cMaxV0Rap)) { + continue; + } + + histos.fill(HIST("Tracks/h1f_tracks_info"), kGenTotAccLambda); + + // get daughter track info and check for decay channel flag + if (!mcpart.has_daughters()) { + histos.fill(HIST("Tracks/h1f_tracks_info"), kGenLambdaNoDau); + continue; + } + auto dautracks = mcpart.template daughters_as(); + std::vector daughterPDGs, daughterIDs; + std::vector vDauPt, vDauEta, vDauRap, vDauPhi; + for (auto const& dautrack : dautracks) { + daughterPDGs.push_back(dautrack.pdgCode()); + daughterIDs.push_back(dautrack.globalIndex()); + vDauPt.push_back(dautrack.pt()); + vDauEta.push_back(dautrack.eta()); + vDauRap.push_back(dautrack.y()); + vDauPhi.push_back(dautrack.phi()); + } + if (cGenDecayChannel) { // check decay channel + if (v0Type == kLambda) { + if (daughterPDGs[0] != kProton || daughterPDGs[1] != kPiMinus) { + continue; + } + } else if (v0Type == kAntiLambda) { + if (daughterPDGs[0] != kProtonBar || daughterPDGs[1] != kPiPlus) { + continue; + } + } + } + + histos.fill(HIST("Tracks/h1f_tracks_info"), kGenLambdaToPrPi); + + if (v0Type == kLambda) { + histos.fill(HIST("McGen/h1f_lambda_daughter_PDG"), daughterPDGs[0]); + histos.fill(HIST("McGen/h1f_lambda_daughter_PDG"), daughterPDGs[1]); + histos.fill(HIST("McGen/h1f_lambda_daughter_PDG"), mcpart.pdgCode()); + histos.fill(HIST("McGen/Lambda/Proton/hPt"), vDauPt[0]); + histos.fill(HIST("McGen/Lambda/Proton/hEta"), vDauEta[0]); + histos.fill(HIST("McGen/Lambda/Proton/hRap"), vDauRap[0]); + histos.fill(HIST("McGen/Lambda/Proton/hPhi"), vDauPhi[0]); + histos.fill(HIST("McGen/Lambda/Pion/hPt"), vDauPt[1]); + histos.fill(HIST("McGen/Lambda/Pion/hEta"), vDauEta[1]); + histos.fill(HIST("McGen/Lambda/Pion/hRap"), vDauRap[1]); + histos.fill(HIST("McGen/Lambda/Pion/hPhi"), vDauPhi[1]); + fillKinematicHists(mcpart.pt(), mcpart.eta(), mcpart.y(), mcpart.phi()); + } else { + histos.fill(HIST("McGen/h1f_antilambda_daughter_PDG"), daughterPDGs[0]); + histos.fill(HIST("McGen/h1f_antilambda_daughter_PDG"), daughterPDGs[1]); + histos.fill(HIST("McGen/h1f_antilambda_daughter_PDG"), mcpart.pdgCode()); + histos.fill(HIST("McGen/AntiLambda/Pion/hPt"), vDauPt[0]); + histos.fill(HIST("McGen/AntiLambda/Pion/hEta"), vDauEta[0]); + histos.fill(HIST("McGen/AntiLambda/Pion/hRap"), vDauRap[0]); + histos.fill(HIST("McGen/AntiLambda/Pion/hPhi"), vDauPhi[0]); + histos.fill(HIST("McGen/AntiLambda/Proton/hPt"), vDauPt[1]); + histos.fill(HIST("McGen/AntiLambda/Proton/hEta"), vDauEta[1]); + histos.fill(HIST("McGen/AntiLambda/Proton/hRap"), vDauRap[1]); + histos.fill(HIST("McGen/AntiLambda/Proton/hPhi"), vDauPhi[1]); + fillKinematicHists(mcpart.pt(), mcpart.eta(), mcpart.y(), mcpart.phi()); + } + + // Fill Lambda McGen Table + lambdaMCGenTrackTable(lambdaMCGenCollisionTable.lastIndex(), mcpart.px(), mcpart.py(), mcpart.pz(), + mcpart.pt(), mcpart.eta(), mcpart.phi(), mcpart.y(), RecoDecay::m(mcpart.p(), mcpart.e()), + daughterIDs[0], daughterIDs[1], (int8_t)v0Type, -999., -999., v0PrmScdType, 1.); + } + } + + template + void analyzeMcRecoGen(M const& mcCollision, C const& collisions, V const& V0s, T const& tracks, P const& mcParticles) + { + // Number of Rec Collisions Associated to the McGen Collision + int nRecCols = collisions.size(); + if (nRecCols != 0) { + histos.fill(HIST("McGen/h1f_collision_recgen"), nRecCols); + } + + // Always fill gen tables so processMCGenXi/Omega has entries. + // selCollision sets cent/mult as a side-effect — works for both Run2 and Run3. + cent = 0.f; + mult = 0.f; + if (nRecCols >= 1 && + collisions.begin().has_mcCollision() && + collisions.begin().mcCollisionId() == mcCollision.globalIndex()) { + selCollision(collisions.begin()); // sets cent and mult + } + fillLambdaMcGenTables(mcCollision, mcParticles); + + // Reco tables only for clean 1-to-1 matched collisions + if (nRecCols != 1) { + return; + } + histos.fill(HIST("McGen/h1f_collisions_info"), kTotCol); + if (!collisions.begin().has_mcCollision() || !selCollision(collisions.begin()) || collisions.begin().mcCollisionId() != mcCollision.globalIndex()) { + return; + } + histos.fill(HIST("McGen/h1f_collisions_info"), kPassSelCol); + histos.fill(HIST("McGen/h2f_collision_posZ"), mcCollision.posZ(), collisions.begin().posZ()); + auto v0Tracks = V0s.sliceBy(perCollision, collisions.begin().globalIndex()); + fillLambdaRecoTables(collisions.begin(), v0Tracks, tracks); + } + + SliceCache cache; + Preslice> perCollision = aod::v0data::collisionId; + + using CollisionsRun3 = soa::Join; + using CollisionsRun2 = soa::Join; + using Tracks = soa::Join; + using TracksRun2 = soa::Join; + using TracksMC = soa::Join; + using TracksMCRun2 = soa::Join; + using McV0Tracks = soa::Join; + + void processDataRun3(CollisionsRun3::iterator const& collision, aod::V0Datas const& V0s, Tracks const& tracks) + { + fillLambdaRecoTables(collision, V0s, tracks); + } + + PROCESS_SWITCH(LambdaTableProducer, processDataRun3, "Process for Run3 DATA", true); + + void processDataRun2(CollisionsRun2::iterator const& collision, aod::V0Datas const& V0s, TracksRun2 const& tracks) + { + fillLambdaRecoTables(collision, V0s, tracks); + } + + PROCESS_SWITCH(LambdaTableProducer, processDataRun2, "Process for Run2 DATA", false); + + void processMCRecoRun3(soa::Join::iterator const& collision, aod::McCollisions const&, + McV0Tracks const& V0s, TracksMC const& tracks, aod::McParticles const&) + { + // check collision + if (!selCollision(collision)) { + return; + } + fillLambdaRecoTables(collision, V0s, tracks); + } + + PROCESS_SWITCH(LambdaTableProducer, processMCRecoRun3, "Process for Run3 McReco DATA", false); + + void processMCRecoRun2(soa::Join::iterator const& collision, aod::McCollisions const&, + McV0Tracks const& V0s, TracksMCRun2 const& tracks, aod::McParticles const&) + { + // check collision + if (!selCollision(collision)) { + return; + } + fillLambdaRecoTables(collision, V0s, tracks); + } + + PROCESS_SWITCH(LambdaTableProducer, processMCRecoRun2, "Process for Run2 McReco DATA", false); + + void processMCRun3(aod::McCollisions::iterator const& mcCollision, + soa::SmallGroups> const& collisions, + McV0Tracks const& V0s, TracksMC const& tracks, + aod::McParticles const& mcParticles) + { + analyzeMcRecoGen(mcCollision, collisions, V0s, tracks, mcParticles); + } + + PROCESS_SWITCH(LambdaTableProducer, processMCRun3, "Process for Run3 MC RecoGen", false); + + void processMCRun2(aod::McCollisions::iterator const& mcCollision, + soa::SmallGroups> const& collisions, + McV0Tracks const& V0s, TracksMCRun2 const& tracks, + aod::McParticles const& mcParticles) + { + analyzeMcRecoGen(mcCollision, collisions, V0s, tracks, mcParticles); + } + + PROCESS_SWITCH(LambdaTableProducer, processMCRun2, "Process for Run2 MC RecoGen", false); + + // Gen-only: fills LambdaMcGenCollisions + LambdaMcGenTracks without touching reco tables. + // Use alongside processMCRecoRun3 (which fills reco tables only). + void processMCGenOnlyRun3(aod::McCollisions::iterator const& mcCollision, + soa::SmallGroups> const& collisions, + aod::McParticles const& mcParticles) + { + // Try to obtain centrality from a matched reco collision + cent = 0.f; + mult = 0.f; + if (collisions.size() >= 1) { + auto firstReco = collisions.begin(); + if (firstReco.has_mcCollision() && + firstReco.mcCollisionId() == mcCollision.globalIndex()) { + selCollision(firstReco); // sets cent and mult + } + } + fillLambdaMcGenTables(mcCollision, mcParticles); + } + + PROCESS_SWITCH(LambdaTableProducer, processMCGenOnlyRun3, "Gen-only Run3 (no reco tables)", false); +}; + +struct LambdaTracksExtProducer { + + Produces lambdaTrackExtTable; + + // Configurables + Configurable cAcceptAllLambda{"cAcceptAllLambda", false, "Accept all Lambda"}; + Configurable cRejAllLambdaShaDau{"cRejAllLambdaShaDau", true, "Reject all Lambda sharing daughters"}; + Configurable cSelLambdaMassPdg{"cSelLambdaMassPdg", false, "Select Lambda closest to Pdg Mass"}; + Configurable cSelLambdaTScore{"cSelLambdaTScore", false, "Select Lambda based on t-score"}; + Configurable cA{"cA", 0.6, "a * |lambdaMass - lambdaPdgMass|"}; + Configurable cB{"cB", 0.6, "b * DcaPrPi"}; + Configurable cC{"cC", 0.6, "c * Cos(theta_{PA})"}; + + // Histogram Registry. + HistogramRegistry histos{"histos", {}, OutputObjHandlingPolicy::AnalysisObject}; + + void init(InitContext const&) + { + // Axis Specifications + const AxisSpec axisMult(10, 0, 10); + const AxisSpec axisMass(100, 1.06, 1.16, "Inv Mass (GeV/#it{c}^{2})"); + const AxisSpec axisCPA(100, 0.995, 1.0, "cos(#theta_{PA})"); + const AxisSpec axisDcaDau(75, 0., 1.5, "Daug DCA (#sigma)"); + const AxisSpec axisDEta(320, -1.6, 1.6, "#Delta#eta"); + const AxisSpec axisDPhi(640, -PIHalf, 3. * PIHalf, "#Delta#varphi"); + + // Histograms Booking + histos.add("h1i_totlambda_mult", "Multiplicity", kTH1I, {axisMult}); + histos.add("h1i_totantilambda_mult", "Multiplicity", kTH1I, {axisMult}); + histos.add("h1i_lambda_mult", "Multiplicity", kTH1I, {axisMult}); + histos.add("h1i_antilambda_mult", "Multiplicity", kTH1I, {axisMult}); + histos.add("h2d_n2_etaphi_LaP_LaM", "#rho_{2}^{SharePair}", kTH2D, {axisDEta, axisDPhi}); + histos.add("h2d_n2_etaphi_LaP_LaP", "#rho_{2}^{SharePair}", kTH2D, {axisDEta, axisDPhi}); + histos.add("h2d_n2_etaphi_LaM_LaM", "#rho_{2}^{SharePair}", kTH2D, {axisDEta, axisDPhi}); + + // InvMass, DcaDau and CosPA + histos.add("Reco/h1f_lambda_invmass", "M_{p#pi}", kTH1F, {axisMass}); + histos.add("Reco/h1f_lambda_cospa", "cos(#theta_{PA})", kTH1F, {axisCPA}); + histos.add("Reco/h1f_lambda_dcadau", "DCA_{p#pi} at V0 Decay Vertex", kTH1F, {axisDcaDau}); + histos.add("Reco/h1f_antilambda_invmass", "M_{p#pi}", kTH1F, {axisMass}); + histos.add("Reco/h1f_antilambda_cospa", "cos(#theta_{PA})", kTH1F, {axisCPA}); + histos.add("Reco/h1f_antilambda_dcadau", "DCA_{p#pi} at V0 Decay Vertex", kTH1F, {axisDcaDau}); + + histos.addClone("Reco/", "SharingDau/"); + } + + template + void fillHistos(T const& track) + { + static constexpr std::string_view SubDir[] = {"Reco/", "SharingDau/"}; + + if (track.v0Type() == kLambda) { + histos.fill(HIST(SubDir[sd]) + HIST("h1f_lambda_invmass"), track.mass()); + histos.fill(HIST(SubDir[sd]) + HIST("h1f_lambda_dcadau"), track.dcaDau()); + histos.fill(HIST(SubDir[sd]) + HIST("h1f_lambda_cospa"), track.cosPA()); + } else { + histos.fill(HIST(SubDir[sd]) + HIST("h1f_antilambda_invmass"), track.mass()); + histos.fill(HIST(SubDir[sd]) + HIST("h1f_antilambda_dcadau"), track.dcaDau()); + histos.fill(HIST(SubDir[sd]) + HIST("h1f_antilambda_cospa"), track.cosPA()); + } + } + + void process(aod::LambdaCollisions::iterator const&, aod::LambdaTracks const& tracks) + { + + int nTotLambda = 0, nTotAntiLambda = 0, nSelLambda = 0, nSelAntiLambda = 0; + + for (auto const& lambda : tracks) { + bool lambdaMinDeltaMassFlag = true, lambdaMinTScoreFlag = true; + bool lambdaSharingDauFlag = false, trueLambdaFlag = false; + std::vector vSharedDauLambdaIndex; + float tLambda = 0., tTrack = 0.; + + if (lambda.v0Type() == kLambda) { + ++nTotLambda; + } else if (lambda.v0Type() == kAntiLambda) { + ++nTotAntiLambda; + } + + tLambda = (cA * std::abs(lambda.mass() - MassLambda0)) + (cB * lambda.dcaDau()) + (cC * std::abs(lambda.cosPA() - 1.)); + + for (auto const& track : tracks) { + // check lambda index (don't analyze same lambda track !!!) + if (lambda.index() == track.index()) { + continue; + } + + // check if lambda shares daughters with any other track + if (lambda.posTrackId() == track.posTrackId() || lambda.negTrackId() == track.negTrackId()) { + vSharedDauLambdaIndex.push_back(track.index()); + lambdaSharingDauFlag = true; + + // Fill DEta-DPhi Histogram + if ((lambda.v0Type() == kLambda && track.v0Type() == kAntiLambda) || (lambda.v0Type() == kAntiLambda && track.v0Type() == kLambda)) { + histos.fill(HIST("h2d_n2_etaphi_LaP_LaM"), lambda.eta() - track.eta(), RecoDecay::constrainAngle((lambda.phi() - track.phi()), -PIHalf)); + } else if (lambda.v0Type() == kLambda && track.v0Type() == kLambda) { + histos.fill(HIST("h2d_n2_etaphi_LaP_LaP"), lambda.eta() - track.eta(), RecoDecay::constrainAngle((lambda.phi() - track.phi()), -PIHalf)); + } else if (lambda.v0Type() == kAntiLambda && track.v0Type() == kAntiLambda) { + histos.fill(HIST("h2d_n2_etaphi_LaM_LaM"), lambda.eta() - track.eta(), RecoDecay::constrainAngle((lambda.phi() - track.phi()), -PIHalf)); + } + + // decision based on mass closest to PdgMass of Lambda + if (std::abs(lambda.mass() - MassLambda0) > std::abs(track.mass() - MassLambda0)) { + lambdaMinDeltaMassFlag = false; + } + + // decisions based on t-score + tTrack = (cA * std::abs(track.mass() - MassLambda0)) + (cB * track.dcaDau()) + (cC * std::abs(track.cosPA() - 1.)); + if (tLambda > tTrack) { + lambdaMinTScoreFlag = false; + } + } + } + + // fill QA histograms + if (lambdaSharingDauFlag) { + fillHistos(lambda); + } else { + fillHistos(lambda); + } + + if (cAcceptAllLambda) { // Accept all lambda + trueLambdaFlag = true; + } else if (cRejAllLambdaShaDau && !lambdaSharingDauFlag) { // Reject all lambda sharing daughter + trueLambdaFlag = true; + } else if (cSelLambdaMassPdg && lambdaMinDeltaMassFlag) { // Select lambda closest to pdg mass + trueLambdaFlag = true; + } else if (cSelLambdaTScore && lambdaMinTScoreFlag) { // Select lambda based on t-score + trueLambdaFlag = true; + } + + // Multiplicity of selected lambda + if (trueLambdaFlag) { + if (lambda.v0Type() == kLambda) { + ++nSelLambda; + } else if (lambda.v0Type() == kAntiLambda) { + ++nSelAntiLambda; + } + } + + // fill LambdaTrackExt table + lambdaTrackExtTable(lambdaSharingDauFlag, vSharedDauLambdaIndex, trueLambdaFlag); + } + + // fill multiplicity histograms + if (nTotLambda != 0) { + histos.fill(HIST("h1i_totlambda_mult"), nTotLambda); + } + + if (nTotAntiLambda != 0) { + histos.fill(HIST("h1i_totantilambda_mult"), nTotAntiLambda); + } + + if (nSelLambda != 0) { + histos.fill(HIST("h1i_lambda_mult"), nSelLambda); + } + + if (nSelAntiLambda != 0) { + histos.fill(HIST("h1i_antilambda_mult"), nSelAntiLambda); + } + } +}; + +struct LambdaR2Correlation { + // Global Configurables + Configurable cNPtBins{"cNPtBins", 34, "N pT Bins"}; + Configurable cMinPt{"cMinPt", 0.8, "pT Min"}; + Configurable cMaxPt{"cMaxPt", 4.2, "pT Max"}; + Configurable cNRapBins{"cNRapBins", 20, "N Rapidity Bins"}; + Configurable cMinRap{"cMinRap", -0.5, "Minimum Rapidity"}; + Configurable cMaxRap{"cMaxRap", 0.5, "Maximum Rapidity"}; + Configurable cNPhiBins{"cNPhiBins", 36, "N Phi Bins"}; + Configurable cAnaSecondaries{"cAnaSecondaries", false, "Analysze Secondaries"}; + Configurable cAnaPairs{"cAnaPairs", false, "Analyze Pairs Flag"}; + Configurable cAnaSecondaryPairs{"cAnaSecondaryPairs", false, "Analyze Secondary Pairs Flag"}; + + // Eta/Rap Analysis + Configurable cDoEtaAnalysis{"cDoEtaAnalysis", false, "Eta/Rap Analysis Flag"}; + + // Centrality Axis + ConfigurableAxis cMultBins{"cMultBins", {VARIABLE_WIDTH, 0.0f, 10.0f, 30.0f, 50.f, 80.0f, 100.f}, "Variable Mult-Bins"}; + + // Histogram Registry. + HistogramRegistry histos{"histos", {}, OutputObjHandlingPolicy::AnalysisObject}; + + // Initialize global variables + float nrapbins = 0.; + float kminrap = 0.; + float kmaxrap = 0.; + float nphibins = 0.; + float kminphi = 0.; + float kmaxphi = TwoPI; + float rapbinwidth = 0.; + float phibinwidth = 0.; + float q = 0., e = 0., qinv = 0.; + float cent = 0.; + + void init(InitContext const&) + { + // Set Density Histogram Attributes + nrapbins = static_cast(cNRapBins); + kminrap = static_cast(cMinRap); + kmaxrap = static_cast(cMaxRap); + nphibins = static_cast(cNPhiBins); + + rapbinwidth = (kmaxrap - kminrap) / nrapbins; + phibinwidth = (kmaxphi - kminphi) / nphibins; + + int knrapphibins = static_cast(cNRapBins) * static_cast(cNPhiBins); + float kminrapphi = 0.; + float kmaxrapphi = knrapphibins; + + const AxisSpec axisCheck(1, 0, 1, ""); + const AxisSpec axisPosZ(220, -11, 11, "V_{z} (cm)"); + const AxisSpec axisCent(cMultBins, "FT0M (%)"); + const AxisSpec axisChMult(200, 0, 200, "N_{ch}"); + const AxisSpec axisMult(10, 0, 10, "N_{#Lambda}"); + const AxisSpec axisMass(100, 1.06, 1.16, "M_{#Lambda} (GeV/#it{c}^{2})"); + const AxisSpec axisPt(cNPtBins, cMinPt, cMaxPt, "p_{T} (GeV/#it{c})"); + const AxisSpec axisEta(cNRapBins, cMinRap, cMaxRap, "#eta"); + const AxisSpec axisRap(cNRapBins, cMinRap, cMaxRap, "y"); + const AxisSpec axisPhi(cNPhiBins, 0., TwoPI, "#varphi (rad)"); + const AxisSpec axisRapPhi(knrapphibins, kminrapphi, kmaxrapphi, "y #varphi"); + const AxisSpec axisQinv(100, 0, 10, "q_{inv} (GeV/#it{c})"); + + // Create Histograms. + // Event + histos.add("Event/Reco/h1f_collision_posz", "V_{Z} Distribution", kTH1F, {axisPosZ}); + histos.add("Event/Reco/h1f_ft0m_mult_percentile", "FT0M (%)", kTH1F, {axisCent}); + histos.add("Event/Reco/h2f_Mult_vs_Centrality", "N_{ch} vs FT0M(%)", kTH2F, {axisCent, axisChMult}); + histos.add("Event/Reco/h2f_lambda_mult", "#Lambda - Multiplicity", kTH2F, {axisCent, axisMult}); + histos.add("Event/Reco/h2f_antilambda_mult", "#bar{#Lambda} - Multiplicity", kTH2F, {axisCent, axisMult}); + + // Efficiency Histograms + // Single Particle Efficiencies + histos.add("Reco/Primary/Efficiency/h2f_n1_centpt_LaP", "#rho_{1}^{#Lambda}", kTH2F, {axisCent, axisPt}); + histos.add("Reco/Primary/Efficiency/h2f_n1_centpt_LaM", "#rho_{1}^{#bar{#Lambda}}", kTH2F, {axisCent, axisPt}); + histos.add("Reco/Primary/Efficiency/h3f_n1_centpteta_LaP", "#rho_{1}^{#Lambda}", kTH3F, {axisCent, axisPt, axisEta}); + histos.add("Reco/Primary/Efficiency/h3f_n1_centpteta_LaM", "#rho_{1}^{#bar{#Lambda}}", kTH3F, {axisCent, axisPt, axisEta}); + histos.add("Reco/Primary/Efficiency/h3f_n1_centptrap_LaP", "#rho_{1}^{#Lambda}", kTH3F, {axisCent, axisPt, axisRap}); + histos.add("Reco/Primary/Efficiency/h3f_n1_centptrap_LaM", "#rho_{1}^{#bar{#Lambda}}", kTH3F, {axisCent, axisPt, axisRap}); + + // Single and Two Particle Densities + // 1D Histograms + histos.add("Reco/Primary/h3f_n1_centmasspt_LaP", "#rho_{1}^{#Lambda}", kTH3F, {axisCent, axisMass, axisPt}); + histos.add("Reco/Primary/h3f_n1_centmasspt_LaM", "#rho_{1}^{#bar{#Lambda}}", kTH3F, {axisCent, axisMass, axisPt}); + histos.add("Reco/Primary/h2f_n1_pt_LaP", "#rho_{1}^{#Lambda}", kTH2F, {axisCent, axisPt}); + histos.add("Reco/Primary/h2f_n1_pt_LaM", "#rho_{1}^{#bar{#Lambda}}", kTH2F, {axisCent, axisPt}); + histos.add("Reco/Primary/h2f_n1_eta_LaP", "#rho_{1}^{#Lambda}", kTH2F, {axisCent, axisEta}); + histos.add("Reco/Primary/h2f_n1_eta_LaM", "#rho_{1}^{#bar{#Lambda}}", kTH2F, {axisCent, axisEta}); + histos.add("Reco/Primary/h2f_n1_rap_LaP", "#rho_{1}^{#Lambda}", kTH2F, {axisCent, axisRap}); + histos.add("Reco/Primary/h2f_n1_rap_LaM", "#rho_{1}^{#bar{#Lambda}}", kTH2F, {axisCent, axisRap}); + histos.add("Reco/Primary/h2f_n1_phi_LaP", "#rho_{1}^{#Lambda}", kTH2F, {axisCent, axisPhi}); + histos.add("Reco/Primary/h2f_n1_phi_LaM", "#rho_{1}^{#bar{#Lambda}}", kTH2F, {axisCent, axisPhi}); + + // rho1 for R2 RapPhi + histos.add("Reco/Primary/h3f_n1_rapphi_LaP", "#rho_{1}^{#Lambda}", kTH3F, {axisCent, axisRap, axisPhi}); + histos.add("Reco/Primary/h3f_n1_rapphi_LaM", "#rho_{1}^{#bar{#Lambda}}", kTH3F, {axisCent, axisRap, axisPhi}); + + // rho1 for Q_{inv} + histos.add("Reco/Primary/h3f_n1_pteta_LaP", "#rho_{1}^{#Lambda}", kTH3F, {axisCent, axisPt, axisEta}); + histos.add("Reco/Primary/h3f_n1_pteta_LaM", "#rho_{1}^{#bar{#Lambda}}", kTH3F, {axisCent, axisPt, axisEta}); + + // Clone Singles Primary/Secondary Histogram + if (cAnaSecondaries) { + histos.addClone("Reco/Primary/", "Reco/Secondary/"); + } + + if (cAnaPairs) { + // rho2 for numerator of R2 + histos.add("Reco/PP/h3f_n2_raprap_LaP_LaM", "#rho_{2}^{#Lambda#bar{#Lambda}}", kTH3F, {axisCent, axisRap, axisRap}); + histos.add("Reco/PP/h3f_n2_raprap_LaP_LaP", "#rho_{2}^{#Lambda#Lambda}", kTH3F, {axisCent, axisRap, axisRap}); + histos.add("Reco/PP/h3f_n2_raprap_LaM_LaM", "#rho_{2}^{#bar{#Lambda}#bar{#Lambda}}", kTH3F, {axisCent, axisRap, axisRap}); + histos.add("Reco/PP/h3f_n2_phiphi_LaP_LaM", "#rho_{2}^{#Lambda#bar{#Lambda}}", kTH3F, {axisCent, axisPhi, axisPhi}); + histos.add("Reco/PP/h3f_n2_phiphi_LaP_LaP", "#rho_{2}^{#Lambda#Lambda}", kTH3F, {axisCent, axisPhi, axisPhi}); + histos.add("Reco/PP/h3f_n2_phiphi_LaM_LaM", "#rho_{2}^{#bar{#Lambda}#bar{#Lambda}}", kTH3F, {axisCent, axisPhi, axisPhi}); + + // rho2 for R2 Rap1Phi1Rap2Phi2 + histos.add("Reco/PP/h3f_n2_rapphi_LaP_LaM", "#rho_{2}^{#Lambda#bar{#Lambda}}", kTH3F, {axisCent, axisRapPhi, axisRapPhi}); + histos.add("Reco/PP/h3f_n2_rapphi_LaP_LaP", "#rho_{2}^{#Lambda#Lambda}", kTH3F, {axisCent, axisRapPhi, axisRapPhi}); + histos.add("Reco/PP/h3f_n2_rapphi_LaM_LaM", "#rho_{2}^{#bar{#Lambda}#bar{#Lambda}}", kTH3F, {axisCent, axisRapPhi, axisRapPhi}); + + // rho2 for R2 Qinv + histos.add("Reco/PP/h2f_n2_qinv_LaP_LaM", "#rho_{2}^{#Lambda#bar{#Lambda}}", kTH2F, {axisCent, axisQinv}); + histos.add("Reco/PP/h2f_n2_qinv_LaP_LaP", "#rho_{2}^{#Lambda#Lambda}", kTH2F, {axisCent, axisQinv}); + histos.add("Reco/PP/h2f_n2_qinv_LaM_LaM", "#rho_{2}^{#bar{#Lambda}#bar{#Lambda}}", kTH2F, {axisCent, axisQinv}); + + // Clone Pairs Histograms + if (cAnaSecondaryPairs) { + histos.addClone("Reco/PP/", "Reco/PS/"); + histos.addClone("Reco/PP/", "Reco/SP/"); + histos.addClone("Reco/PP/", "Reco/SS/"); + } + } + + // MCGen + if (doprocessMCGen) { + histos.addClone("Event/Reco/", "Event/McGen/"); + histos.addClone("Reco/", "McGen/"); + } + } + + template + void fillPairHistos(U& p1, U& p2) + { + static constexpr std::string_view SubDirRecGen[] = {"Reco/", "McGen/"}; + static constexpr std::string_view SubDirPrmScd[] = {"PP/", "PS/", "SP/", "SS/"}; + static constexpr std::string_view SubDirHist[] = {"LaP_LaM", "LaP_LaP", "LaM_LaM"}; + + float rap1 = (cDoEtaAnalysis) ? p1.eta() : p1.rap(); + float rap2 = (cDoEtaAnalysis) ? p2.eta() : p2.rap(); + + int rapbin1 = static_cast((rap1 - kminrap) / rapbinwidth); + int rapbin2 = static_cast((rap2 - kminrap) / rapbinwidth); + + int phibin1 = static_cast(p1.phi() / phibinwidth); + int phibin2 = static_cast(p2.phi() / phibinwidth); + + float corfac = p1.corrFact() * p2.corrFact(); + + // fill rho2 histograms + histos.fill(HIST(SubDirRecGen[rec_gen]) + HIST(SubDirPrmScd[psp]) + HIST("h3f_n2_raprap_") + HIST(SubDirHist[part_pair]), cent, rap1, rap2, corfac); + histos.fill(HIST(SubDirRecGen[rec_gen]) + HIST(SubDirPrmScd[psp]) + HIST("h3f_n2_phiphi_") + HIST(SubDirHist[part_pair]), cent, p1.phi(), p2.phi(), corfac); + + if (rapbin1 >= 0 && rapbin2 >= 0 && phibin1 >= 0 && phibin2 >= 0 && rapbin1 < nrapbins && rapbin2 < nrapbins && phibin1 < nphibins && phibin2 < nphibins) { + + int rapphix = rapbin1 * nphibins + phibin1; + int rapphiy = rapbin2 * nphibins + phibin2; + + histos.fill(HIST(SubDirRecGen[rec_gen]) + HIST(SubDirPrmScd[psp]) + HIST("h3f_n2_rapphi_") + HIST(SubDirHist[part_pair]), cent, rapphix + 0.5, rapphiy + 0.5, corfac); + } + + // qinv histograms + q = RecoDecay::p((p1.px() - p2.px()), (p1.py() - p2.py()), (p1.pz() - p2.pz())); + e = RecoDecay::e(p1.px(), p1.py(), p1.pz(), MassLambda0) - RecoDecay::e(p2.px(), p2.py(), p2.pz(), MassLambda0); + qinv = std::sqrt(-RecoDecay::m2(q, e)); + histos.fill(HIST(SubDirRecGen[rec_gen]) + HIST(SubDirPrmScd[psp]) + HIST("h2f_n2_qinv_") + HIST(SubDirHist[part_pair]), cent, qinv, corfac); + } + + template + void analyzeSingles(T const& tracks) + { + static constexpr std::string_view SubDirRecGen[] = {"Reco/", "McGen/"}; + static constexpr std::string_view SubDirPrmScd[] = {"Primary/", "Secondary/"}; + static constexpr std::string_view SubDirHist[] = {"LaP", "LaM"}; + + int ntrk = 0; + + for (auto const& track : tracks) { + // count tracks + ++ntrk; + + // Efficiency Plots + histos.fill(HIST(SubDirRecGen[rec_gen]) + HIST(SubDirPrmScd[pst]) + HIST("Efficiency/h2f_n1_centpt_") + HIST(SubDirHist[part]), cent, track.pt()); + histos.fill(HIST(SubDirRecGen[rec_gen]) + HIST(SubDirPrmScd[pst]) + HIST("Efficiency/h3f_n1_centpteta_") + HIST(SubDirHist[part]), cent, track.pt(), track.eta()); + histos.fill(HIST(SubDirRecGen[rec_gen]) + HIST(SubDirPrmScd[pst]) + HIST("Efficiency/h3f_n1_centptrap_") + HIST(SubDirHist[part]), cent, track.pt(), track.rap()); + + // QA Plots + histos.fill(HIST(SubDirRecGen[rec_gen]) + HIST(SubDirPrmScd[pst]) + HIST("h3f_n1_centmasspt_") + HIST(SubDirHist[part]), cent, track.mass(), track.pt()); + histos.fill(HIST(SubDirRecGen[rec_gen]) + HIST(SubDirPrmScd[pst]) + HIST("h2f_n1_pt_") + HIST(SubDirHist[part]), cent, track.pt(), track.corrFact()); + histos.fill(HIST(SubDirRecGen[rec_gen]) + HIST(SubDirPrmScd[pst]) + HIST("h2f_n1_eta_") + HIST(SubDirHist[part]), cent, track.eta(), track.corrFact()); + histos.fill(HIST(SubDirRecGen[rec_gen]) + HIST(SubDirPrmScd[pst]) + HIST("h2f_n1_phi_") + HIST(SubDirHist[part]), cent, track.phi(), track.corrFact()); + histos.fill(HIST(SubDirRecGen[rec_gen]) + HIST(SubDirPrmScd[pst]) + HIST("h2f_n1_rap_") + HIST(SubDirHist[part]), cent, track.rap(), track.corrFact()); + + // Rho1 for N1RapPhi + histos.fill(HIST(SubDirRecGen[rec_gen]) + HIST(SubDirPrmScd[pst]) + HIST("h3f_n1_rapphi_") + HIST(SubDirHist[part]), cent, track.rap(), track.phi(), track.corrFact()); + + // Rho1 for Q_{inv} Bkg Estimation + histos.fill(HIST(SubDirRecGen[rec_gen]) + HIST(SubDirPrmScd[pst]) + HIST("h3f_n1_pteta_") + HIST(SubDirHist[part]), cent, track.pt(), track.eta(), track.corrFact()); + } + + // fill multiplicity histograms + if (ntrk != 0) { + if (part == kLambda) { + histos.fill(HIST("Event/") + HIST(SubDirRecGen[rec_gen]) + HIST("h2f_lambda_mult"), cent, ntrk); + } else { + histos.fill(HIST("Event/") + HIST(SubDirRecGen[rec_gen]) + HIST("h2f_antilambda_mult"), cent, ntrk); + } + } + } + + template + void analyzePairs(T const& trks_1, T const& trks_2) + { + for (auto const& trk_1 : trks_1) { + for (auto const& trk_2 : trks_2) { + // check for same index for Lambda-Lambda / AntiLambda-AntiLambda + if (samelambda && ((trk_1.index() == trk_2.index()))) { + continue; + } + fillPairHistos(trk_1, trk_2); + } + } + } + + using LambdaCollisions = aod::LambdaCollisions; + using LambdaTracks = soa::Join; + + // using MyCascades = aod::CascDataExt; // ← NOT CascDatas. NEVER CascDatas. + using MyCascades = soa::Filtered; + + SliceCache cache; + Partition partPrimLambdaTracks = (aod::lambdatrack::v0Type == (int8_t)kLambda) && (aod::lambdatrackext::trueLambdaFlag == true) && (aod::lambdatrack::v0PrmScd == (int8_t)kPrimary); + Partition partPrimAntiLambdaTracks = (aod::lambdatrack::v0Type == (int8_t)kAntiLambda) && (aod::lambdatrackext::trueLambdaFlag == true) && (aod::lambdatrack::v0PrmScd == (int8_t)kPrimary); + Partition partSecdLambdaTracks = (aod::lambdatrack::v0Type == (int8_t)kLambda) && (aod::lambdatrackext::trueLambdaFlag == true) && (aod::lambdatrack::v0PrmScd == (int8_t)kSecondary); + Partition partSecdAntiLambdaTracks = (aod::lambdatrack::v0Type == (int8_t)kAntiLambda) && (aod::lambdatrackext::trueLambdaFlag == true) && (aod::lambdatrack::v0PrmScd == (int8_t)kSecondary); + + void processDataReco(LambdaCollisions::iterator const& collision, LambdaTracks const&) + { + histos.fill(HIST("Event/Reco/h1f_collision_posz"), collision.posZ()); + histos.fill(HIST("Event/Reco/h1f_ft0m_mult_percentile"), collision.cent()); + histos.fill(HIST("Event/Reco/h2f_Mult_vs_Centrality"), collision.cent(), collision.mult()); + + cent = collision.cent(); + + auto lambdaPrimTracks = partPrimLambdaTracks->sliceByCached(aod::lambdatrack::lambdaCollisionId, collision.globalIndex(), cache); + auto antiLambdaPrimTracks = partPrimAntiLambdaTracks->sliceByCached(aod::lambdatrack::lambdaCollisionId, collision.globalIndex(), cache); + auto lambdaSecdTracks = partSecdLambdaTracks->sliceByCached(aod::lambdatrack::lambdaCollisionId, collision.globalIndex(), cache); + auto antiLambdaSecdTracks = partSecdAntiLambdaTracks->sliceByCached(aod::lambdatrack::lambdaCollisionId, collision.globalIndex(), cache); + + analyzeSingles(lambdaPrimTracks); + analyzeSingles(antiLambdaPrimTracks); + + if (cAnaSecondaries) { + analyzeSingles(lambdaSecdTracks); + analyzeSingles(antiLambdaSecdTracks); + } + + if (cAnaPairs) { + // Primary Pairs Only + analyzePairs(lambdaPrimTracks, antiLambdaPrimTracks); + analyzePairs(lambdaPrimTracks, lambdaPrimTracks); + analyzePairs(antiLambdaPrimTracks, antiLambdaPrimTracks); + + // Secondary Pairs + if (cAnaSecondaryPairs) { + analyzePairs(lambdaPrimTracks, antiLambdaSecdTracks); + analyzePairs(lambdaPrimTracks, lambdaSecdTracks); + analyzePairs(antiLambdaPrimTracks, antiLambdaSecdTracks); + analyzePairs(lambdaSecdTracks, antiLambdaPrimTracks); + analyzePairs(lambdaSecdTracks, lambdaPrimTracks); + analyzePairs(antiLambdaSecdTracks, antiLambdaPrimTracks); + analyzePairs(lambdaSecdTracks, antiLambdaSecdTracks); + analyzePairs(lambdaSecdTracks, lambdaSecdTracks); + analyzePairs(antiLambdaSecdTracks, antiLambdaSecdTracks); + } + } + } + + PROCESS_SWITCH(LambdaR2Correlation, processDataReco, "Process for Data and MCReco", true); + + using LambdaMcGenCollisions = aod::LambdaMcGenCollisions; + using LambdaMcGenTracks = aod::LambdaMcGenTracks; + + SliceCache cachemc; + Partition partMcPrimLambdaTracks = (aod::lambdatrack::v0Type == (int8_t)kLambda) && (aod::lambdatrack::v0PrmScd == (int8_t)kPrimary); + Partition partMcPrimAntiLambdaTracks = (aod::lambdatrack::v0Type == (int8_t)kAntiLambda) && (aod::lambdatrack::v0PrmScd == (int8_t)kPrimary); + Partition partMcSecdLambdaTracks = (aod::lambdatrack::v0Type == (int8_t)kLambda) && (aod::lambdatrack::v0PrmScd == (int8_t)kSecondary); + Partition partMcSecdAntiLambdaTracks = (aod::lambdatrack::v0Type == (int8_t)kAntiLambda) && (aod::lambdatrack::v0PrmScd == (int8_t)kSecondary); + + void processMCGen(LambdaMcGenCollisions::iterator const& mcgencol, LambdaMcGenTracks const&) + { + histos.fill(HIST("Event/McGen/h1f_collision_posz"), mcgencol.posZ()); + histos.fill(HIST("Event/McGen/h1f_ft0m_mult_percentile"), mcgencol.cent()); + histos.fill(HIST("Event/McGen/h2f_Mult_vs_Centrality"), mcgencol.cent(), mcgencol.mult()); + + cent = mcgencol.cent(); + + auto lambdaPrimTracks = partMcPrimLambdaTracks->sliceByCached(aod::lambdamcgentrack::lambdaMcGenCollisionId, mcgencol.globalIndex(), cachemc); + auto antiLambdaPrimTracks = partMcPrimAntiLambdaTracks->sliceByCached(aod::lambdamcgentrack::lambdaMcGenCollisionId, mcgencol.globalIndex(), cachemc); + auto lambdaSecdTracks = partMcSecdLambdaTracks->sliceByCached(aod::lambdamcgentrack::lambdaMcGenCollisionId, mcgencol.globalIndex(), cachemc); + auto antiLambdaSecdTracks = partMcSecdAntiLambdaTracks->sliceByCached(aod::lambdamcgentrack::lambdaMcGenCollisionId, mcgencol.globalIndex(), cachemc); + + analyzeSingles(lambdaPrimTracks); + analyzeSingles(antiLambdaPrimTracks); + + if (cAnaSecondaries) { + analyzeSingles(lambdaSecdTracks); + analyzeSingles(antiLambdaSecdTracks); + } + + if (cAnaPairs) { + // Primary Pairs Only + analyzePairs(lambdaPrimTracks, antiLambdaPrimTracks); + analyzePairs(lambdaPrimTracks, lambdaPrimTracks); + analyzePairs(antiLambdaPrimTracks, antiLambdaPrimTracks); + + // Secondary Pairs + if (cAnaSecondaryPairs) { + analyzePairs(lambdaPrimTracks, antiLambdaSecdTracks); + analyzePairs(lambdaPrimTracks, lambdaSecdTracks); + analyzePairs(antiLambdaPrimTracks, antiLambdaSecdTracks); + analyzePairs(lambdaSecdTracks, antiLambdaPrimTracks); + analyzePairs(lambdaSecdTracks, lambdaPrimTracks); + analyzePairs(antiLambdaSecdTracks, antiLambdaPrimTracks); + analyzePairs(lambdaSecdTracks, antiLambdaSecdTracks); + analyzePairs(lambdaSecdTracks, lambdaSecdTracks); + analyzePairs(antiLambdaSecdTracks, antiLambdaSecdTracks); + } + } + } + + PROCESS_SWITCH(LambdaR2Correlation, processMCGen, "Process for MC Generated", false); +}; + +struct CascadeSelector { + + Service ccdb; + Service pdgDB; + + Produces cascflags; + + // Configurables + Configurable ccdbUrl{"ccdbUrl", "http://alice-ccdb.cern.ch", "CCDB url"}; + Configurable useTrigger{"useTrigger", false, "Use trigger selection on skimmed data"}; + Configurable triggerList{"triggerList", "fDoubleXi, fDoubleOmega, fOmegaXi", "List of triggers used to select events"}; + Configurable doTFBorderCut{"doTFBorderCut", true, "Switch to apply TimeframeBorderCut event selection"}; + Configurable doSel8{"doSel8", true, "Switch to apply sel8 event selection"}; + Configurable doNoSameBunchPileUp{"doNoSameBunchPileUp", true, "Switch to apply NoSameBunchPileUp event selection"}; + Configurable INEL{"INEL", 0, "Number of charged tracks within |eta| < 1 has to be greater than value"}; + Configurable maxVertexZ{"maxVertexZ", 10., "Maximum value of z coordinate of PV"}; + Configurable etaCascades{"etaCascades", 0.8, "min/max of eta for cascades"}; + Configurable doCompetingMassCut{"doCompetingMassCut", true, "Switch to apply a competing mass cut for the Omega's"}; + Configurable competingMassWindow{"competingMassWindow", 0.01, "Mass window for the competing mass cut"}; + + // Tracklevel + Configurable tpcNsigmaBachelor{"tpcNsigmaBachelor", 3, "TPC NSigma bachelor"}; + Configurable tpcNsigmaProton{"tpcNsigmaProton", 3, "TPC NSigma proton <- lambda"}; + Configurable tpcNsigmaPion{"tpcNsigmaPion", 3, "TPC NSigma pion <- lambda"}; + Configurable minTPCCrossedRows{"minTPCCrossedRows", 80, "min N TPC crossed rows"}; // TODO: finetune! 80 > 159/2, so no split tracks? + Configurable minITSClusters{"minITSClusters", 4, "minimum number of ITS clusters"}; + Configurable etaTracks{"etaTracks", 1.0, "min/max of eta for tracks"}; + Configurable tpcChi2{"tpcChi2", 4, "TPC Chi2"}; + Configurable itsChi2{"itsChi2", 36, "ITS Chi2"}; + + // Selection criteria - compatible with core wagon autodetect - copied from cascadeanalysis.cxx + //*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+* + Configurable v0setting_cospa{"v0setting_cospa", 0.995, "v0setting_cospa"}; + Configurable v0setting_dcav0dau{"v0setting_dcav0dau", 1.0, "v0setting_dcav0dau"}; + Configurable v0setting_dcapostopv{"v0setting_dcapostopv", 0.1, "v0setting_dcapostopv"}; + Configurable v0setting_dcanegtopv{"v0setting_dcanegtopv", 0.1, "v0setting_dcanegtopv"}; + Configurable v0setting_radius{"v0setting_radius", 0.9, "v0setting_radius"}; + Configurable cascadesetting_cospa{"cascadesetting_cospa", 0.95, "cascadesetting_cospa"}; + Configurable cascadesetting_dcacascdau{"cascadesetting_dcacascdau", 1.0, "cascadesetting_dcacascdau"}; + Configurable cascadesetting_dcabachtopv{"cascadesetting_dcabachtopv", 0.05, "cascadesetting_dcabachtopv"}; + Configurable cascadesetting_cascradius{"cascadesetting_cascradius", 0.9, "cascadesetting_cascradius"}; + Configurable cascadesetting_v0masswindow{"cascadesetting_v0masswindow", 0.01, "cascadesetting_v0masswindow"}; + Configurable cascadesetting_mindcav0topv{"cascadesetting_mindcav0topv", 0.01, "cascadesetting_mindcav0topv"}; + //*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+*+-+* + + // TODO: variables as function of Omega mass, only do Xi for now + ConfigurableAxis radiusAxis = {"radiusAxis", {100, 0.0f, 50.0f}, "cm"}; + ConfigurableAxis cpaAxis = {"cpaAxis", {100, 0.95f, 1.0f}, "CPA"}; + ConfigurableAxis vertexAxis = {"vertexAxis", {100, -10.0f, 10.0f}, "cm"}; + ConfigurableAxis dcaAxis = {"dcaAxis", {100, 0.0f, 2.0f}, "cm"}; + ConfigurableAxis invXiMassAxis = {"invXiMassAxis", {100, 1.28f, 1.38f}, "Inv. Mass (GeV/c^{2})"}; + ConfigurableAxis invOmegaMassAxis = {"invOmegaMassAxis", {100, 1.62f, 1.72f}, "Inv. Mass (GeV/c^{2})"}; + ConfigurableAxis ptAxis = {"ptAxis", {150, 0, 15}, "#it{p}_{T}"}; + ConfigurableAxis rapidityAxis{"rapidityAxis", {100, -1.f, 1.f}, "y"}; + ConfigurableAxis invLambdaMassAxis{"invLambdaMassAxis", {100, 1.07f, 1.17f}, "Inv. Mass (GeV/c^{2})"}; + AxisSpec itsClustersAxis{8, -0.5, 7.5, "number of ITS clusters"}; + AxisSpec tpcRowsAxis{160, -0.5, 159.5, "TPC crossed rows"}; + HistogramRegistry registry{ + "registry", + { + // basic selection variables + {"hV0Radius", "hV0Radius", {HistType::kTH3F, {radiusAxis, invXiMassAxis, ptAxis}}}, + {"hCascRadius", "hCascRadius", {HistType::kTH3F, {radiusAxis, invXiMassAxis, ptAxis}}}, + {"hV0CosPA", "hV0CosPA", {HistType::kTH3F, {cpaAxis, invXiMassAxis, ptAxis}}}, + {"hCascCosPA", "hCascCosPA", {HistType::kTH3F, {cpaAxis, invXiMassAxis, ptAxis}}}, + {"hDCAPosToPV", "hDCAPosToPV", {HistType::kTH3F, {vertexAxis, invXiMassAxis, ptAxis}}}, + {"hDCANegToPV", "hDCANegToPV", {HistType::kTH3F, {vertexAxis, invXiMassAxis, ptAxis}}}, + {"hDCABachToPV", "hDCABachToPV", {HistType::kTH3F, {vertexAxis, invXiMassAxis, ptAxis}}}, + {"hDCAV0ToPV", "hDCAV0ToPV", {HistType::kTH3F, {vertexAxis, invXiMassAxis, ptAxis}}}, + {"hDCAV0Dau", "hDCAV0Dau", {HistType::kTH3F, {dcaAxis, invXiMassAxis, ptAxis}}}, + {"hDCACascDau", "hDCACascDau", {HistType::kTH3F, {dcaAxis, invXiMassAxis, ptAxis}}}, + {"hLambdaMass", "hLambdaMass", {HistType::kTH3F, {invLambdaMassAxis, invXiMassAxis, ptAxis}}}, + + {"hMassXiMinus", "hMassXiMinus", {HistType::kTH3F, {invXiMassAxis, ptAxis, rapidityAxis}}}, + {"hMassXiPlus", "hMassXiPlus", {HistType::kTH3F, {invXiMassAxis, ptAxis, rapidityAxis}}}, + {"hMassOmegaMinus", "hMassOmegaMinus", {HistType::kTH3F, {invOmegaMassAxis, ptAxis, rapidityAxis}}}, + {"hMassOmegaPlus", "hMassOmegaPlus", {HistType::kTH3F, {invOmegaMassAxis, ptAxis, rapidityAxis}}}, + + // // invariant mass per cut, start with Xi + // {"hMassXi0", "Xi inv mass before selections", {HistType::kTH2F, {invMassAxis, ptAxis}}}, + // {"hMassXi1", "Xi inv mass after TPCnCrossedRows cut", {HistType::kTH2F, {invMassAxis, ptAxis}}}, + // {"hMassXi2", "Xi inv mass after ITSnClusters cut", {HistType::kTH2F, {invMassAxis, ptAxis}}}, + // {"hMassXi3", "Xi inv mass after topo cuts", {HistType::kTH2F, {invMassAxis, ptAxis}}}, + // {"hMassXi4", "Xi inv mass after V0 daughters PID cut", {HistType::kTH2F, {invMassAxis, ptAxis}}}, + // {"hMassXi5", "Xi inv mass after bachelor PID cut", {HistType::kTH2F, {invMassAxis, ptAxis}}}, + + // ITS & TPC clusters, with Xi inv mass + {"hTPCnCrossedRowsPos", "hTPCnCrossedRowsPos", {HistType::kTH3F, {tpcRowsAxis, invXiMassAxis, ptAxis}}}, + {"hTPCnCrossedRowsNeg", "hTPCnCrossedRowsNeg", {HistType::kTH3F, {tpcRowsAxis, invXiMassAxis, ptAxis}}}, + {"hTPCnCrossedRowsBach", "hTPCnCrossedRowsBach", {HistType::kTH3F, {tpcRowsAxis, invXiMassAxis, ptAxis}}}, + {"hITSnClustersPos", "hITSnClustersPos", {HistType::kTH3F, {itsClustersAxis, invXiMassAxis, ptAxis}}}, + {"hITSnClustersNeg", "hITSnClustersNeg", {HistType::kTH3F, {itsClustersAxis, invXiMassAxis, ptAxis}}}, + {"hITSnClustersBach", "hITSnClustersBach", {HistType::kTH3F, {itsClustersAxis, invXiMassAxis, ptAxis}}}, + {"hTPCChi2Pos", "hTPCChi2Pos", {HistType::kTH1F, {{100, 0, 10, "TPC Chi2 Pos"}}}}, + {"hTPCChi2Neg", "hTPCChi2Neg", {HistType::kTH1F, {{100, 0, 10, "TPC Chi2 Neg"}}}}, + {"hTPCChi2Bach", "hTPCChi2Bach", {HistType::kTH1F, {{100, 0, 10, "TPC Chi2 Bach"}}}}, + {"hITSChi2Pos", "hITSChi2Pos", {HistType::kTH1F, {{100, 0, 100, "ITS Chi2 Pos"}}}}, + {"hITSChi2Neg", "hITSChi2Neg", {HistType::kTH1F, {{100, 0, 100, "ITS Chi2 Neg"}}}}, + {"hITSChi2Bach", "hITSChi2Bach", {HistType::kTH1F, {{100, 0, 100, "ITS Chi2 Bach"}}}}, + + {"hTriggerQA", "hTriggerQA", {HistType::kTH1F, {{2, -0.5, 1.5, "Trigger y/n"}}}}, + }, + }; + + // Keep track of which selections the candidates pass + void init(InitContext const&) + { + ccdb->setURL(ccdbUrl); + ccdb->setCaching(true); + + auto h = registry.add("hSelectionStatus", "hSelectionStatus", HistType::kTH1I, {{10, 0, 10, "status"}}); + h->GetXaxis()->SetBinLabel(1, "All"); + h->GetXaxis()->SetBinLabel(2, "nTPC OK"); + h->GetXaxis()->SetBinLabel(3, "nITS OK"); + h->GetXaxis()->SetBinLabel(4, "track Chi2 OK"); + h->GetXaxis()->SetBinLabel(5, "Topo OK"); + h->GetXaxis()->SetBinLabel(6, "Track eta OK"); + h->GetXaxis()->SetBinLabel(7, "Cascade eta OK"); + h->GetXaxis()->SetBinLabel(8, "V0 PID OK"); + h->GetXaxis()->SetBinLabel(9, "Bach PID OK"); + + auto hEventSel = registry.add("hEventSel", "hEventSel", HistType::kTH1I, {{10, 0, 10, "selection criteria"}}); + hEventSel->GetXaxis()->SetBinLabel(1, "All"); + hEventSel->GetXaxis()->SetBinLabel(2, "sel8"); + hEventSel->GetXaxis()->SetBinLabel(3, "INEL0"); + hEventSel->GetXaxis()->SetBinLabel(4, "V_z"); + hEventSel->GetXaxis()->SetBinLabel(5, "NoSameBunchPileUp"); + hEventSel->GetXaxis()->SetBinLabel(6, "Selected events"); + + if (doprocessRecMC) { + // only create the rec matched to gen histograms if relevant + registry.add("truerec/hV0Radius", "hV0Radius", HistType::kTH1F, {radiusAxis}); + registry.add("truerec/hCascRadius", "hCascRadius", HistType::kTH1F, {radiusAxis}); + registry.add("truerec/hV0CosPA", "hV0CosPA", HistType::kTH1F, {cpaAxis}); + registry.add("truerec/hCascCosPA", "hCascCosPA", HistType::kTH1F, {cpaAxis}); + registry.add("truerec/hDCAPosToPV", "hDCAPosToPV", HistType::kTH1F, {vertexAxis}); + registry.add("truerec/hDCANegToPV", "hDCANegToPV", HistType::kTH1F, {vertexAxis}); + registry.add("truerec/hDCABachToPV", "hDCABachToPV", HistType::kTH1F, {vertexAxis}); + registry.add("truerec/hDCAV0ToPV", "hDCAV0ToPV", HistType::kTH1F, {vertexAxis}); + registry.add("truerec/hDCAV0Dau", "hDCAV0Dau", HistType::kTH1F, {dcaAxis}); + registry.add("truerec/hDCACascDau", "hDCACascDau", HistType::kTH1F, {dcaAxis}); + registry.add("truerec/hLambdaMass", "hLambdaMass", HistType::kTH1F, {invLambdaMassAxis}); + registry.add("truerec/hTPCnCrossedRowsPos", "hTPCnCrossedRowsPos", HistType::kTH1F, {tpcRowsAxis}); + registry.add("truerec/hTPCnCrossedRowsNeg", "hTPCnCrossedRowsNeg", HistType::kTH1F, {tpcRowsAxis}); + registry.add("truerec/hTPCnCrossedRowsBach", "hTPCnCrossedRowsBach", HistType::kTH1F, {tpcRowsAxis}); + registry.add("truerec/hITSnClustersPos", "hITSnClustersPos", HistType::kTH1F, {itsClustersAxis}); + registry.add("truerec/hITSnClustersNeg", "hITSnClustersNeg", HistType::kTH1F, {itsClustersAxis}); + registry.add("truerec/hITSnClustersBach", "hITSnClustersBach", HistType::kTH1F, {itsClustersAxis}); + registry.add("truerec/hTPCChi2Pos", "hTPCChi2Pos", HistType::kTH1F, {{100, 0, 10, "TPC Chi2 Pos"}}); + registry.add("truerec/hTPCChi2Neg", "hTPCChi2Neg", HistType::kTH1F, {{100, 0, 10, "TPC Chi2 Neg"}}); + registry.add("truerec/hTPCChi2Bach", "hTPCChi2Bach", HistType::kTH1F, {{100, 0, 10, "TPC Chi2 Bach"}}); + registry.add("truerec/hITSChi2Pos", "hITSChi2Pos", HistType::kTH1F, {{100, 0, 100, "ITS Chi2 Pos"}}); + registry.add("truerec/hITSChi2Neg", "hITSChi2Neg", HistType::kTH1F, {{100, 0, 100, "ITS Chi2 Neg"}}); + registry.add("truerec/hITSChi2Bach", "hITSChi2Bach", HistType::kTH1F, {{100, 0, 100, "ITS Chi2 Bach"}}); + registry.add("truerec/hXiMinus", "hXiMinus", HistType::kTH2F, {ptAxis, rapidityAxis}); + registry.add("truerec/hXiPlus", "hXiPlus", HistType::kTH2F, {ptAxis, rapidityAxis}); + registry.add("truerec/hOmegaMinus", "hOmegaMinus", HistType::kTH2F, {ptAxis, rapidityAxis}); + registry.add("truerec/hOmegaPlus", "hOmegaPlus", HistType::kTH2F, {ptAxis, rapidityAxis}); + } + + if (doprocessGenMC) { + // only create the MC gen histograms if relevant + registry.add("gen/hXiMinus", "hXiMinus", HistType::kTH2F, {ptAxis, rapidityAxis}); + registry.add("gen/hXiPlus", "hXiPlus", HistType::kTH2F, {ptAxis, rapidityAxis}); + registry.add("gen/hOmegaMinus", "hOmegaMinus", HistType::kTH2F, {ptAxis, rapidityAxis}); + registry.add("gen/hOmegaPlus", "hOmegaPlus", HistType::kTH2F, {ptAxis, rapidityAxis}); + + registry.add("genwithrec/hXiMinus", "hXiMinus", HistType::kTH2F, {ptAxis, rapidityAxis}); + registry.add("genwithrec/hXiPlus", "hXiPlus", HistType::kTH2F, {ptAxis, rapidityAxis}); + registry.add("genwithrec/hOmegaMinus", "hOmegaMinus", HistType::kTH2F, {ptAxis, rapidityAxis}); + registry.add("genwithrec/hOmegaPlus", "hOmegaPlus", HistType::kTH2F, {ptAxis, rapidityAxis}); + + registry.add("genwithrec/hNevents", "hNevents", HistType::kTH1F, {{1, 0, 1, "N generated events with reconstructed event"}}); + registry.add("gen/hNevents", "hNevents", HistType::kTH1F, {{1, 0, 1, "N generated events"}}); + } + } + + template + bool eventSelection(TCollision const& collision, bool fillHistos) + { + + if (fillHistos) + registry.fill(HIST("hEventSel"), 0); + if (doSel8 && !collision.sel8()) { + if (fillHistos) + registry.fill(HIST("hEventSel"), 1); + return false; + } else if (collision.multNTracksPVeta1() <= INEL) { + if (fillHistos) + registry.fill(HIST("hEventSel"), 2); + return false; + } else if (std::abs(collision.posZ()) > maxVertexZ) { + if (fillHistos) + registry.fill(HIST("hEventSel"), 3); + return false; + } else if (doNoSameBunchPileUp && !collision.selection_bit(aod::evsel::kNoSameBunchPileup)) { + if (fillHistos) + registry.fill(HIST("hEventSel"), 4); + return false; + } + // passes all selections + if (fillHistos) + registry.fill(HIST("hEventSel"), 5); + return true; + } + + template + void fillMatchedHistos(LabeledCascades::iterator rec, int flag, TCollision collision) + { + if (flag == 0) + return; + if (!rec.has_mcParticle()) + return; + auto gen = rec.mcParticle(); + if (!gen.isPhysicalPrimary()) + return; + int genpdg = gen.pdgCode(); + if ((flag < 3 && std::abs(genpdg) == 3312) || (flag > 1 && std::abs(genpdg) == 3334)) { + // if casc is consistent with Xi and has matched gen Xi OR cand is consistent with Omega and has matched gen omega + // have to do this in case we reco true Xi with only Omega hypothesis (or vice versa) (very unlikely) + registry.fill(HIST("truerec/hV0Radius"), rec.v0radius()); + registry.fill(HIST("truerec/hCascRadius"), rec.cascradius()); + registry.fill(HIST("truerec/hV0CosPA"), rec.v0cosPA(collision.posX(), collision.posY(), collision.posZ())); + registry.fill(HIST("truerec/hCascCosPA"), rec.casccosPA(collision.posX(), collision.posY(), collision.posZ())); + registry.fill(HIST("truerec/hDCAPosToPV"), rec.dcapostopv()); + registry.fill(HIST("truerec/hDCANegToPV"), rec.dcanegtopv()); + registry.fill(HIST("truerec/hDCABachToPV"), rec.dcabachtopv()); + registry.fill(HIST("truerec/hDCAV0ToPV"), rec.dcav0topv(collision.posX(), collision.posY(), collision.posZ())); + registry.fill(HIST("truerec/hDCAV0Dau"), rec.dcaV0daughters()); + registry.fill(HIST("truerec/hDCACascDau"), rec.dcacascdaughters()); + registry.fill(HIST("truerec/hLambdaMass"), rec.mLambda()); + registry.fill(HIST("truerec/hITSnClustersPos"), rec.posTrack_as().itsNCls()); + registry.fill(HIST("truerec/hITSnClustersNeg"), rec.negTrack_as().itsNCls()); + registry.fill(HIST("truerec/hITSnClustersBach"), rec.bachelor_as().itsNCls()); + registry.fill(HIST("truerec/hTPCnCrossedRowsPos"), rec.posTrack_as().tpcNClsCrossedRows()); + registry.fill(HIST("truerec/hTPCnCrossedRowsNeg"), rec.negTrack_as().tpcNClsCrossedRows()); + registry.fill(HIST("truerec/hTPCnCrossedRowsBach"), rec.bachelor_as().tpcNClsCrossedRows()); + registry.fill(HIST("truerec/hITSChi2Pos"), rec.posTrack_as().itsChi2NCl()); + registry.fill(HIST("truerec/hITSChi2Neg"), rec.negTrack_as().itsChi2NCl()); + registry.fill(HIST("truerec/hITSChi2Bach"), rec.bachelor_as().itsChi2NCl()); + registry.fill(HIST("truerec/hTPCChi2Pos"), rec.posTrack_as().tpcChi2NCl()); + registry.fill(HIST("truerec/hTPCChi2Neg"), rec.negTrack_as().tpcChi2NCl()); + registry.fill(HIST("truerec/hTPCChi2Bach"), rec.bachelor_as().tpcChi2NCl()); + switch (genpdg) { // is matched so we can use genpdg + case 3312: + registry.fill(HIST("truerec/hXiMinus"), rec.pt(), rec.yXi()); + break; + case -3312: + registry.fill(HIST("truerec/hXiPlus"), rec.pt(), rec.yXi()); + break; + case 3334: + registry.fill(HIST("truerec/hOmegaMinus"), rec.pt(), rec.yOmega()); + break; + case -3334: + registry.fill(HIST("truerec/hOmegaPlus"), rec.pt(), rec.yOmega()); + break; + } + } + } + + template + int processCandidate(TCascade const& casc, TCollision const& collision) + { + // these are the tracks: + auto bachTrack = casc.template bachelor_as(); + auto posTrack = casc.template posTrack_as(); + auto negTrack = casc.template negTrack_as(); + + // topo variables before cuts: + registry.fill(HIST("hV0Radius"), casc.v0radius(), casc.mXi(), casc.pt()); + registry.fill(HIST("hCascRadius"), casc.cascradius(), casc.mXi(), casc.pt()); + registry.fill(HIST("hV0CosPA"), casc.v0cosPA(collision.posX(), collision.posY(), collision.posZ()), casc.mXi(), casc.pt()); + registry.fill(HIST("hCascCosPA"), casc.casccosPA(collision.posX(), collision.posY(), collision.posZ()), casc.mXi(), casc.pt()); + registry.fill(HIST("hDCAPosToPV"), casc.dcapostopv(), casc.mXi(), casc.pt()); + registry.fill(HIST("hDCANegToPV"), casc.dcanegtopv(), casc.mXi(), casc.pt()); + registry.fill(HIST("hDCABachToPV"), casc.dcabachtopv(), casc.mXi(), casc.pt()); + registry.fill(HIST("hDCAV0ToPV"), casc.dcav0topv(collision.posX(), collision.posY(), collision.posZ()), casc.mXi(), casc.pt()); + registry.fill(HIST("hDCAV0Dau"), casc.dcaV0daughters(), casc.mXi(), casc.pt()); + registry.fill(HIST("hDCACascDau"), casc.dcacascdaughters(), casc.mXi(), casc.pt()); + registry.fill(HIST("hLambdaMass"), casc.mLambda(), casc.mXi(), casc.pt()); + + registry.fill(HIST("hITSnClustersPos"), posTrack.itsNCls(), casc.mXi(), casc.pt()); + registry.fill(HIST("hITSnClustersNeg"), negTrack.itsNCls(), casc.mXi(), casc.pt()); + registry.fill(HIST("hITSnClustersBach"), bachTrack.itsNCls(), casc.mXi(), casc.pt()); + registry.fill(HIST("hTPCnCrossedRowsPos"), posTrack.tpcNClsCrossedRows(), casc.mXi(), casc.pt()); + registry.fill(HIST("hTPCnCrossedRowsNeg"), negTrack.tpcNClsCrossedRows(), casc.mXi(), casc.pt()); + registry.fill(HIST("hTPCnCrossedRowsBach"), bachTrack.tpcNClsCrossedRows(), casc.mXi(), casc.pt()); + registry.fill(HIST("hITSChi2Pos"), posTrack.itsChi2NCl()); + registry.fill(HIST("hITSChi2Neg"), negTrack.itsChi2NCl()); + registry.fill(HIST("hITSChi2Bach"), bachTrack.itsChi2NCl()); + registry.fill(HIST("hTPCChi2Pos"), posTrack.tpcChi2NCl()); + registry.fill(HIST("hTPCChi2Neg"), negTrack.tpcChi2NCl()); + registry.fill(HIST("hTPCChi2Bach"), bachTrack.tpcChi2NCl()); + + registry.fill(HIST("hSelectionStatus"), 0); // all the cascade before selections + // registry.fill(HIST("hMassXi0"), casc.mXi(), casc.pt()); + + // TPC N crossed rows todo: check if minTPCCrossedRows > 50 + if (posTrack.tpcNClsCrossedRows() < minTPCCrossedRows || negTrack.tpcNClsCrossedRows() < minTPCCrossedRows || bachTrack.tpcNClsCrossedRows() < minTPCCrossedRows) + return 0; + + registry.fill(HIST("hSelectionStatus"), 1); // passes nTPC crossed rows + // registry.fill(HIST("hMassXi1"), casc.mXi(), casc.pt()); + + // ITS N clusters todo: check if minITSClusters > 0 + if (posTrack.itsNCls() < minITSClusters || negTrack.itsNCls() < minITSClusters || bachTrack.itsNCls() < minITSClusters) + return 0; + + registry.fill(HIST("hSelectionStatus"), 2); // passes nITS clusters + // registry.fill(HIST("hMassXi2"), casc.mXi(), casc.pt()); + + // Chi2 cuts + if (posTrack.itsChi2NCl() > itsChi2 || negTrack.itsChi2NCl() > itsChi2 || bachTrack.itsChi2NCl() > itsChi2) + return 0; + if (posTrack.tpcChi2NCl() > tpcChi2 || negTrack.tpcChi2NCl() > tpcChi2 || bachTrack.tpcChi2NCl() > tpcChi2) + return 0; + + registry.fill(HIST("hSelectionStatus"), 3); // passes Chi2 cuts + + //// TOPO CUTS //// TODO: improve! + double pvx = collision.posX(); + double pvy = collision.posY(); + double pvz = collision.posZ(); + if (casc.v0radius() < v0setting_radius || + casc.cascradius() < cascadesetting_cascradius || + casc.v0cosPA(pvx, pvy, pvz) < v0setting_cospa || + casc.casccosPA(pvx, pvy, pvz) < cascadesetting_cospa || + casc.dcav0topv(pvx, pvy, pvz) < cascadesetting_mindcav0topv || + std::abs(casc.mLambda() - 1.115683) > cascadesetting_v0masswindow) + return 0; // It failed at least one topo selection + + registry.fill(HIST("hSelectionStatus"), 4); // passes topo + // registry.fill(HIST("hMassXi3"), casc.mXi(), casc.pt()); + + if (std::abs(posTrack.eta()) > etaTracks || std::abs(negTrack.eta()) > etaTracks || std::abs(bachTrack.eta()) > etaTracks) + return 0; + + registry.fill(HIST("hSelectionStatus"), 5); // passes track eta + + if (std::abs(casc.eta()) > etaCascades) + return 0; + + registry.fill(HIST("hSelectionStatus"), 6); // passes candidate eta + + // TODO: TOF (for pT > 2 GeV per track?) + + //// TPC PID //// + // Lambda check + if (casc.sign() < 0) { + // Proton check: + if (std::abs(posTrack.tpcNSigmaPr()) > tpcNsigmaProton) + return 0; + // Pion check: + if (std::abs(negTrack.tpcNSigmaPi()) > tpcNsigmaPion) + return 0; + } else { + // Proton check: + if (std::abs(negTrack.tpcNSigmaPr()) > tpcNsigmaProton) + return 0; + // Pion check: + if (std::abs(posTrack.tpcNSigmaPi()) > tpcNsigmaPion) + return 0; + } + registry.fill(HIST("hSelectionStatus"), 7); // passes V0 daughters PID + // registry.fill(HIST("hMassXi4"), casc.mXi(), casc.pt()); + + // setting selection flag based on bachelor PID (and competing mass cut for omega's) + int flag = 0; + if (std::abs(bachTrack.tpcNSigmaPi()) < tpcNsigmaBachelor) + flag = 1; + if (std::abs(bachTrack.tpcNSigmaKa()) < tpcNsigmaBachelor && (!doCompetingMassCut || std::abs(pdgDB->Mass(3312) - casc.mXi()) > competingMassWindow)) + flag = 3 - flag; // 3 if only consistent with omega, 2 if consistent with both + + switch (flag) { + case 1: // only Xi + registry.fill(HIST("hSelectionStatus"), 8); // passes bach PID + if (casc.sign() < 0) { + registry.fill(HIST("hMassXiMinus"), casc.mXi(), casc.pt(), casc.yXi()); + } else { + registry.fill(HIST("hMassXiPlus"), casc.mXi(), casc.pt(), casc.yXi()); + } + break; + case 2: // Xi or Omega + registry.fill(HIST("hSelectionStatus"), 8); // passes bach PID + if (casc.sign() < 0) { + registry.fill(HIST("hMassXiMinus"), casc.mXi(), casc.pt(), casc.yXi()); + registry.fill(HIST("hMassOmegaMinus"), casc.mOmega(), casc.pt(), casc.yOmega()); + } else { + registry.fill(HIST("hMassXiPlus"), casc.mXi(), casc.pt(), casc.yXi()); + registry.fill(HIST("hMassOmegaPlus"), casc.mOmega(), casc.pt(), casc.yOmega()); + } + break; + case 3: // only Omega + registry.fill(HIST("hSelectionStatus"), 8); // passes bach PID + if (casc.sign() < 0) { + registry.fill(HIST("hMassOmegaMinus"), casc.mOmega(), casc.pt(), casc.yOmega()); + } else { + registry.fill(HIST("hMassOmegaPlus"), casc.mOmega(), casc.pt(), casc.yOmega()); + } + break; + } + + return flag; + + } // processCandidate + + void processGenMC(aod::McCollision const& mcCollision, soa::SmallGroups> const& collisions, aod::McParticles const& mcParticles) + { + // evsel + if (INEL >= 0 && !pwglf::isINELgtNmc(mcParticles, INEL, pdgDB)) + return; + if (std::abs(mcCollision.posZ()) > maxVertexZ) + return; + + registry.fill(HIST("gen/hNevents"), 0); + + for (auto const& mcPart : mcParticles) { + if (!mcPart.isPhysicalPrimary()) + continue; + if (std::abs(mcPart.eta()) > etaCascades) + continue; + + switch (mcPart.pdgCode()) { + case 3312: + registry.fill(HIST("gen/hXiMinus"), mcPart.pt(), mcPart.y()); + break; + case -3312: + registry.fill(HIST("gen/hXiPlus"), mcPart.pt(), mcPart.y()); + break; + case 3334: + registry.fill(HIST("gen/hOmegaMinus"), mcPart.pt(), mcPart.y()); + break; + case -3334: + registry.fill(HIST("gen/hOmegaPlus"), mcPart.pt(), mcPart.y()); + break; + } + } + + // Do the same thing, but now making sure there is at least one matched reconstructed event: + if (collisions.size() < 1) { + return; + } else { + bool evSel = false; // will be true if at least one rec. collision passes evsel + for (auto const& collision : collisions) { + // can be more than 1 rec. collisions due to event splitting + evSel = eventSelection(collision, false); + if (evSel) // exit loop if we find 1 rec. event that passes evsel + break; + } + if (evSel) { + // N gen events with a reconstructed event + registry.fill(HIST("genwithrec/hNevents"), 0); + + for (auto const& mcPart : mcParticles) { + if (!mcPart.isPhysicalPrimary()) + continue; + if (std::abs(mcPart.eta()) > etaCascades) + continue; + + switch (mcPart.pdgCode()) { + case 3312: + registry.fill(HIST("genwithrec/hXiMinus"), mcPart.pt(), mcPart.y()); + break; + case -3312: + registry.fill(HIST("genwithrec/hXiPlus"), mcPart.pt(), mcPart.y()); + break; + case 3334: + registry.fill(HIST("genwithrec/hOmegaMinus"), mcPart.pt(), mcPart.y()); + break; + case -3334: + registry.fill(HIST("genwithrec/hOmegaPlus"), mcPart.pt(), mcPart.y()); + break; + } + } + } + } + } // processGen + + // wrappers for data/MC processes on reco level + void processRecData(MyCollisions::iterator const& collision, aod::CascDataExt const& Cascades, FullTracksExtIUWithPID const&, aod::BCsWithTimestamps const&) + { + bool evSel = eventSelection(collision, true); + // do not skip the collision if event selection fails - this will lead to the cascadeFlag table having less entries than the Cascade table, and therefor not joinable. + for (auto const& casc : Cascades) { + if (!evSel) { + cascflags(0); + continue; + } + int flag = processCandidate(casc, collision); + cascflags(flag); + } + } + + void processRecMC(MyCollisions::iterator const& collision, LabeledCascades const& Cascades, FullTracksExtIUWithPID const&, aod::BCsWithTimestamps const&, aod::McParticles const&) + { + bool evSel = eventSelection(collision, true); + // do not skip the collision if event selection fails - this will lead to the cascadeFlag table having less entries than the Cascade table, and therefor not joinable. + for (auto const& casc : Cascades) { + if (!evSel) { + cascflags(0); + continue; + } + int flag = processCandidate(casc, collision); + cascflags(flag); + // do mc matching here + fillMatchedHistos(casc, flag, collision); // if sign < 0 then pdg > 0 + } + } + + PROCESS_SWITCH(CascadeSelector, processRecData, "Process rec data", true); + PROCESS_SWITCH(CascadeSelector, processRecMC, "Process rec MC", false); + PROCESS_SWITCH(CascadeSelector, processGenMC, "Process gen MC", false); +}; // struct + +struct CascadeCorrelations { + Service ccdb; + + // Configurables + Configurable maxRapidity{"maxRapidity", 0.5, "|y| < maxRapidity"}; + Configurable zVertexCut{"zVertexCut", 10, "Cut on PV position"}; + Configurable nMixedEvents{"nMixedEvents", 10, "Number of events to be mixed"}; + Configurable doEfficiencyCorrection{"doEfficiencyCorrection", true, "flag to do efficiency corrections"}; + Configurable ccdbUrl{"ccdbUrl", "http://alice-ccdb.cern.ch", "CCDB url"}; + Configurable useTrigger{"useTrigger", false, "Use trigger selection on skimmed data"}; + Configurable triggerList{"triggerList", "fDoubleXi, fDoubleOmega, fOmegaXi", "List of triggers used to select events"}; + Configurable efficiencyCCDBPath{"efficiencyCCDBPath", "Users/r/rspijker/test/EffTest", "Path of the efficiency corrections"}; + Configurable doTFBorderCut{"doTFBorderCut", true, "Switch to apply TimeframeBorderCut event selection"}; + Configurable doSel8{"doSel8", true, "Switch to apply sel8 event selection"}; + + ConfigurableAxis radiusAxis = {"radiusAxis", {100, 0.0f, 50.0f}, "cm"}; + ConfigurableAxis cpaAxis = {"cpaAxis", {100, 0.95f, 1.0f}, "CPA"}; + ConfigurableAxis invMassAxis = {"invMassAxis", {1000, 1.0f, 2.0f}, "Inv. Mass (GeV/c^{2})"}; + ConfigurableAxis deltaPhiAxis = {"deltaPhiAxis", {180, -PIHalf, 3 * PIHalf}, "#Delta#varphi"}; // 180 is divisible by 18 (tpc sectors) and 20 (run 2 binning) + ConfigurableAxis ptAxis = {"ptAxis", {150, 0, 15}, "#it{p}_{T}"}; + ConfigurableAxis vertexAxis = {"vertexAxis", {200, -10.0f, 10.0f}, "cm"}; + ConfigurableAxis dcaAxis = {"dcaAxis", {100, 0.0f, 2.0f}, "cm"}; + ConfigurableAxis multiplicityAxis{"multiplicityAxis", {100, 0, 100}, "Multiplicity (centFT0M?)"}; + ConfigurableAxis invLambdaMassAxis{"invLambdaMassAxis", {100, 1.07f, 1.17f}, "Inv. Mass (GeV/c^{2})"}; + AxisSpec signAxis{3, -1.5, 1.5, "sign of cascade"}; + AxisSpec deltaYAxis{40, -2.f, 2.f, "#Delta y"}; + AxisSpec rapidityAxis{100, -1.f, 1.f, "y"}; + AxisSpec selectionFlagAxis{4, -0.5f, 3.5f, "Selection flag of casc candidate"}; + AxisSpec itsClustersAxis{8, -0.5, 7.5, "number of ITS clusters"}; + AxisSpec tpcRowsAxis{160, -0.5, 159.5, "TPC crossed rows"}; + + // initialize efficiency maps + TH1D* hEffXiMin; + TH1D* hEffXiPlus; + TH1D* hEffOmegaMin; + TH1D* hEffOmegaPlus; + + // used in MC closure test + Service pdgDB; + o2::pwglf::ParticleCounter mCounter; + + void init(InitContext const&) + { + ccdb->setURL(ccdbUrl); + ccdb->setCaching(true); + if (doEfficiencyCorrection) { + TList* effList = ccdb->getForTimeStamp(efficiencyCCDBPath, 1); + if (!effList) { + LOGF(fatal, "null ptr in efficiency list!"); + } + hEffXiMin = static_cast(effList->FindObject("hXiMinEff")); + hEffXiPlus = static_cast(effList->FindObject("hXiPlusEff")); + hEffOmegaMin = static_cast(effList->FindObject("hOmegaMinEff")); + hEffOmegaPlus = static_cast(effList->FindObject("hOmegaPlusEff")); + } + + mCounter.mPdgDatabase = pdgDB.service; + mCounter.mSelectPrimaries = true; + } + + double getEfficiency(TH1* h, double pT, double y = 0) + { + // This function returns 1 / eff + double eff = h->GetBinContent(h->FindFixBin(pT, y)); + if (eff == 0) + return 0; + else + return 1. / eff; + } + + bool autoCorrelation(std::array triggerTracks, std::array assocTracks) + { + // function that loops over 2 arrays of track indices, checking for common elements + for (int triggerTrack : triggerTracks) { + for (int assocTrack : assocTracks) { + if (triggerTrack == assocTrack) + return true; + } + } + return false; + } + + HistogramRegistry registry{ + "registry", + { + // inv mass + {"hMassXiMinus", "hMassXiMinus", {HistType::kTH3F, {{200, 1.24, 1.44, "Inv. Mass (GeV/c^{2})"}, ptAxis, rapidityAxis}}}, + {"hMassXiPlus", "hMassXiPlus", {HistType::kTH3F, {{200, 1.24, 1.44, "Inv. Mass (GeV/c^{2})"}, ptAxis, rapidityAxis}}}, + {"hMassOmegaMinus", "hMassOmegaMinus", {HistType::kTH3F, {{200, 1.6, 1.8, "Inv. Mass (GeV/c^{2})"}, ptAxis, rapidityAxis}}}, + {"hMassOmegaPlus", "hMassOmegaPlus", {HistType::kTH3F, {{200, 1.6, 1.8, "Inv. Mass (GeV/c^{2})"}, ptAxis, rapidityAxis}}}, + // efficiency corrected inv mass + {"hMassXiEffCorrected", "hMassXiEffCorrected", {HistType::kTHnSparseF, {invMassAxis, signAxis, ptAxis, rapidityAxis, vertexAxis, multiplicityAxis}}, true}, + {"hMassOmegaEffCorrected", "hMassOmegaEffCorrected", {HistType::kTHnSparseF, {invMassAxis, signAxis, ptAxis, rapidityAxis, vertexAxis, multiplicityAxis}}, true}, + + // trigger QA + {"hTriggerQA", "hTriggerQA", {HistType::kTH1F, {{2, -0.5, 1.5, "Trigger y/n"}}}}, + + // basic selection variables (after cuts) + {"hV0Radius", "hV0Radius", {HistType::kTH1F, {radiusAxis}}}, + {"hCascRadius", "hCascRadius", {HistType::kTH1F, {radiusAxis}}}, + {"hV0CosPA", "hV0CosPA", {HistType::kTH1F, {cpaAxis}}}, + {"hCascCosPA", "hCascCosPA", {HistType::kTH1F, {cpaAxis}}}, + {"hDCAPosToPV", "hDCAPosToPV", {HistType::kTH1F, {vertexAxis}}}, + {"hDCANegToPV", "hDCANegToPV", {HistType::kTH1F, {vertexAxis}}}, + {"hDCABachToPV", "hDCABachToPV", {HistType::kTH1F, {vertexAxis}}}, + {"hDCAV0ToPV", "hDCAV0ToPV", {HistType::kTH1F, {vertexAxis}}}, + {"hDCAV0Dau", "hDCAV0Dau", {HistType::kTH1F, {dcaAxis}}}, + {"hDCACascDau", "hDCACascDau", {HistType::kTH1F, {dcaAxis}}}, + {"hLambdaMass", "hLambdaMass", {HistType::kTH1F, {invLambdaMassAxis}}}, + {"hTPCnCrossedRowsPos", "hTPCnCrossedRowsPos", {HistType::kTH1F, {tpcRowsAxis}}}, + {"hTPCnCrossedRowsNeg", "hTPCnCrossedRowsNeg", {HistType::kTH1F, {tpcRowsAxis}}}, + {"hTPCnCrossedRowsBach", "hTPCnCrossedRowsBach", {HistType::kTH1F, {tpcRowsAxis}}}, + {"hITSnClustersPos", "hITSnClustersPos", {HistType::kTH1F, {itsClustersAxis}}}, + {"hITSnClustersNeg", "hITSnClustersNeg", {HistType::kTH1F, {itsClustersAxis}}}, + {"hITSnClustersBach", "hITSnClustersBach", {HistType::kTH1F, {itsClustersAxis}}}, + + {"hSelectionFlag", "hSelectionFlag", {HistType::kTH1I, {selectionFlagAxis}}}, + {"hAutoCorrelation", "hAutoCorrelation", {HistType::kTH1I, {{4, -0.5f, 3.5f, "Types of SS autocorrelation"}}}}, + {"hAutoCorrelationOS", "hAutoCorrelationOS", {HistType::kTH1I, {{2, -1.f, 1.f, "Charge of OS autocorrelated track"}}}}, + {"hPhi", "hPhi", {HistType::kTH1F, {{180, 0, TwoPI, "#varphi"}}}}, + {"hEta", "hEta", {HistType::kTH1F, {{100, -2, 2, "#eta"}}}}, + {"hRapidityXi", "hRapidityXi", {HistType::kTH1F, {rapidityAxis}}}, + {"hRapidityOmega", "hRapidityOmega", {HistType::kTH1F, {rapidityAxis}}}, + + // correlation histos + {"hDeltaPhiSS", "hDeltaPhiSS", {HistType::kTH1F, {deltaPhiAxis}}}, + {"hDeltaPhiOS", "hDeltaPhiOS", {HistType::kTH1F, {deltaPhiAxis}}}, + + {"hXiXi", "hXiXi", {HistType::kTHnSparseF, {deltaPhiAxis, deltaYAxis, signAxis, signAxis, ptAxis, ptAxis, invMassAxis, invMassAxis, vertexAxis, multiplicityAxis}}, true}, + {"hXiOm", "hXiOm", {HistType::kTHnSparseF, {deltaPhiAxis, deltaYAxis, signAxis, signAxis, ptAxis, ptAxis, invMassAxis, invMassAxis, vertexAxis, multiplicityAxis}}, true}, + {"hOmOm", "hOmOm", {HistType::kTHnSparseF, {deltaPhiAxis, deltaYAxis, signAxis, signAxis, ptAxis, ptAxis, invMassAxis, invMassAxis, vertexAxis, multiplicityAxis}}, true}, + + // Mixed events + {"MixedEvents/hMEVz1", "hMEVz1", {HistType::kTH1F, {vertexAxis}}}, + {"MixedEvents/hMEVz2", "hMEVz2", {HistType::kTH1F, {vertexAxis}}}, + {"MixedEvents/hMEDeltaPhiSS", "hMEDeltaPhiSS", {HistType::kTH1F, {deltaPhiAxis}}}, + {"MixedEvents/hMEDeltaPhiOS", "hMEDeltaPhiOS", {HistType::kTH1F, {deltaPhiAxis}}}, + {"MixedEvents/hMEQA", "hMEQA", {HistType::kTH1I, {{2, 0, 2, "QA for exceptions in ME (this histogram should have 0 entries!)"}}}}, + {"MixedEvents/hMEAutoCorrelation", "hMEAutoCorrelation", {HistType::kTH1I, {{4, -0.5f, 3.5f, "Types of SS autocorrelation"}}}}, + {"MixedEvents/hMEAutoCorrelationOS", "hMEAutoCorrelationOS", {HistType::kTH1I, {{2, -1.f, 1.f, "Charge of OS autocorrelated track"}}}}, + + {"MixedEvents/hMEXiXi", "hMEXiXi", {HistType::kTHnSparseF, {deltaPhiAxis, deltaYAxis, signAxis, signAxis, ptAxis, ptAxis, invMassAxis, invMassAxis, vertexAxis, multiplicityAxis}}, true}, + {"MixedEvents/hMEXiOm", "hMEXiOm", {HistType::kTHnSparseF, {deltaPhiAxis, deltaYAxis, signAxis, signAxis, ptAxis, ptAxis, invMassAxis, invMassAxis, vertexAxis, multiplicityAxis}}, true}, + {"MixedEvents/hMEOmOm", "hMEOmOm", {HistType::kTHnSparseF, {deltaPhiAxis, deltaYAxis, signAxis, signAxis, ptAxis, ptAxis, invMassAxis, invMassAxis, vertexAxis, multiplicityAxis}}, true}, + + // MC closure + {"MC/hMCPlusMinus", "hMCPlusMinus", {HistType::kTHnSparseF, {deltaPhiAxis, deltaYAxis, ptAxis, ptAxis, vertexAxis, multiplicityAxis}}, true}, + {"MC/hMCPlusPlus", "hMCPlusPlus", {HistType::kTHnSparseF, {deltaPhiAxis, deltaYAxis, ptAxis, ptAxis, vertexAxis, multiplicityAxis}}, true}, + {"MC/hMCMinusPlus", "hMCMinusPlus", {HistType::kTHnSparseF, {deltaPhiAxis, deltaYAxis, ptAxis, ptAxis, vertexAxis, multiplicityAxis}}, true}, + {"MC/hMCMinusMinus", "hMCMinusMinus", {HistType::kTHnSparseF, {deltaPhiAxis, deltaYAxis, ptAxis, ptAxis, vertexAxis, multiplicityAxis}}, true}, + + {"MC/hGenMultNoReco", "hGenMultNoReco", {HistType::kTH1I, {{100, 0, 100, "Number of generated charged primaries"}}}}, + {"MC/hGenMultOneReco", "hGenMultOneReco", {HistType::kTH1I, {{100, 0, 100, "Number of generated charged primaries"}}}}, + {"MC/hSplitEvents", "hSplitEvents", {HistType::kTH1I, {{10, 0, 10, "Number of rec. events per gen event"}}}}, + + // debug + {"MC/hPhi", "hPhi", {HistType::kTH1F, {{180, 0, TwoPI}}}}, + {"MC/hEta", "hEta", {HistType::kTH1F, {{100, -2, 2}}}}, + {"MC/hRapidity", "hRapidity", {HistType::kTH1F, {{100, -2, 2}}}}, + }, + }; + + // cascade filter + Filter cascadeSelector = aod::cascadeflags::isSelected > 0; + + // Warning: it is not possible to use this axis as configurable due to a bug - however, default values are sensible. + SliceCache cache; + ConfigurableAxis axisVtxZ{"axisVtxZ", {VARIABLE_WIDTH, -10.0f, -8.f, -6.f, -4.f, -2.f, 0.f, 2.f, 4.f, 6.f, 8.f, 10.f}, "Mixing bins - z-vertex"}; + // ConfigurableAxis axisMult{"axisMult", {VARIABLE_WIDTH, 0, 5, 10, 20, 30, 40, 50, 100, 1000}, "Mixing bins - multiplicity"}; + // using BinningType = ColumnBinningPolicy; + // BinningType colBinning{{axisVtxZ, axisMult}, true}; // true is for 'ignore overflows' (true by default). Underflows and overflows will have bin -1. + using BinningType = ColumnBinningPolicy; + BinningType colBinning{{axisVtxZ}, true}; // true is for 'ignore overflows' (true by default). Underflows and overflows will have bin -1. + + void processSameEvent(MyCollisionsMult::iterator const& collision, MyCascades const& Cascades, FullTracksExtIU const&, aod::BCsWithTimestamps const&) + { + + double weight; + // Some QA on the cascades + for (auto const& casc : Cascades) { + if (casc.isSelected() <= 2) { // not exclusively an Omega --> consistent with Xi or both + if (casc.sign() < 0) { + registry.fill(HIST("hMassXiMinus"), casc.mXi(), casc.pt(), casc.yXi()); + weight = getEfficiency(hEffXiMin, casc.pt(), casc.yXi()); + } else { + registry.fill(HIST("hMassXiPlus"), casc.mXi(), casc.pt(), casc.yXi()); + weight = getEfficiency(hEffXiPlus, casc.pt(), casc.yXi()); + } + // LOGF(info, "casc pt %f, weight %f", casc.pt(), weight); + registry.fill(HIST("hMassXiEffCorrected"), casc.mXi(), casc.sign(), casc.pt(), casc.yXi(), collision.posZ(), collision.centFT0M(), weight); + registry.fill(HIST("hRapidityXi"), casc.yXi()); + } + if (casc.isSelected() >= 2) { // consistent with Omega or both + if (casc.sign() < 0) { + registry.fill(HIST("hMassOmegaMinus"), casc.mOmega(), casc.pt(), casc.yOmega()); + weight = getEfficiency(hEffOmegaMin, casc.pt(), casc.yOmega()); + } else { + registry.fill(HIST("hMassOmegaPlus"), casc.mOmega(), casc.pt(), casc.yOmega()); + weight = getEfficiency(hEffOmegaPlus, casc.pt(), casc.yOmega()); + } + registry.fill(HIST("hMassOmegaEffCorrected"), casc.mOmega(), casc.sign(), casc.pt(), casc.yOmega(), collision.posZ(), collision.centFT0M(), weight); + registry.fill(HIST("hRapidityOmega"), casc.yOmega()); + } + registry.fill(HIST("hV0Radius"), casc.v0radius()); + registry.fill(HIST("hCascRadius"), casc.cascradius()); + registry.fill(HIST("hV0CosPA"), casc.v0cosPA(collision.posX(), collision.posY(), collision.posZ())); + registry.fill(HIST("hCascCosPA"), casc.casccosPA(collision.posX(), collision.posY(), collision.posZ())); + registry.fill(HIST("hDCAPosToPV"), casc.dcapostopv()); + registry.fill(HIST("hDCANegToPV"), casc.dcanegtopv()); + registry.fill(HIST("hDCABachToPV"), casc.dcabachtopv()); + registry.fill(HIST("hDCAV0ToPV"), casc.dcav0topv(collision.posX(), collision.posY(), collision.posZ())); + registry.fill(HIST("hDCAV0Dau"), casc.dcaV0daughters()); + registry.fill(HIST("hDCACascDau"), casc.dcacascdaughters()); + registry.fill(HIST("hLambdaMass"), casc.mLambda()); + registry.fill(HIST("hITSnClustersPos"), casc.posTrack_as().itsNCls()); + registry.fill(HIST("hITSnClustersNeg"), casc.negTrack_as().itsNCls()); + registry.fill(HIST("hITSnClustersBach"), casc.bachelor_as().itsNCls()); + registry.fill(HIST("hTPCnCrossedRowsPos"), casc.posTrack_as().tpcNClsCrossedRows()); + registry.fill(HIST("hTPCnCrossedRowsNeg"), casc.negTrack_as().tpcNClsCrossedRows()); + registry.fill(HIST("hTPCnCrossedRowsBach"), casc.bachelor_as().tpcNClsCrossedRows()); + + registry.fill(HIST("hSelectionFlag"), casc.isSelected()); + registry.fill(HIST("hPhi"), casc.phi()); + registry.fill(HIST("hEta"), casc.eta()); + } // casc loop + + for (auto& [c0, c1] : combinations(Cascades, Cascades)) { // combinations automatically applies strictly upper in case of 2 identical tables + // Define the trigger as the particle with the highest pT. As we can't swap the cascade tables themselves, we swap the addresses and later dereference them + auto* triggerAddress = &c0; + auto* assocAddress = &c1; + if (assocAddress->pt() > triggerAddress->pt()) { + std::swap(triggerAddress, assocAddress); + } + auto trigger = *triggerAddress; + auto assoc = *assocAddress; + + // autocorrelation check + std::array triggerTracks = {trigger.posTrackId(), trigger.negTrackId(), trigger.bachelorId()}; + std::array assocTracks = {assoc.posTrackId(), assoc.negTrackId(), assoc.bachelorId()}; + if (autoCorrelation(triggerTracks, assocTracks)) + continue; + + // calculate angular correlations + double dphi = RecoDecay::constrainAngle(trigger.phi() - assoc.phi(), -PIHalf); + + double invMassXiTrigg = trigger.mXi(); + double invMassOmTrigg = trigger.mOmega(); + double invMassXiAssoc = assoc.mXi(); + double invMassOmAssoc = assoc.mOmega(); + + double weightTrigg = 1.; + double weightAssoc = 1.; + + if (trigger.isSelected() <= 2 && std::abs(trigger.yXi()) < maxRapidity) { // trigger Xi + if (doEfficiencyCorrection) + weightTrigg = trigger.sign() < 0 ? getEfficiency(hEffXiMin, trigger.pt()) : getEfficiency(hEffXiPlus, trigger.pt()); + if (assoc.isSelected() <= 2 && std::abs(assoc.yXi()) < maxRapidity) { // assoc Xi + if (doEfficiencyCorrection) + weightAssoc = assoc.sign() < 0 ? getEfficiency(hEffXiMin, assoc.pt()) : getEfficiency(hEffXiPlus, assoc.pt()); + registry.fill(HIST("hXiXi"), dphi, trigger.yXi() - assoc.yXi(), trigger.sign(), assoc.sign(), trigger.pt(), assoc.pt(), invMassXiTrigg, invMassXiAssoc, collision.posZ(), collision.centFT0M(), weightTrigg * weightAssoc); + } + if (assoc.isSelected() >= 2 && std::abs(assoc.yOmega()) < maxRapidity) { // assoc Omega + if (doEfficiencyCorrection) + weightAssoc = assoc.sign() < 0 ? getEfficiency(hEffOmegaMin, assoc.pt()) : getEfficiency(hEffOmegaPlus, assoc.pt()); + registry.fill(HIST("hXiOm"), dphi, trigger.yXi() - assoc.yOmega(), trigger.sign(), assoc.sign(), trigger.pt(), assoc.pt(), invMassXiTrigg, invMassOmAssoc, collision.posZ(), collision.centFT0M(), weightTrigg * weightAssoc); + } + } + if (trigger.isSelected() >= 2 && std::abs(trigger.yOmega()) < maxRapidity) { // trigger Omega + if (doEfficiencyCorrection) + weightTrigg = trigger.sign() < 0 ? getEfficiency(hEffOmegaMin, trigger.pt()) : getEfficiency(hEffOmegaPlus, trigger.pt()); + if (assoc.isSelected() <= 2 && std::abs(assoc.yXi()) < maxRapidity) { // assoc Xi + if (doEfficiencyCorrection) + weightAssoc = assoc.sign() < 0 ? getEfficiency(hEffXiMin, assoc.pt()) : getEfficiency(hEffXiPlus, assoc.pt()); + // if Omega-Xi, fill the Xi-Omega histogram (flip the trigger/assoc and dphy,dy signs) + registry.fill(HIST("hXiOm"), RecoDecay::constrainAngle(assoc.phi() - trigger.phi(), -PIHalf), -(trigger.yOmega() - assoc.yXi()), assoc.sign(), trigger.sign(), assoc.pt(), trigger.pt(), invMassXiAssoc, invMassOmTrigg, collision.posZ(), collision.centFT0M(), weightTrigg * weightAssoc); + } + if (assoc.isSelected() >= 2 && std::abs(assoc.yOmega()) < maxRapidity) { // assoc Omega + if (doEfficiencyCorrection) + weightAssoc = assoc.sign() < 0 ? getEfficiency(hEffOmegaMin, assoc.pt()) : getEfficiency(hEffOmegaPlus, assoc.pt()); + registry.fill(HIST("hOmOm"), dphi, trigger.yOmega() - assoc.yOmega(), trigger.sign(), assoc.sign(), trigger.pt(), assoc.pt(), invMassOmTrigg, invMassOmAssoc, collision.posZ(), collision.centFT0M(), weightTrigg * weightAssoc); + } + } + + // QA plots + if (trigger.sign() * assoc.sign() < 0) { + registry.fill(HIST("hDeltaPhiOS"), dphi); + } else { + registry.fill(HIST("hDeltaPhiSS"), dphi); + } + } // correlations + } // process same event + + void processMixedEvent(MyCollisionsMult const& collisions, MyCascades const& Cascades, FullTracksExtIU const&) + { + auto cascadesTuple = std::make_tuple(Cascades); + SameKindPair pair{colBinning, nMixedEvents, -1, collisions, cascadesTuple, &cache}; + + for (auto const& [col1, cascades1, col2, cascades2] : pair) { + if (!col1.sel8() || !col2.sel8()) + continue; + if (std::abs(col1.posZ()) > zVertexCut || std::abs(col2.posZ()) > zVertexCut) + continue; + if (col1.globalIndex() == col2.globalIndex()) { + registry.fill(HIST("hMEQA"), 0.5); + continue; + } + registry.fill(HIST("MixedEvents/hMEVz1"), col1.posZ()); + registry.fill(HIST("MixedEvents/hMEVz2"), col2.posZ()); + + for (auto& [casc1, casc2] : combinations(CombinationsFullIndexPolicy(cascades1, cascades2))) { + // specify FullIndexPolicy since the cascades are from different collisions + auto* triggerAddress = &casc1; + auto* assocAddress = &casc2; + if (assocAddress->pt() > triggerAddress->pt()) { + std::swap(triggerAddress, assocAddress); + } + auto trigger = *triggerAddress; + auto assoc = *assocAddress; + + if (trigger.collisionId() == assoc.collisionId()) { + registry.fill(HIST("hMEQA"), 1.5); + continue; + } + + std::array triggerTracks = {trigger.posTrackId(), trigger.negTrackId(), trigger.bachelorId()}; + std::array assocTracks = {assoc.posTrackId(), assoc.negTrackId(), assoc.bachelorId()}; + if (autoCorrelation(triggerTracks, assocTracks)) + continue; + + double dphi = RecoDecay::constrainAngle(trigger.phi() - assoc.phi(), -PIHalf); + + double invMassXiTrigg = trigger.mXi(); + double invMassOmTrigg = trigger.mOmega(); + double invMassXiAssoc = assoc.mXi(); + double invMassOmAssoc = assoc.mOmega(); + + double weightTrigg = 1.; + double weightAssoc = 1.; + + if (trigger.isSelected() <= 2 && std::abs(trigger.yXi()) < maxRapidity) { // trigger Xi + if (doEfficiencyCorrection) + weightTrigg = trigger.sign() < 0 ? getEfficiency(hEffXiMin, trigger.pt()) : getEfficiency(hEffXiPlus, trigger.pt()); + if (assoc.isSelected() <= 2 && std::abs(assoc.yXi()) < maxRapidity) { // assoc Xi + if (doEfficiencyCorrection) + weightAssoc = assoc.sign() < 0 ? getEfficiency(hEffXiMin, assoc.pt()) : getEfficiency(hEffXiPlus, assoc.pt()); + registry.fill(HIST("MixedEvents/hMEXiXi"), dphi, trigger.yXi() - assoc.yXi(), trigger.sign(), assoc.sign(), trigger.pt(), assoc.pt(), invMassXiTrigg, invMassXiAssoc, col1.posZ(), col1.centFT0M(), weightTrigg * weightAssoc); + } + if (assoc.isSelected() >= 2 && std::abs(assoc.yOmega()) < maxRapidity) { // assoc Omega + if (doEfficiencyCorrection) + weightAssoc = assoc.sign() < 0 ? getEfficiency(hEffOmegaMin, assoc.pt()) : getEfficiency(hEffOmegaPlus, assoc.pt()); + registry.fill(HIST("MixedEvents/hMEXiOm"), dphi, trigger.yXi() - assoc.yOmega(), trigger.sign(), assoc.sign(), trigger.pt(), assoc.pt(), invMassXiTrigg, invMassOmAssoc, col1.posZ(), col1.centFT0M(), weightTrigg * weightAssoc); + } + } + if (trigger.isSelected() >= 2 && std::abs(trigger.yOmega()) < maxRapidity) { // trigger Omega + if (doEfficiencyCorrection) + weightTrigg = trigger.sign() < 0 ? getEfficiency(hEffOmegaMin, trigger.pt()) : getEfficiency(hEffOmegaPlus, trigger.pt()); + if (assoc.isSelected() <= 2 && std::abs(assoc.yXi()) < maxRapidity) { // assoc Xi + if (doEfficiencyCorrection) + weightAssoc = assoc.sign() < 0 ? getEfficiency(hEffXiMin, assoc.pt()) : getEfficiency(hEffXiPlus, assoc.pt()); + // if Omega-Xi, fill the Xi-Omega histogram (flip the trigger/assoc and dphy,dy signs) + registry.fill(HIST("MixedEvents/hMEXiOm"), RecoDecay::constrainAngle(assoc.phi() - trigger.phi(), -PIHalf), -(trigger.yOmega() - assoc.yXi()), assoc.sign(), trigger.sign(), assoc.pt(), trigger.pt(), invMassXiAssoc, invMassOmTrigg, col1.posZ(), col1.centFT0M(), weightTrigg * weightAssoc); + } + if (assoc.isSelected() >= 2 && std::abs(assoc.yOmega()) < maxRapidity) { // assoc Omega + if (doEfficiencyCorrection) + weightAssoc = assoc.sign() < 0 ? getEfficiency(hEffOmegaMin, assoc.pt()) : getEfficiency(hEffOmegaPlus, assoc.pt()); + registry.fill(HIST("MixedEvents/hMEOmOm"), dphi, trigger.yOmega() - assoc.yOmega(), trigger.sign(), assoc.sign(), trigger.pt(), assoc.pt(), invMassOmTrigg, invMassOmAssoc, col1.posZ(), col1.centFT0M(), weightTrigg * weightAssoc); + } + } + + // QA plots + if (trigger.sign() * assoc.sign() < 0) { + registry.fill(HIST("MixedEvents/hMEDeltaPhiOS"), dphi); + } else { + registry.fill(HIST("MixedEvents/hMEDeltaPhiSS"), dphi); + } + } // correlations + } // collisions + } // process mixed events + + Configurable etaGenCascades{"etaGenCascades", 0.8, "min/max of eta for generated cascades"}; + Filter genCascadesFilter = nabs(aod::mcparticle::pdgCode) == 3312; + + void processMC(aod::McCollision const&, soa::SmallGroups> const& collisions, soa::Filtered const& genCascades, aod::McParticles const& mcParticles) + { + // Let's do some logic on matched reconstructed collisions - if there less or more than one, fill some QA and skip the rest + double FT0mult = -1; // non-sensible default value just in case + double vtxz = -999.; // non-sensible default value just in case + if (collisions.size() < 1) { + registry.fill(HIST("MC/hSplitEvents"), 0); + registry.fill(HIST("MC/hGenMultNoReco"), mCounter.countFT0A(mcParticles) + mCounter.countFT0C(mcParticles)); + return; + } else if (collisions.size() == 1) { + registry.fill(HIST("MC/hSplitEvents"), 1); + registry.fill(HIST("MC/hGenMultOneReco"), mCounter.countFT0A(mcParticles) + mCounter.countFT0C(mcParticles)); + for (auto const& collision : collisions) { // not really a loop, as there is only one collision + FT0mult = collision.centFT0M(); + vtxz = collision.posZ(); + } + } else if (collisions.size() > 1) { + registry.fill(HIST("MC/hSplitEvents"), collisions.size()); + return; + } + + // QA + for (auto& casc : genCascades) { + if (!casc.isPhysicalPrimary()) + continue; + registry.fill(HIST("MC/hPhi"), casc.phi()); + registry.fill(HIST("MC/hEta"), casc.eta()); + registry.fill(HIST("MC/hRapidity"), casc.y()); + } + + for (auto& [c0, c1] : combinations(genCascades, genCascades)) { // combinations automatically applies strictly upper in case of 2 identical tables + // Define the trigger as the particle with the highest pT. As we can't swap the cascade tables themselves, we swap the addresses and later dereference them + auto* triggerAddress = &c0; + auto* assocAddress = &c1; + if (assocAddress->pt() > triggerAddress->pt()) { + std::swap(triggerAddress, assocAddress); + } + auto trigger = *triggerAddress; + auto assoc = *assocAddress; + + if (!trigger.isPhysicalPrimary() || !assoc.isPhysicalPrimary()) + continue; // require the cascades to be primaries + if (std::abs(trigger.eta()) > etaGenCascades) + continue; // only apply eta cut to trigger - trigger normalization still valid without introducing 2-particle-acceptance effects + + double dphi = RecoDecay::constrainAngle(trigger.phi() - assoc.phi(), -PIHalf); + + if (trigger.pdgCode() < 0) { // anti-trigg --> Plus + if (assoc.pdgCode() < 0) { // anti-assoc --> Plus + registry.fill(HIST("MC/hMCPlusPlus"), dphi, trigger.y() - assoc.y(), trigger.pt(), assoc.pt(), vtxz, FT0mult); + } else { // assoc --> Minus + registry.fill(HIST("MC/hMCPlusMinus"), dphi, trigger.y() - assoc.y(), trigger.pt(), assoc.pt(), vtxz, FT0mult); + } + } else { // trig --> Minus + if (assoc.pdgCode() < 0) { // anti-assoc --> Plus + registry.fill(HIST("MC/hMCMinusPlus"), dphi, trigger.y() - assoc.y(), trigger.pt(), assoc.pt(), vtxz, FT0mult); + } else { + registry.fill(HIST("MC/hMCMinusMinus"), dphi, trigger.y() - assoc.y(), trigger.pt(), assoc.pt(), vtxz, FT0mult); + } + } + } + } + + PROCESS_SWITCH(CascadeCorrelations, processSameEvent, "Process same events", true); + PROCESS_SWITCH(CascadeCorrelations, processMixedEvent, "Process mixed events", true); + PROCESS_SWITCH(CascadeCorrelations, processMC, "Process MC", false); + +}; // struct + +// Branch data structs for TTree filling — plain POD, no O2 framework types. +// Stored via a single raw pointer (1 StructToTuple slot) from the task struct. +namespace lxicorr +{ +struct CascBranches { + float pt, rap, mass; + int sign; + float cascCosPA, v0CosPA; + float cascRadius, v0Radius; + float dcaV0Dau, dcaCascDau; + float dcaV0ToPV, dcaPosToPV, dcaNegToPV, dcaBachToPV; + float cent, pvZ; + // MC truth-matching (filled only in MC mode; default = no match) + int pdgCode{0}; // PDG of matched McParticle (0 = no match = background) + bool isPhysPrim{false}; +}; + +// Holds branch data for both Xi and Omega — one raw pointer covers both. +// Gen-level branches — kinematics + truth only, no topology +struct GenBranches { + float pt, rap, cent, pvZ; + int pdgCode; + bool isPhysPrim; +}; + +// Single pointer covers all four branch sets — 1 StructToTuple slot +struct BranchPair { + CascBranches xi{}; + CascBranches om{}; + GenBranches xiGen{}; + GenBranches omGen{}; +}; + +inline void connectBranches(TTree* t, CascBranches* b) +{ + t->Branch("pt", &b->pt); + t->Branch("rap", &b->rap); + t->Branch("mass", &b->mass); + t->Branch("sign", &b->sign); + t->Branch("cascCosPA", &b->cascCosPA); + t->Branch("v0CosPA", &b->v0CosPA); + t->Branch("cascRadius", &b->cascRadius); + t->Branch("v0Radius", &b->v0Radius); + t->Branch("dcaV0Dau", &b->dcaV0Dau); + t->Branch("dcaCascDau", &b->dcaCascDau); + t->Branch("dcaV0ToPV", &b->dcaV0ToPV); + t->Branch("dcaPosToPV", &b->dcaPosToPV); + t->Branch("dcaNegToPV", &b->dcaNegToPV); + t->Branch("dcaBachToPV", &b->dcaBachToPV); + t->Branch("cent", &b->cent); + t->Branch("pvZ", &b->pvZ); + t->Branch("pdgCode", &b->pdgCode); + t->Branch("isPhysPrim", &b->isPhysPrim); +} + +inline void connectGenBranches(TTree* t, GenBranches* b) +{ + t->Branch("pt", &b->pt); + t->Branch("rap", &b->rap); + t->Branch("pdgCode", &b->pdgCode); + t->Branch("isPhysPrim", &b->isPhysPrim); + t->Branch("cent", &b->cent); + t->Branch("pvZ", &b->pvZ); +} +} // namespace lxicorr + +struct LambdaXiCorrelation { + + // --- Configurables --- + Configurable maxY{"maxY", 0.5, "Max |y| for Lambda, Xi and Omega"}; + Configurable useEff{"useEff", false, "Apply Lambda efficiency correction"}; + // Omega bachelor kaon PID cut (kept separate from Xi pion cut for physics correctness) + Configurable tpcNsigmaBachKaon{"tpcNsigmaBachKaon", 3.0f, "TPC NSigma bachelor kaon (Omega selection)"}; + // FT0M centrality bins — same variable-width defaults as LambdaR2Correlation + ConfigurableAxis centAxis{"centAxis", {VARIABLE_WIDTH, 0.0f, 10.0f, 30.0f, 50.0f, 80.0f, 100.0f}, "FT0M centrality (%)"}; + Configurable saveCascTree{"saveCascTree", false, "Save TTree of cascade topological variables into AnalysisResults.root"}; + + // --- Outputs --- + HistogramRegistry histos{"Histos", {}, OutputObjHandlingPolicy::AnalysisObject}; + // Direct OutputObj members → framework registers and writes these into + // AnalysisResults.root under the "CascadeTrees" folder automatically. + // setObject() is called in init() when saveCascTree is true. + OutputObj treeXi{"XiCandidates", OutputObjHandlingPolicy::AnalysisObject}; + OutputObj treeOmega{"OmegaCandidates", OutputObjHandlingPolicy::AnalysisObject}; + OutputObj treeXiGen{"XiCandidatesGen", OutputObjHandlingPolicy::AnalysisObject}; + OutputObj treeOmegaGen{"OmegaCandidatesGen", OutputObjHandlingPolicy::AnalysisObject}; + // Single raw pointer covers all four branch sets — 1 StructToTuple slot + lxicorr::BranchPair* bp{nullptr}; + + // --- Data Slicing Definitions --- + using GoodLambdas = soa::Join; + Partition goodLambda = aod::lambdatrackext::trueLambdaFlag == true; + + Preslice lambdasPerCollision = aod::lambdatrack::lambdaCollisionId; + Preslice cascadesPerCollision = aod::cascdata::collisionId; + Preslice labeledCascPerCollision = aod::cascdata::collisionId; + // Gen-level lambda slicing: use HashBy (unsorted-safe) via o2::framework::expressions + // Simple approach: iterate all and match by collision index inline (no cache needed) + + using LambdaCollisionsExt = aod::LambdaCollisions; + + // Gen Xi/Omega: PDG filtering is done inline inside each process function. + // (Two Filter declarations on the same table within one struct are AND-ed, + // so |pdg|==3312 AND |pdg|==3334 would always be false.) + Preslice mcParticlesPerMcCollision = aod::mcparticle::mcCollisionId; + + // --- R2 Calculation Helper --- + // R2 = (N_events * Pair_Yield) / (Single_Yield_1 * Single_Yield_2) - 1 + static TH2* calculateR2(TH2* hPairs, TH1* hSinglesTrig, TH1* hSinglesAssoc, double nEvents) + { + if (!hPairs || !hSinglesTrig || !hSinglesAssoc || nEvents <= 0) + return nullptr; + + TH2* hR2 = reinterpret_cast(hPairs->Clone(Form("%s_R2", hPairs->GetName()))); + hR2->Reset(); + + double nS1 = hSinglesTrig->Integral(); + double nS2 = hSinglesAssoc->Integral(); + + if (nS1 > 0 && nS2 > 0) { + hR2->Add(hPairs); + hR2->Scale(nEvents / (nS1 * nS2)); + + for (int i = 1; i <= hR2->GetNbinsX(); i++) { + for (int j = 1; j <= hR2->GetNbinsY(); j++) { + double content = hR2->GetBinContent(i, j); + hR2->SetBinContent(i, j, content - 1.0); + } + } + } + return hR2; + } + + void init(InitContext const&) + { + // --- 1. Axis Definitions --- + const AxisSpec dphi{72, -PIHalf, 3 * PIHalf, "#Delta#varphi"}; + const AxisSpec dy{40, -2.0f, 2.0f, "#Delta y"}; + const AxisSpec cent{centAxis, "FT0M (%)"}; + const AxisSpec pt{100, 0, 10, "p_{T} (GeV/c)"}; + const AxisSpec rap{100, -1.0, 1.0, "y"}; + const AxisSpec massLam{100, 1.09, 1.14, "M_{p#pi} (GeV/c^{2})"}; + const AxisSpec massXi{100, 1.28, 1.36, "M_{#Lambda#pi} (GeV/c^{2})"}; + const AxisSpec massOm{100, 1.62, 1.72, "M_{#LambdaK} (GeV/c^{2})"}; + const AxisSpec radius{100, 0, 100, "Radius (cm)"}; + const AxisSpec cpa{100, 0.9, 1.0, "Cos(PA)"}; + const AxisSpec dca{100, 0.0, 5.0, "DCA (cm)"}; + const AxisSpec pvDca{100, -10.0, 10.0, "DCA to PV (cm)"}; + // Fixed AxisSpec (not ConfigurableAxis) so bin edges cannot be misconfigured at runtime + const AxisSpec tpcRows{160, -0.5, 159.5, "TPC crossed rows"}; + + // --- 2. Histograms --- + histos.add("Event/hEventCount", "Event Counter", kTH1F, {{1, 0, 1, "Count"}}); + + // Singles: Lambda + histos.add("Singles/Lambda/hPt", "Lambda p_{T}", kTH1F, {pt}); + histos.add("Singles/AntiLambda/hPt", "AntiLambda p_{T}", kTH1F, {pt}); + + histos.add("Singles/Lambda/hPtVsMass", "Lambda p_{T} vs Mass", kTH2F, {massLam, pt}); + histos.add("Singles/AntiLambda/hPtVsMass", "AntiLambda p_{T} vs Mass", kTH2F, {massLam, pt}); + + // Singles: Xi & QA + histos.add("QA/Xi/hRadius", "Xi Radius", kTH1F, {radius}); + histos.add("QA/Xi/hCosPA", "Xi CosPA", kTH1F, {cpa}); + histos.add("QA/Xi/hDCAV0Dau", "DCA V0 Daughters", kTH1F, {dca}); + histos.add("QA/Xi/hDCACascDau", "DCA Casc Daughters", kTH1F, {dca}); + histos.add("QA/Xi/hDCAV0ToPV", "DCA V0 to PV", kTH1F, {pvDca}); + histos.add("QA/Xi/hDCAPosToPV", "DCA Pos to PV", kTH1F, {pvDca}); + histos.add("QA/Xi/hDCANegToPV", "DCA Neg to PV", kTH1F, {pvDca}); + histos.add("QA/Xi/hDCABachToPV", "DCA Bach to PV", kTH1F, {pvDca}); + + // Cascade track QA — TPC crossed rows per daughter (fixed AxisSpec, immune to config override) + histos.add("QA/Casc/hTPCRowsPos", "TPC crossed rows (pos)", kTH1F, {tpcRows}); + histos.add("QA/Casc/hTPCRowsNeg", "TPC crossed rows (neg)", kTH1F, {tpcRows}); + histos.add("QA/Casc/hTPCRowsBach", "TPC crossed rows (bach)", kTH1F, {tpcRows}); + + histos.add("Singles/XiMinus/hPtVsMass", "Xi^{-} p_{T} vs Mass", kTH2F, {massXi, pt}); + histos.add("Singles/XiPlus/hPtVsMass", "Xi^{+} p_{T} vs Mass", kTH2F, {massXi, pt}); + histos.add("Singles/XiMinus/hRap", "Xi^{-} Rapidity", kTH1F, {rap}); + histos.add("Singles/XiPlus/hRap", "Xi^{+} Rapidity", kTH1F, {rap}); + + // --- Omega QA --- + histos.add("QA/Om/hRadius", "Omega Radius", kTH1F, {radius}); + histos.add("QA/Om/hCosPA", "Omega CosPA", kTH1F, {cpa}); + histos.add("QA/Om/hDCAV0Dau", "DCA V0 Daughters", kTH1F, {dca}); + histos.add("QA/Om/hDCACascDau", "DCA Casc Daughters", kTH1F, {dca}); + histos.add("QA/Om/hDCAV0ToPV", "DCA V0 to PV", kTH1F, {pvDca}); + histos.add("QA/Om/hDCAPosToPV", "DCA Pos to PV", kTH1F, {pvDca}); + histos.add("QA/Om/hDCANegToPV", "DCA Neg to PV", kTH1F, {pvDca}); + histos.add("QA/Om/hDCABachToPV", "DCA Bach to PV", kTH1F, {pvDca}); + + // Singles: Omega + histos.add("Singles/OmegaMinus/hPtVsMass", "Omega^{-} p_{T} vs Mass", kTH2F, {massOm, pt}); + histos.add("Singles/OmegaPlus/hPtVsMass", "Omega^{+} p_{T} vs Mass", kTH2F, {massOm, pt}); + histos.add("Singles/OmegaMinus/hRap", "Omega^{-} Rapidity", kTH1F, {rap}); + histos.add("Singles/OmegaPlus/hRap", "Omega^{+} Rapidity", kTH1F, {rap}); + + // Pairs: Xi (R2 inputs) + histos.add("Pairs/Lam_XiM/hDeltaPhiDeltaY", "L-Xi-", kTH3F, {cent, dphi, dy}); + histos.add("Pairs/Lam_XiP/hDeltaPhiDeltaY", "L-Xi+", kTH3F, {cent, dphi, dy}); + histos.add("Pairs/AntiLam_XiM/hDeltaPhiDeltaY", "AL-Xi-", kTH3F, {cent, dphi, dy}); + histos.add("Pairs/AntiLam_XiP/hDeltaPhiDeltaY", "AL-Xi+", kTH3F, {cent, dphi, dy}); + + // Pairs: Omega (R2 inputs) + histos.add("Pairs/Lam_OmM/hDeltaPhiDeltaY", "L-Om-", kTH3F, {cent, dphi, dy}); + histos.add("Pairs/Lam_OmP/hDeltaPhiDeltaY", "L-Om+", kTH3F, {cent, dphi, dy}); + histos.add("Pairs/AntiLam_OmM/hDeltaPhiDeltaY", "AL-Om-", kTH3F, {cent, dphi, dy}); + histos.add("Pairs/AntiLam_OmP/hDeltaPhiDeltaY", "AL-Om+", kTH3F, {cent, dphi, dy}); + + // --- MC Gen-level histograms (mirror reco under McGen/) --- + // Singles: gen Lambda + histos.add("McGen/Singles/Lambda/hPt", "Gen #Lambda p_{T}", kTH1F, {pt}); + histos.add("McGen/Singles/AntiLambda/hPt", "Gen #bar{#Lambda} p_{T}", kTH1F, {pt}); + + // Singles: gen Xi + histos.add("McGen/Singles/XiMinus/hPtVsRap", "Gen #Xi^{-} p_{T} vs y", kTH2F, {rap, pt}); + histos.add("McGen/Singles/XiPlus/hPtVsRap", "Gen #Xi^{+} p_{T} vs y", kTH2F, {rap, pt}); + + // Singles: gen Omega + histos.add("McGen/Singles/OmegaMinus/hPtVsRap", "Gen #Omega^{-} p_{T} vs y", kTH2F, {rap, pt}); + histos.add("McGen/Singles/OmegaPlus/hPtVsRap", "Gen #Omega^{+} p_{T} vs y", kTH2F, {rap, pt}); + + // Pairs: gen Lam-Xi + histos.add("McGen/Pairs/Lam_XiM/hDeltaPhiDeltaY", "Gen L-Xi-", kTH3F, {cent, dphi, dy}); + histos.add("McGen/Pairs/Lam_XiP/hDeltaPhiDeltaY", "Gen L-Xi+", kTH3F, {cent, dphi, dy}); + histos.add("McGen/Pairs/AntiLam_XiM/hDeltaPhiDeltaY", "Gen AL-Xi-", kTH3F, {cent, dphi, dy}); + histos.add("McGen/Pairs/AntiLam_XiP/hDeltaPhiDeltaY", "Gen AL-Xi+", kTH3F, {cent, dphi, dy}); + + // Pairs: gen Lam-Omega + histos.add("McGen/Pairs/Lam_OmM/hDeltaPhiDeltaY", "Gen L-Om-", kTH3F, {cent, dphi, dy}); + histos.add("McGen/Pairs/Lam_OmP/hDeltaPhiDeltaY", "Gen L-Om+", kTH3F, {cent, dphi, dy}); + histos.add("McGen/Pairs/AntiLam_OmM/hDeltaPhiDeltaY", "Gen AL-Om-", kTH3F, {cent, dphi, dy}); + histos.add("McGen/Pairs/AntiLam_OmP/hDeltaPhiDeltaY", "Gen AL-Om+", kTH3F, {cent, dphi, dy}); + + // --- 3. Efficiency map production histograms --- + // Axis definitions for efficiency maps (coarser binning to avoid empty bins) + const AxisSpec effCent{cent}; + const AxisSpec effPt{50, 0, 10, "p_{T} (GeV/c)"}; + const AxisSpec effRap{20, -1.0, 1.0, "y"}; + + // Generator-level denominator: all physical-primary Xi/Omega in acceptance + histos.add("Eff/Gen/XiMinus/hCentPtRap", "Gen #Xi^{-}", kTH3F, {effCent, effPt, effRap}); + histos.add("Eff/Gen/XiPlus/hCentPtRap", "Gen #Xi^{+}", kTH3F, {effCent, effPt, effRap}); + histos.add("Eff/Gen/OmegaMinus/hCentPtRap", "Gen #Omega^{-}", kTH3F, {effCent, effPt, effRap}); + histos.add("Eff/Gen/OmegaPlus/hCentPtRap", "Gen #Omega^{+}", kTH3F, {effCent, effPt, effRap}); + // Reco-level numerator: truth-matched reco Xi/Omega (physical-primary) + histos.add("Eff/Reco/XiMinus/hCentPtRap", "Reco #Xi^{-}", kTH3F, {effCent, effPt, effRap}); + histos.add("Eff/Reco/XiPlus/hCentPtRap", "Reco #Xi^{+}", kTH3F, {effCent, effPt, effRap}); + histos.add("Eff/Reco/OmegaMinus/hCentPtRap", "Reco #Omega^{-}", kTH3F, {effCent, effPt, effRap}); + histos.add("Eff/Reco/OmegaPlus/hCentPtRap", "Reco #Omega^{+}", kTH3F, {effCent, effPt, effRap}); + + // TTree setup — only allocates when saveCascTree is enabled. + // OutputObj are direct task members, so the framework automatically + // writes them into AnalysisResults.root under their own folder. + if (saveCascTree) { + bp = new lxicorr::BranchPair{}; + treeXi.setObject(new TTree("XiCandidates", "Xi topological variables")); + treeOmega.setObject(new TTree("OmegaCandidates", "Omega topological variables")); + lxicorr::connectBranches(treeXi.object.get(), &bp->xi); + lxicorr::connectBranches(treeOmega.object.get(), &bp->om); + treeXiGen.setObject(new TTree("XiCandidatesGen", "Xi gen-level kinematics")); + treeOmegaGen.setObject(new TTree("OmegaCandidatesGen", "Omega gen-level kinematics")); + lxicorr::connectGenBranches(treeXiGen.object.get(), &bp->xiGen); + lxicorr::connectGenBranches(treeOmegaGen.object.get(), &bp->omGen); + } + } + + // --- Analysis Functions --- + + template + void analyzeSinglesLambda(T const& tracks) + { + for (const auto& track : tracks) { + if (std::abs(track.rap()) > maxY) + continue; + + float w = useEff ? track.corrFact() : 1.0f; + bool isAnti = (track.v0Type() == 1); + + if (!isAnti) { + histos.fill(HIST("Singles/Lambda/hPt"), track.pt(), w); + histos.fill(HIST("Singles/Lambda/hPtVsMass"), track.mass(), track.pt(), w); + } else { + histos.fill(HIST("Singles/AntiLambda/hPt"), track.pt(), w); + histos.fill(HIST("Singles/AntiLambda/hPtVsMass"), track.mass(), track.pt(), w); + } + } + } + + template + void analyzeSinglesXi(T const& cascades, F const& flagsStart, float pvX, float pvY, float pvZ, float centVal) + { + for (const auto& casc : cascades) { + if ((flagsStart + casc.globalIndex()).isSelected() == 0) + continue; + + float xiY = RecoDecay::y(std::array{casc.px(), casc.py(), casc.pz()}, MassXi0); + if (std::abs(xiY) > maxY) + continue; + + // QA Filling + histos.fill(HIST("QA/Xi/hRadius"), casc.cascradius()); + histos.fill(HIST("QA/Xi/hCosPA"), casc.casccosPA(pvX, pvY, pvZ)); + histos.fill(HIST("QA/Xi/hDCAV0Dau"), casc.dcaV0daughters()); + histos.fill(HIST("QA/Xi/hDCACascDau"), casc.dcacascdaughters()); + histos.fill(HIST("QA/Xi/hDCAV0ToPV"), casc.dcav0topv(pvX, pvY, pvZ)); + histos.fill(HIST("QA/Xi/hDCAPosToPV"), casc.dcapostopv()); + histos.fill(HIST("QA/Xi/hDCANegToPV"), casc.dcanegtopv()); + histos.fill(HIST("QA/Xi/hDCABachToPV"), casc.dcabachtopv()); + + if (casc.sign() < 0) { + histos.fill(HIST("Singles/XiMinus/hPtVsMass"), casc.mXi(), casc.pt()); + histos.fill(HIST("Singles/XiMinus/hRap"), xiY); + } else { + histos.fill(HIST("Singles/XiPlus/hPtVsMass"), casc.mXi(), casc.pt()); + histos.fill(HIST("Singles/XiPlus/hRap"), xiY); + } + + // MC: fill efficiency numerator for truth-matched primary Xi + if constexpr (IsMC) { + if (casc.has_mcParticle()) { + auto mcpart = casc.mcParticle(); + if (std::abs(mcpart.pdgCode()) == 3312 && mcpart.isPhysicalPrimary()) { + if (mcpart.pdgCode() == 3312) + histos.fill(HIST("Eff/Reco/XiMinus/hCentPtRap"), centVal, casc.pt(), xiY); + else + histos.fill(HIST("Eff/Reco/XiPlus/hCentPtRap"), centVal, casc.pt(), xiY); + } + } + } + + if (bp) { + auto& b = bp->xi; + b.pt = casc.pt(); + b.rap = xiY; + b.mass = casc.mXi(); + b.sign = casc.sign(); + b.cascCosPA = casc.casccosPA(pvX, pvY, pvZ); + b.v0CosPA = casc.v0cosPA(pvX, pvY, pvZ); + b.cascRadius = casc.cascradius(); + b.v0Radius = casc.v0radius(); + b.dcaV0Dau = casc.dcaV0daughters(); + b.dcaCascDau = casc.dcacascdaughters(); + b.dcaV0ToPV = casc.dcav0topv(pvX, pvY, pvZ); + b.dcaPosToPV = casc.dcapostopv(); + b.dcaNegToPV = casc.dcanegtopv(); + b.dcaBachToPV = casc.dcabachtopv(); + b.cent = centVal; + b.pvZ = pvZ; + // MC truth matching + if constexpr (IsMC) { + if (casc.has_mcParticle()) { + auto mcpart = casc.mcParticle(); + b.pdgCode = mcpart.pdgCode(); + b.isPhysPrim = mcpart.isPhysicalPrimary(); + } else { + b.pdgCode = 0; + b.isPhysPrim = false; + } + } else { + b.pdgCode = 0; + b.isPhysPrim = false; + } + treeXi->Fill(); + } + } + } + + // Omega singles: kaon bachelor PID cut distinguishes Omega from Xi + template + void analyzeSinglesOmega(T const& cascades, F const& flagsStart, float pvX, float pvY, float pvZ, float centVal) + { + for (const auto& casc : cascades) { + if ((flagsStart + casc.globalIndex()).isSelected() == 0) + continue; + + float omY = RecoDecay::y(std::array{casc.px(), casc.py(), casc.pz()}, MassOmegaMinus); + if (std::abs(omY) > maxY) + continue; + + // Require kaon bachelor PID — NSigma lives on the track, not the cascade row + auto bachTrack = casc.template bachelor_as(); + if (std::abs(bachTrack.tpcNSigmaKa()) > tpcNsigmaBachKaon) + continue; + + // QA Filling (mirrors Xi QA under QA/Om/) + histos.fill(HIST("QA/Om/hRadius"), casc.cascradius()); + histos.fill(HIST("QA/Om/hCosPA"), casc.casccosPA(pvX, pvY, pvZ)); + histos.fill(HIST("QA/Om/hDCAV0Dau"), casc.dcaV0daughters()); + histos.fill(HIST("QA/Om/hDCACascDau"), casc.dcacascdaughters()); + histos.fill(HIST("QA/Om/hDCAV0ToPV"), casc.dcav0topv(pvX, pvY, pvZ)); + histos.fill(HIST("QA/Om/hDCAPosToPV"), casc.dcapostopv()); + histos.fill(HIST("QA/Om/hDCANegToPV"), casc.dcanegtopv()); + histos.fill(HIST("QA/Om/hDCABachToPV"), casc.dcabachtopv()); + + if (casc.sign() < 0) { + histos.fill(HIST("Singles/OmegaMinus/hPtVsMass"), casc.mOmega(), casc.pt()); + histos.fill(HIST("Singles/OmegaMinus/hRap"), omY); + } else { + histos.fill(HIST("Singles/OmegaPlus/hPtVsMass"), casc.mOmega(), casc.pt()); + histos.fill(HIST("Singles/OmegaPlus/hRap"), omY); + } + + // MC: fill efficiency numerator for truth-matched primary Omega + if constexpr (IsMC) { + if (casc.has_mcParticle()) { + auto mcpart = casc.mcParticle(); + if (std::abs(mcpart.pdgCode()) == 3334 && mcpart.isPhysicalPrimary()) { + if (mcpart.pdgCode() == 3334) + histos.fill(HIST("Eff/Reco/OmegaMinus/hCentPtRap"), centVal, casc.pt(), omY); + else + histos.fill(HIST("Eff/Reco/OmegaPlus/hCentPtRap"), centVal, casc.pt(), omY); + } + } + } + + if (bp) { + auto& b = bp->om; + b.pt = casc.pt(); + b.rap = omY; + b.mass = casc.mOmega(); + b.sign = casc.sign(); + b.cascCosPA = casc.casccosPA(pvX, pvY, pvZ); + b.v0CosPA = casc.v0cosPA(pvX, pvY, pvZ); + b.cascRadius = casc.cascradius(); + b.v0Radius = casc.v0radius(); + b.dcaV0Dau = casc.dcaV0daughters(); + b.dcaCascDau = casc.dcacascdaughters(); + b.dcaV0ToPV = casc.dcav0topv(pvX, pvY, pvZ); + b.dcaPosToPV = casc.dcapostopv(); + b.dcaNegToPV = casc.dcanegtopv(); + b.dcaBachToPV = casc.dcabachtopv(); + b.cent = centVal; + b.pvZ = pvZ; + // MC truth matching + if constexpr (IsMC) { + if (casc.has_mcParticle()) { + auto mcpart = casc.mcParticle(); + b.pdgCode = mcpart.pdgCode(); + b.isPhysPrim = mcpart.isPhysicalPrimary(); + } else { + b.pdgCode = 0; + b.isPhysPrim = false; + } + } else { + b.pdgCode = 0; + b.isPhysPrim = false; + } + treeOmega->Fill(); + } + } + } + + template + void analyzePairs(L const& lambdas, C const& cascades, F const& flagsStart, float centVal) + { + for (const auto& lam : lambdas) { + if (std::abs(lam.rap()) > maxY) + continue; + float wLam = useEff ? lam.corrFact() : 1.0f; + bool isAntiLam = (lam.v0Type() == 1); + + for (const auto& casc : cascades) { + if ((flagsStart + casc.globalIndex()).isSelected() == 0) + continue; + + float xiY = RecoDecay::y(std::array{casc.px(), casc.py(), casc.pz()}, MassXi0); + if (std::abs(xiY) > maxY) + continue; + + float dphi = RecoDecay::constrainAngle(casc.phi() - lam.phi(), -PIHalf); + float dy = xiY - lam.rap(); + + bool isXiPlus = (casc.sign() > 0); + + if (!isAntiLam && !isXiPlus) + histos.fill(HIST("Pairs/Lam_XiM/hDeltaPhiDeltaY"), centVal, dphi, dy, wLam); + else if (!isAntiLam && isXiPlus) + histos.fill(HIST("Pairs/Lam_XiP/hDeltaPhiDeltaY"), centVal, dphi, dy, wLam); + else if (isAntiLam && !isXiPlus) + histos.fill(HIST("Pairs/AntiLam_XiM/hDeltaPhiDeltaY"), centVal, dphi, dy, wLam); + else if (isAntiLam && isXiPlus) + histos.fill(HIST("Pairs/AntiLam_XiP/hDeltaPhiDeltaY"), centVal, dphi, dy, wLam); + } + } + } + + // Omega pair loop: same structure as Xi pairs but uses Omega mass for rapidity + kaon PID + template + void analyzeOmegaPairs(L const& lambdas, C const& cascades, F const& flagsStart, float centVal) + { + for (const auto& lam : lambdas) { + if (std::abs(lam.rap()) > maxY) + continue; + float wLam = useEff ? lam.corrFact() : 1.0f; + bool isAntiLam = (lam.v0Type() == 1); + + for (const auto& casc : cascades) { + if ((flagsStart + casc.globalIndex()).isSelected() == 0) + continue; + + auto bachTrack = casc.template bachelor_as(); + if (std::abs(bachTrack.tpcNSigmaKa()) > tpcNsigmaBachKaon) + continue; + + float omY = RecoDecay::y(std::array{casc.px(), casc.py(), casc.pz()}, MassOmegaMinus); + if (std::abs(omY) > maxY) + continue; + + float dphi = RecoDecay::constrainAngle(casc.phi() - lam.phi(), -PIHalf); + float dy = omY - lam.rap(); + + bool isOmPlus = (casc.sign() > 0); + + if (!isAntiLam && !isOmPlus) + histos.fill(HIST("Pairs/Lam_OmM/hDeltaPhiDeltaY"), centVal, dphi, dy, wLam); + else if (!isAntiLam && isOmPlus) + histos.fill(HIST("Pairs/Lam_OmP/hDeltaPhiDeltaY"), centVal, dphi, dy, wLam); + else if (isAntiLam && !isOmPlus) + histos.fill(HIST("Pairs/AntiLam_OmM/hDeltaPhiDeltaY"), centVal, dphi, dy, wLam); + else if (isAntiLam && isOmPlus) + histos.fill(HIST("Pairs/AntiLam_OmP/hDeltaPhiDeltaY"), centVal, dphi, dy, wLam); + } + } + } + + void processXi(LambdaCollisionsExt::iterator const& lambdacoll, + GoodLambdas const& /*lambdas*/, + aod::CascDataExt const& cascades, + aod::CascadeFlags const& cascflags) + { + histos.fill(HIST("Event/hEventCount"), 0.5); + + auto lambdasInThisEvent = goodLambda->sliceBy(lambdasPerCollision, lambdacoll.globalIndex()); + const int64_t refCollisionIndex = lambdacoll.refCollId(); + auto cascadesInThisEvent = cascades.sliceBy(cascadesPerCollision, refCollisionIndex); + + float pvX = lambdacoll.posX(); + float pvY = lambdacoll.posY(); + float pvZ = lambdacoll.posZ(); + + auto flagsStart = cascflags.begin(); + + analyzeSinglesLambda(lambdasInThisEvent); + float centVal = lambdacoll.cent(); + analyzeSinglesXi(cascadesInThisEvent, flagsStart, pvX, pvY, pvZ, centVal); + analyzePairs(lambdasInThisEvent, cascadesInThisEvent, flagsStart, centVal); + } + PROCESS_SWITCH(LambdaXiCorrelation, processXi, "Λ–Ξ correlation", true); + + void processOmega(LambdaCollisionsExt::iterator const& lambdacoll, + GoodLambdas const& /*lambdas*/, + aod::CascDataExt const& cascades, + aod::CascadeFlags const& cascflags, + FullTracksExtIUWithPID const& /*tracks*/) + { + histos.fill(HIST("Event/hEventCount"), 0.5); + + auto lambdasInThisEvent = goodLambda->sliceBy(lambdasPerCollision, lambdacoll.globalIndex()); + const int64_t refCollisionIndex = lambdacoll.refCollId(); + auto cascadesInThisEvent = cascades.sliceBy(cascadesPerCollision, refCollisionIndex); + + float pvX = lambdacoll.posX(); + float pvY = lambdacoll.posY(); + float pvZ = lambdacoll.posZ(); + + auto flagsStart = cascflags.begin(); + + analyzeSinglesLambda(lambdasInThisEvent); + float centVal = lambdacoll.cent(); + analyzeSinglesOmega(cascadesInThisEvent, flagsStart, pvX, pvY, pvZ, centVal); + analyzeOmegaPairs(lambdasInThisEvent, cascadesInThisEvent, flagsStart, centVal); + } + PROCESS_SWITCH(LambdaXiCorrelation, processOmega, "Λ–Ω correlation", false); + + // --------------------------------------------------------------------------- + // MC Reco-level with truth matching: Λ–Ξ + // Same as processXi but cascades carry McCascLabels → tree gets pdgCode/isPhysPrim. + // --------------------------------------------------------------------------- + void processMCRecoXi(LambdaCollisionsExt::iterator const& lambdacoll, + GoodLambdas const& /*lambdas*/, + LabeledCascades const& cascades, + aod::CascadeFlags const& cascflags, + aod::McParticles const& /*mcparts*/) + { + histos.fill(HIST("Event/hEventCount"), 0.5); + + auto lambdasInThisEvent = goodLambda->sliceBy(lambdasPerCollision, lambdacoll.globalIndex()); + const int64_t refCollisionIndex = lambdacoll.refCollId(); + auto cascadesInThisEvent = cascades.sliceBy(labeledCascPerCollision, refCollisionIndex); + + float pvX = lambdacoll.posX(); + float pvY = lambdacoll.posY(); + float pvZ = lambdacoll.posZ(); + + auto flagsStart = cascflags.begin(); + + analyzeSinglesLambda(lambdasInThisEvent); + float centVal = lambdacoll.cent(); + analyzeSinglesXi(cascadesInThisEvent, flagsStart, pvX, pvY, pvZ, centVal); + analyzePairs(lambdasInThisEvent, cascadesInThisEvent, flagsStart, centVal); + } + PROCESS_SWITCH(LambdaXiCorrelation, processMCRecoXi, "MC reco Λ–Ξ (truth-tagged tree)", false); + + // --------------------------------------------------------------------------- + // MC Reco-level with truth matching: Λ–Ω + // Same as processOmega but cascades carry McCascLabels → tree gets pdgCode/isPhysPrim. + // --------------------------------------------------------------------------- + void processMCRecoOmega(LambdaCollisionsExt::iterator const& lambdacoll, + GoodLambdas const& /*lambdas*/, + LabeledCascades const& cascades, + aod::CascadeFlags const& cascflags, + FullTracksExtIUWithPID const& /*tracks*/, + aod::McParticles const& /*mcparts*/) + { + histos.fill(HIST("Event/hEventCount"), 0.5); + + auto lambdasInThisEvent = goodLambda->sliceBy(lambdasPerCollision, lambdacoll.globalIndex()); + const int64_t refCollisionIndex = lambdacoll.refCollId(); + auto cascadesInThisEvent = cascades.sliceBy(labeledCascPerCollision, refCollisionIndex); + + float pvX = lambdacoll.posX(); + float pvY = lambdacoll.posY(); + float pvZ = lambdacoll.posZ(); + + auto flagsStart = cascflags.begin(); + + analyzeSinglesLambda(lambdasInThisEvent); + float centVal = lambdacoll.cent(); + analyzeSinglesOmega(cascadesInThisEvent, flagsStart, pvX, pvY, pvZ, centVal); + analyzeOmegaPairs(lambdasInThisEvent, cascadesInThisEvent, flagsStart, centVal); + } + PROCESS_SWITCH(LambdaXiCorrelation, processMCRecoOmega, "MC reco Λ–Ω (truth-tagged tree)", false); + + // --------------------------------------------------------------------------- + // MC Gen-level: Λ–Ξ truth correlation (closure test) + // Loops over generator-level primary Λ from LambdaMcGenTracks and + // generator-level Ξ from McParticles (inline PDG == ±3312 check). + // McParticles are sliced per McCollision using the stored refMcCollId. + // No reconstruction, no PID cuts — pure truth-level R2. + // --------------------------------------------------------------------------- + void processMCGenXi(aod::LambdaMcGenCollisions::iterator const& mcgencol, + aod::LambdaMcGenTracks const& genLambdasAll, + aod::McParticles const& allMcParts) + { + int32_t thisColId = mcgencol.globalIndex(); + histos.fill(HIST("Event/hEventCount"), 0.5); + float centVal = mcgencol.cent(); + + // Slice McParticles to only those belonging to this McCollision + int64_t mcCollId = mcgencol.refMcCollId(); + auto genXis = allMcParts.sliceBy(mcParticlesPerMcCollision, mcCollId); + + // Fill gen Lambda singles — filter by collision ID inline + for (const auto& lam : genLambdasAll) { + if (lam.lambdaMcGenCollisionId() != thisColId) + continue; + if (lam.v0Type() != (int8_t)kLambda || lam.v0PrmScd() != (int8_t)kPrimary) + continue; + if (std::abs(lam.rap()) > maxY) + continue; + histos.fill(HIST("McGen/Singles/Lambda/hPt"), lam.pt()); + } + for (const auto& lam : genLambdasAll) { + if (lam.lambdaMcGenCollisionId() != thisColId) + continue; + if (lam.v0Type() != (int8_t)kAntiLambda || lam.v0PrmScd() != (int8_t)kPrimary) + continue; + if (std::abs(lam.rap()) > maxY) + continue; + histos.fill(HIST("McGen/Singles/AntiLambda/hPt"), lam.pt()); + } + + // Fill gen Xi singles (inline PDG filter) + for (const auto& xi : genXis) { + if (std::abs(xi.pdgCode()) != 3312) + continue; // inline PDG filter + if (!xi.isPhysicalPrimary()) + continue; + float xiY = RecoDecay::y(std::array{xi.px(), xi.py(), xi.pz()}, MassXi0); + if (std::abs(xiY) > maxY) + continue; + if (xi.pdgCode() == 3312) + histos.fill(HIST("McGen/Singles/XiMinus/hPtVsRap"), xiY, xi.pt()); + else if (xi.pdgCode() == -3312) + histos.fill(HIST("McGen/Singles/XiPlus/hPtVsRap"), xiY, xi.pt()); + + // Efficiency denominator: all physical-primary gen Xi in acceptance + if (xi.pdgCode() == 3312) + histos.fill(HIST("Eff/Gen/XiMinus/hCentPtRap"), centVal, xi.pt(), xiY); + else + histos.fill(HIST("Eff/Gen/XiPlus/hCentPtRap"), centVal, xi.pt(), xiY); + + if (bp) { + auto& b = bp->xiGen; + b.pt = xi.pt(); + b.rap = xiY; + b.pdgCode = xi.pdgCode(); + b.isPhysPrim = xi.isPhysicalPrimary(); + b.cent = centVal; + b.pvZ = mcgencol.posZ(); + treeXiGen->Fill(); + } + } + + // Fill gen Lam-Xi pairs + auto fillGenXiPairs = [&](bool isAntiLam) { + int8_t wantType = isAntiLam ? (int8_t)kAntiLambda : (int8_t)kLambda; + for (const auto& lam : genLambdasAll) { + if (lam.lambdaMcGenCollisionId() != thisColId) + continue; + if (lam.v0Type() != wantType || lam.v0PrmScd() != (int8_t)kPrimary) + continue; + if (std::abs(lam.rap()) > maxY) + continue; + for (const auto& xi : genXis) { + if (std::abs(xi.pdgCode()) != 3312) + continue; // inline PDG filter + if (!xi.isPhysicalPrimary()) + continue; + float xiY = RecoDecay::y(std::array{xi.px(), xi.py(), xi.pz()}, MassXi0); + if (std::abs(xiY) > maxY) + continue; + float dphi = RecoDecay::constrainAngle(xi.phi() - lam.phi(), -PIHalf); + float dy = xiY - lam.rap(); + bool isXiPlus = (xi.pdgCode() == -3312); + if (!isAntiLam && !isXiPlus) + histos.fill(HIST("McGen/Pairs/Lam_XiM/hDeltaPhiDeltaY"), centVal, dphi, dy); + else if (!isAntiLam && isXiPlus) + histos.fill(HIST("McGen/Pairs/Lam_XiP/hDeltaPhiDeltaY"), centVal, dphi, dy); + else if (isAntiLam && !isXiPlus) + histos.fill(HIST("McGen/Pairs/AntiLam_XiM/hDeltaPhiDeltaY"), centVal, dphi, dy); + else + histos.fill(HIST("McGen/Pairs/AntiLam_XiP/hDeltaPhiDeltaY"), centVal, dphi, dy); + } + } + }; + fillGenXiPairs(false); + fillGenXiPairs(true); + } + PROCESS_SWITCH(LambdaXiCorrelation, processMCGenXi, "MC gen-level Λ–Ξ closure", false); + + // --------------------------------------------------------------------------- + // MC Gen-level: Λ–Ω truth correlation (closure test) + // Same structure as processMCGenXi but uses |PDG| == 3334 (Omega). + // No kaon PID cut needed — truth level. + // --------------------------------------------------------------------------- + void processMCGenOmega(aod::LambdaMcGenCollisions::iterator const& mcgencol, + aod::LambdaMcGenTracks const& genLambdasAll, + aod::McParticles const& allMcParts) + { + int32_t thisColId = mcgencol.globalIndex(); + histos.fill(HIST("Event/hEventCount"), 0.5); + float centVal = mcgencol.cent(); + + // Slice McParticles to only those belonging to this McCollision + int64_t mcCollId = mcgencol.refMcCollId(); + auto genOmegas = allMcParts.sliceBy(mcParticlesPerMcCollision, mcCollId); + + // Fill gen Lambda singles — filter by collision ID inline + for (const auto& lam : genLambdasAll) { + if (lam.lambdaMcGenCollisionId() != thisColId) + continue; + if (lam.v0Type() != (int8_t)kLambda || lam.v0PrmScd() != (int8_t)kPrimary) + continue; + if (std::abs(lam.rap()) > maxY) + continue; + histos.fill(HIST("McGen/Singles/Lambda/hPt"), lam.pt()); + } + for (const auto& lam : genLambdasAll) { + if (lam.lambdaMcGenCollisionId() != thisColId) + continue; + if (lam.v0Type() != (int8_t)kAntiLambda || lam.v0PrmScd() != (int8_t)kPrimary) + continue; + if (std::abs(lam.rap()) > maxY) + continue; + histos.fill(HIST("McGen/Singles/AntiLambda/hPt"), lam.pt()); + } + + // Fill gen Omega singles (inline PDG filter) + for (const auto& om : genOmegas) { + if (std::abs(om.pdgCode()) != 3334) + continue; // inline PDG filter + if (!om.isPhysicalPrimary()) + continue; + float omY = RecoDecay::y(std::array{om.px(), om.py(), om.pz()}, MassOmegaMinus); + if (std::abs(omY) > maxY) + continue; + if (om.pdgCode() == 3334) + histos.fill(HIST("McGen/Singles/OmegaMinus/hPtVsRap"), omY, om.pt()); + else if (om.pdgCode() == -3334) + histos.fill(HIST("McGen/Singles/OmegaPlus/hPtVsRap"), omY, om.pt()); + + // Efficiency denominator: all physical-primary gen Omega in acceptance + if (om.pdgCode() == 3334) + histos.fill(HIST("Eff/Gen/OmegaMinus/hCentPtRap"), centVal, om.pt(), omY); + else + histos.fill(HIST("Eff/Gen/OmegaPlus/hCentPtRap"), centVal, om.pt(), omY); + + if (bp) { + auto& b = bp->omGen; + b.pt = om.pt(); + b.rap = omY; + b.pdgCode = om.pdgCode(); + b.isPhysPrim = om.isPhysicalPrimary(); + b.cent = centVal; + b.pvZ = mcgencol.posZ(); + treeOmegaGen->Fill(); + } + } + + // Fill gen Lam-Omega pairs + auto fillGenOmPairs = [&](bool isAntiLam) { + int8_t wantType = isAntiLam ? (int8_t)kAntiLambda : (int8_t)kLambda; + for (const auto& lam : genLambdasAll) { + if (lam.lambdaMcGenCollisionId() != thisColId) + continue; + if (lam.v0Type() != wantType || lam.v0PrmScd() != (int8_t)kPrimary) + continue; + if (std::abs(lam.rap()) > maxY) + continue; + for (const auto& om : genOmegas) { + if (std::abs(om.pdgCode()) != 3334) + continue; // inline PDG filter + if (!om.isPhysicalPrimary()) + continue; + float omY = RecoDecay::y(std::array{om.px(), om.py(), om.pz()}, MassOmegaMinus); + if (std::abs(omY) > maxY) + continue; + float dphi = RecoDecay::constrainAngle(om.phi() - lam.phi(), -PIHalf); + float dy = omY - lam.rap(); + bool isOmPlus = (om.pdgCode() == -3334); + if (!isAntiLam && !isOmPlus) + histos.fill(HIST("McGen/Pairs/Lam_OmM/hDeltaPhiDeltaY"), centVal, dphi, dy); + else if (!isAntiLam && isOmPlus) + histos.fill(HIST("McGen/Pairs/Lam_OmP/hDeltaPhiDeltaY"), centVal, dphi, dy); + else if (isAntiLam && !isOmPlus) + histos.fill(HIST("McGen/Pairs/AntiLam_OmM/hDeltaPhiDeltaY"), centVal, dphi, dy); + else + histos.fill(HIST("McGen/Pairs/AntiLam_OmP/hDeltaPhiDeltaY"), centVal, dphi, dy); + } + } + }; + fillGenOmPairs(false); + fillGenOmPairs(true); + } + PROCESS_SWITCH(LambdaXiCorrelation, processMCGenOmega, "MC gen-level Λ–Ω closure", false); +}; + +WorkflowSpec defineDataProcessing(ConfigContext const& cfgc) +{ + return WorkflowSpec{ + + adaptAnalysisTask(cfgc), + adaptAnalysisTask(cfgc), + // adaptAnalysisTask(cfgc), + adaptAnalysisTask(cfgc), + // adaptAnalysisTask(cfgc), + adaptAnalysisTask(cfgc) + + }; +}